{ "ocid": "ocds-x-licitia-la-38-90u-03890u001-n-19-2024", "id": "LA-38-90U-03890U001-N-19-2024", "date": "2024-05-29T19:00:00.000Z", "language": "es", "initiationType": "tender", "tag": [ "tender", "award", "contract" ], "parties": [ { "id": "CIQA", "name": "CIQA", "roles": [ "buyer" ] }, { "id": "ISAEL DE SANTIAGO RODRIGUEZ", "name": "ISAEL DE SANTIAGO RODRIGUEZ", "roles": [ "supplier" ] }, { "id": "VECO SA DE CV", "name": "VECO SA DE CV", "roles": [ "supplier" ] }, { "id": "COLIN INGENIERIA SA DE CV", "name": "COLIN INGENIERIA SA DE CV", "roles": [ "supplier" ] }, { "id": "JESUS MANUEL RESENDIZ BOONE", "name": "JESUS MANUEL RESENDIZ BOONE", "roles": [ "supplier" ] }, { "id": "JOSE ANGEL CARRAL NARRO", "name": "JOSE ANGEL CARRAL NARRO", "roles": [ "supplier" ] }, { "id": "MIGUEL ANGEL DYER HERRERA", "name": "MIGUEL ANGEL DYER HERRERA", "roles": [ "supplier" ] }, { "id": "EL CRISOL SA DE CV", "name": "EL CRISOL SA DE CV", "roles": [ "supplier" ] }, { "id": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "name": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "roles": [ "supplier" ] }, { "id": "APPLIED BIOSYSTEMS DE MEXICO S DE RL DE CV", "name": "APPLIED BIOSYSTEMS DE MEXICO S DE RL DE CV", "roles": [ "supplier" ] }, { "id": "HELS DE AGUASCALIENTES SA DE CV", "name": "HELS DE AGUASCALIENTES SA DE CV", "roles": [ "supplier" ] } ], "buyer": { "id": "CIQA", "name": "CIQA" }, "tender": { "id": "LA-38-90U-03890U001-N-19-2024", "title": "MATERIAL DIVERSO MAYO", "description": "MATERIAL DIVERSO MAYO", "status": "complete", "procurementMethod": "open", "procurementMethodDetails": "LICITACIÓN PÚBLICA", "mainProcurementCategory": "goods", "tenderPeriod": { "startDate": "2024-05-09T15:37:28.000Z", "endDate": "2024-05-23T15:00:00.000Z" }, "awardPeriod": { "endDate": "2024-05-29T19:00:00.000Z" }, "items": [ { "id": "0", "description": "JUEGO DE TORNILLO Y TUERCA DE CIERRE PARA TAPA DE AUTOCLAVE FABRICADOS DE ACERO INOXIDABLE 10 CM DE LARGO X 3/8, ASEGURAR BIEN EL DISEÑO Y LAS MEDIDAS. EL EQUIPO ES MARCA EVAR, MODELO EV36D.", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 800, "currency": "MXN" } } }, { "id": "0", "description": "HIPOCLORITO DE SODIO AL 12%, PORRON DE 20 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 746.47, "currency": "MXN" } } }, { "id": "0", "description": "HIDRÓXIDO DE SODIO GRADO INDUSTRIAL 20 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 930.98, "currency": "MXN" } } }, { "id": "0", "description": "REACTOR HIDROTERMAL DE 20 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5000, "currency": "MXN" } } }, { "id": "0", "description": "REACTOR HIDROTERMAL DE 250 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 12500, "currency": "MXN" } } }, { "id": "0", "description": "VÁLVULA DE SEGURIDAD PARA REACTOR", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 900, "currency": "MXN" } } }, { "id": "0", "description": "KIT DE EMPAQUES PARA REACTOR", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 300, "currency": "MXN" } } }, { "id": "0", "description": "RESISTENCIA ELECTRICA PARA REACTOR DE 2.5 \" DE DIÁMETRO.", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2000, "currency": "MXN" } } }, { "id": "0", "description": "KIT DE CONEXIONES ELECTRICAS PARA REACTOR DE 2.5 \" DE DIÁMETRO", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 400, "currency": "MXN" } } }, { "id": "0", "description": "MASCARILLA PARA SOLVENTES ORGÁNICOS Y VAPORES ÁCIDOS (TALLA L) SKU Z197130-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2350, "currency": "MXN" } } }, { "id": "0", "description": "MOLDE PARA RESINAS ESTIRENICAS", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 38800, "currency": "MXN" } } }, { "id": "0", "description": "PORTAMUESTRAS CILÍNDRICO DE ALUMINIO SOBRE DISEÑO 1\" DIÁMETRO X 1\" ALTURA. ESTAS PIEZAS SON PARA MEJORAR EL SISTEMA DE PLASMA JET ATMOSFÉRICO CON EL QUE SE VA A ACTIVAR EL AGUA. ES PARA HACER MÁS EFICIENTE EL SISTEMA ACTUAL. DELTA REACTOTY ISR-CIQ-GS014-1", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 500, "currency": "MXN" } } }, { "id": "0", "description": "PORTAMUESTRAS 1\" DIAMETRO X 1/2\" ALTURA. ESTAS PIEZAS SON PARA MEJORAR EL SISTEMA DE PLASMA JET ATMOSFÉRICO CON EL QUE SE VA A ACTIVAR EL AGUA. ESTAS PIEZAS SON PARA MEJORAR EL SISTEMA DE PLASMA JET ATMOSFÉRICO CON EL QUE SE VA A ACTIVAR EL AGUA. ES PARA HACER MÁS EFICIENTE EL SISTEMA ACTUAL. DELTA REACTOTY ISR-CIQ-GS014-2", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 300, "currency": "MXN" } } }, { "id": "0", "description": "REACTOR DE PLASMA JET SOBRE DISEÑO, CÁMARA DIELECTRICA, ELECTRODO INOX. OVOIDE, BOQUILLA INOX.ESTAS PIEZAS SON PARA MEJORAR EL SISTEMA DE PLASMA JET ATMOSFÉRICO CON EL QUE SE VA A ACTIVAR EL AGUA. ESTAS PIEZAS SON PARA MEJORAR EL SISTEMA DE PLASMA JET ATMOSFÉRICO CON EL QUE SE VA A ACTIVAR EL AGUA. ES PARA HACER MÁS EFICIENTE EL SISTEMA ACTUAL. DELTA REACTOTY ISR-CIQ-GS014-3", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5700, "currency": "MXN" } } }, { "id": "0", "description": "COMPRA DE ADAPTADOR PARA SONOTRODO", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4500, "currency": "MXN" } } }, { "id": "0", "description": "RESISTENCIA TIPO CARTUCHO DE 3/8\" DIÁMETRO X 4\" LARGO,\nCON 220V 250W, TERMINALES FLEXIBLES 150 CM DE LARGO,\nCON TUBO FLEXIBLE DE 45 CM DE LARGO.", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 12, "unit": { "name": "PIEZA", "value": { "amount": 1900, "currency": "MXN" } } }, { "id": "0", "description": "MOLDE PARA CURADO DE RESINAS ESTIRENICAS", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 38800, "currency": "MXN" } } }, { "id": "0", "description": "SERVICIO DE MANTENIMIENTO GENERAL Y DE UNA BOMBA DE VACIO ROTATORIA MARCA EDWARDS MODELO RV12 NO DE SERIE 149524189", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 5500, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A PLASTICORDER ATR-2120", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 50000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A PLASTICORDER PL2200", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 50000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO EQUIPO DESHUMIDIFICADOR CONAIR", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 50000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A PRENSA HIDRÁULICA (CALIENTE)", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 3000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A PRENSA HIDRÁULICA (FRIA)", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 3000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A CÁMARA DE MEZCLADO (PREP-MIXER)", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 20000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A CÁMARA DE MEZCLADO CHICA (MIXER/MEASURING HEAD) 3 ZONAS", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 17500, "currency": "MXN" } } }, { "id": "0", "description": "FILTRO DE CARBONO GRANULADO PARA SISTEMAS DE EXTRACCIÓN DE CAMPANAS EXTRACTORAS CON LAS SIGUIENTES MEDIDAS ESTÁNDARES DE 24*24*2 PULGADAS EN CARCASA METALICA.", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 112, "unit": { "name": "PIEZA", "value": { "amount": 2498, "currency": "MXN" } } }, { "id": "0", "description": "FILTRO DE PLIEGUE PARA SISTEMAS DE EXTRACCIÓN DE CAMPANAS EXTRACTORAS DE LABORATORIOS CON MARCO DE CARTÓN. LAS MEDIDAS DE LOS FILTROS SON: 24*24*2 PULGADAS. SISTEMA DE FILTRADO ES MER 12.", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 28, "unit": { "name": "PIEZA", "value": { "amount": 158, "currency": "MXN" } } }, { "id": "0", "description": "SUMINISTRO E INSTALACIÓN DE BOMBA NUEVA DIÉSEL\nPARA PLANTA DE EMERGENCIA DE 100 KW, MOTOR\nCUMMINS, GENERADOR MARCA WEG MODELO GTA,\nUBICADO EN CAMPO EXPERIMENTAL AGRÍCOLA, EL\nPRECIO INCLUYE: RETIRO DE BOMBA ACTUAL,\nMISCELÁNEOS, PRUEBAS Y TODO LO NECESARIO\nPARA SU PUESTA EN MARCHA.", "classification": { "scheme": "CUCOP", "id": "35101-0001" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 72000, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE EQUIPO DE AIRE ACONDICIONADO DE EDIFICIO G PLANTA ALTA DE ACUERDO A WORD ANEXO", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 137145, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE EQUIPO DE AIRE ACONDICIONADO DE EDIFICIO G PLANTA BAJA DE ACUERDO A WORD ANEXO", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 118620, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES LATEX SIN POLVO TALLA CHICA (CAJA)", "classification": { "scheme": "CUCOP", "id": "25501-0033" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 142, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES LATEX SIN POLVO TALLA MEDIANA (CAJA)", "classification": { "scheme": "CUCOP", "id": "25501-0033" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 142, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES LATEX SIN POLVO TALLA GRANDE (CAJA)", "classification": { "scheme": "CUCOP", "id": "25501-0033" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 142, "currency": "MXN" } } }, { "id": "0", "description": "GUILLOTINA MAE 12X15 METÁLICA", "classification": { "scheme": "CUCOP", "id": "21101-0020" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1750, "currency": "MXN" } } }, { "id": "0", "description": "SELLO DE RECIBIDO DE LA UNIDAD DE TRANSPARENCIA CON FECHA Y LOGO (EN BASE A MUESTRA)", "classification": { "scheme": "CUCOP", "id": "21101-0194" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 610, "currency": "MXN" } } }, { "id": "0", "description": "SELLO DE RECIBIDO DEL COMITE DE ETICA CON FECHA Y LOGO (EN BASE A MUESTRA)", "classification": { "scheme": "CUCOP", "id": "21101-0194" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 610, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE CARTON DURO TAMAÑO CARTA PARA EL ARCHIVO 31 CM X 50 CM X 25 CM (LARGO X ANCHO X ALTURA )", "classification": { "scheme": "CUCOP", "id": "21101-0034" }, "quantity": 100, "unit": { "name": "PIEZA", "value": { "amount": 72, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PAPEL DE DOBLE PARED - 12 OZ, BLANCOS 600/CAJA AISLANTE DE DOBLE PARED", "classification": { "scheme": "CUCOP", "id": "22104-0011" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2400, "currency": "MXN" } } }, { "id": "0", "description": "REPARACIÓN DE PISOS CERAMICOS EN EDIFICIOS D, E, G, H Y POSGRADO (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 67850, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE RAMPAS CIQA (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 85320, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE GRIETAS EN MUROS EDIFICIO B (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 38600, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE MUROS Y CAJILLOS DE TABLARROCA (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 46300, "currency": "MXN" } } }, { "id": "0", "description": "IMPERMEABILIZANTE PARA EDIFICIOS (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 2810000, "currency": "MXN" } } }, { "id": "0", "description": "SUMINISTRO E INSTALACIÓN DE MARCO DE PUERTA PARA INVERTIR SENTIDO DE APERTURA EDIFICIO A (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 33420, "currency": "MXN" } } }, { "id": "0", "description": "PINTURA EN EDIFICIO CIQA - PIIT EN APODACA NUEVO LEÓN (DE ACUERDO A ANEXO \"CATALOGO DE OBRA 2 2024\")", "classification": { "scheme": "CUCOP", "id": "35102-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 122900, "currency": "MXN" } } }, { "id": "0", "description": "DESBROZADORA MARCA STIHL, MODELO FS250: PARA TRABAJOS DE CORTE DUROS Y DE GRAN ENVERGADURA. SISTEMA ANTIVIBRACIÓN DE 1 PUNTO, STIHL ELASTOSTART, EMPUÑADURA MULTIFUNCIÓN, EMPUÑADURA DE BICICLETA, AJUSTE DE LA EMPUÑADURA SIN HERRAMIENTAS. CILINDRADA 40.2 CCM, POTENCIA 1.6 KW - 2.2 ZPS.", "classification": { "scheme": "CUCOP", "id": "29101-0343" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 13500, "currency": "MXN" } } }, { "id": "0", "description": "MANGUERA INDUSTRIAL PARA JARDIN DE 20 METROS", "classification": { "scheme": "CUCOP", "id": "29101-0086" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 600, "currency": "MXN" } } }, { "id": "0", "description": "TUBO HIDRÁULICO DE PVC 3/4\" CED. 40-160PSI", "classification": { "scheme": "CUCOP", "id": "29101-0048" }, "quantity": 6, "unit": { "name": "LITRO", "value": { "amount": 150, "currency": "MXN" } } }, { "id": "0", "description": "TEE HIDRAULICO DE PVC DE 1-1/4\" CED 40-160 PSI", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 25, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE CARNAZA AZULES REFORZADOS PARA SOLDADOR DE PUÑO LARGO DE SEGURIDAD DE 6\" MARCA TRUPER CÓDIGO 15246 MODELO GU-515", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 265, "currency": "MXN" } } }, { "id": "0", "description": "TIJERA MANUAL PARA PODA MARCA STIHL MODELO PP30", "classification": { "scheme": "CUCOP", "id": "29101-0280" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 750, "currency": "MXN" } } }, { "id": "0", "description": "AZADONES LANE TRUPER CON MANGO DE FIBRA DE VIDRIO DE 54\" Y GRIP DE 9\" CON UNA CABEZA DE 8\" CON CODIGO 10618", "classification": { "scheme": "CUCOP", "id": "29101-0019" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 450, "currency": "MXN" } } }, { "id": "0", "description": "AZADONES LANE TRUPER CON MANGO DE ACERO DE 54\" Y GRIP DE 9\" CON UNA CABEZA DE 8\" CON CÓDIGO 103106", "classification": { "scheme": "CUCOP", "id": "29101-0019" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 450, "currency": "MXN" } } }, { "id": "0", "description": "DISCO LAMINADOS 4-1/2\" X 7/8\" DE PULGADA", "classification": { "scheme": "CUCOP", "id": "29101-0084" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 90, "currency": "MXN" } } }, { "id": "0", "description": "ESMALTE ANTICORROSIVO DE LARGA DURACIÓN PARA PROTECCIÓN DE METAL AL INTEMPERIE COLOR BLANCO (1 GALÓN)", "classification": { "scheme": "CUCOP", "id": "29101-0316" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 800, "currency": "MXN" } } }, { "id": "0", "description": "VÁLVULA DE FONDO (PIE): PICHANCHA METÁLICA 1-1/4\", PARA FLUJO DEL AGUA SIN RETORNOS Y CON REJILLA DE SUCCIÓN EN ACERO INOXIDABLE PARA EVITAR EL PASO DE SÓLIDO.", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 360, "currency": "MXN" } } }, { "id": "0", "description": "CARRETE DE HILO REDONDO PARA DESBROZADORA STIHL DE 2.4MM DE 253 METROS COLOR NARANJA", "classification": { "scheme": "CUCOP", "id": "29101-0325" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 710, "currency": "MXN" } } }, { "id": "0", "description": "CARETA PROFESIONAL CON PANEL DIGITAL PARA SOLDAR, CON DESACTIVADOR GRADUAL DE SOMBRA MARCA TRUPER CÓDIGO 14632, MODELO: CAREL-913 DX, CON VEL. DE OSCURECIMIENTO DE 1/30,000S (AUTOMÁTICO), CON VISTA PANORÁMICA DE 10X6 CM Y PANEL DIGITAL CON SOMBRA N° 4 EN ESTADO PASIVO", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2700, "currency": "MXN" } } }, { "id": "0", "description": "SOLDADORA PORTÁTIL INVERSOR ELEC 200A 110-220 PROFESIONAL ENERGY P113 COLOR AZUL", "classification": { "scheme": "CUCOP", "id": "29101-0265" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3350, "currency": "MXN" } } }, { "id": "0", "description": "ACEITE LUBRICANTE PARA MOTOR A GASOLINA DOS TIEMPOS ( STIHL | STIHL ACEITE PARA MOTOR DE 2 TIEMPOS 3.785 LITROS)", "classification": { "scheme": "CUCOP", "id": "26102-0003" }, "quantity": 6, "unit": { "name": "LITRO", "value": { "amount": 1400, "currency": "MXN" } } }, { "id": "0", "description": "GENERADOR DE ELECTRICIDAD PORTATIL A GASOLINA 4000W CON RUEDAS DEWALT", "classification": { "scheme": "CUCOP", "id": "24601-0109" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 21000, "currency": "MXN" } } }, { "id": "0", "description": "M12 TALADRO ROTOMARTILLO INALÁMBRICO DE 3/8\" DE 12V CON 2 BATERÍAS DE 1.5 AH, CARGADOR Y ESTUCHE", "classification": { "scheme": "CUCOP", "id": "29101-0272" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3800, "currency": "MXN" } } }, { "id": "0", "description": "MILWAUKEE 4932459596 - CINTA MÉTRICA COMPACTA DE 8 M, COLOR ROJO", "classification": { "scheme": "CUCOP", "id": "29101-0043" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 450, "currency": "MXN" } } }, { "id": "0", "description": "PINZAS ALTO PODER PARA ELECTRICISTA 8 PULGADAS ACERO TULMEX", "classification": { "scheme": "CUCOP", "id": "29101-0307" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 395, "currency": "MXN" } } }, { "id": "0", "description": "URREA HERRAMIENTAS 353F URREA ARCO DE SEGUETA FIJO ALTA TENSIÓN 12\"", "classification": { "scheme": "CUCOP", "id": "29101-0013" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 320, "currency": "MXN" } } }, { "id": "0", "description": "TAPÓN CACHUCHA 2\" ROSCAR, HIDRÁULICO PVC", "classification": { "scheme": "CUCOP", "id": "24901-0062" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 45, "currency": "MXN" } } }, { "id": "0", "description": "COPLES DE 1 PULGADA, HIDRÁULICOS PVC BLANCO", "classification": { "scheme": "CUCOP", "id": "24901-0011" }, "quantity": 20, "unit": { "name": "PIEZA", "value": { "amount": 15, "currency": "MXN" } } }, { "id": "0", "description": "TEE 1/2 PULGADA, HIDRÁULICO PVC, PARA CEMENTAR", "classification": { "scheme": "CUCOP", "id": "24901-0047" }, "quantity": 20, "unit": { "name": "PIEZA", "value": { "amount": 15, "currency": "MXN" } } }, { "id": "0", "description": "TEE 3/4 PULGADA, HIDRÁULICO PVC, PARA CEMENTAR", "classification": { "scheme": "CUCOP", "id": "24901-0047" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 15, "currency": "MXN" } } }, { "id": "0", "description": "TEE 1 1/2 PULGADA, HIDRÁULICO PVC, PARA CEMENTAR", "classification": { "scheme": "CUCOP", "id": "24901-0047" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 35, "currency": "MXN" } } }, { "id": "0", "description": "VÁLVULA DE ESFERA DE 1 PLG, PVC, HIDRÁULICA ECONOMICA", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 115, "currency": "MXN" } } }, { "id": "0", "description": "COPLE DE 1 1/2 PULGADA, PVC BLANCO, HIDRÁULICO", "classification": { "scheme": "CUCOP", "id": "24901-0011" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 25, "currency": "MXN" } } }, { "id": "0", "description": "COPLE DE 1/2 DE PULGADA, PVC PARA CEMENTAR, HIDRÁULICO", "classification": { "scheme": "CUCOP", "id": "24901-0011" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 15, "currency": "MXN" } } }, { "id": "0", "description": "ROLLO DE MAGUERA PARA SISTEMA DE RIEGO DE 13 MM DE 304 METROS DE LARGO", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2690, "currency": "MXN" } } }, { "id": "0", "description": "PTR DE 6 M DE 4\" CALIBRE 16", "classification": { "scheme": "CUCOP", "id": "24901-0047" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 1250, "currency": "MXN" } } }, { "id": "0", "description": "LÁMINA ACANALADA DE 1.1 × 6", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 18, "unit": { "name": "PIEZA", "value": { "amount": 1400, "currency": "MXN" } } }, { "id": "0", "description": "ÁNGULO DE 6 M DE 2\" × 1/8", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 630, "currency": "MXN" } } }, { "id": "0", "description": "CONTRACANASTA PARA FREGADERO DE ACERO INOXIDABLE 8.6 CM PLATA MARCA URREA O RUGO", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 400, "currency": "MXN" } } }, { "id": "0", "description": "LLAVE INDIVIDUAL PARA FREGADERO DE CUELLO LARGO MARCA RUGO O URREA", "classification": { "scheme": "CUCOP", "id": "24901-0062" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 420, "currency": "MXN" } } }, { "id": "0", "description": "TARJA SENCILLA DE ACERO INOXIDABLE CON ESCURRIDOR Y PEDESTAL TOTALMENTE DE ACERO INOXIDABLE", "classification": { "scheme": "CUCOP", "id": "24901-0062" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1400, "currency": "MXN" } } }, { "id": "0", "description": "LENTES DE SEGURIDAD 3M, TRANSPARENTE PAQUETE CON 4 UNIDADES", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 310, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO ORIGINAL PARA IMPRESORA HP 36 A CB436A", "classification": { "scheme": "CUCOP", "id": "29401-0054" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2328.102, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO ORIGINAL DE TINTA HP 96 NEGRA HP C8767WL", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1890, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO DE TINTA HP 97 TRICOLOR ORIGINAL HP C9363WL", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1688.442, "currency": "MXN" } } }, { "id": "0", "description": "HORNO HAMILTON BEACH 31401 (CAPACIDAD 12 LTS)", "classification": { "scheme": "CUCOP", "id": "29501-0009" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1820.672, "currency": "MXN" } } }, { "id": "0", "description": "MARCADORES SHARPIE DE VARIOS COLORES, PAQUETE CON 24 PIEZAS", "classification": { "scheme": "CUCOP", "id": "21101-0259" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 622.804, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINA PARA IMPRESORA DE CREDENCIALES ZEBRA SXP SERIE 1 ZEBRA TRUE COLORES", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 614.306, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL PARA IMPRESORA HP LÁSER JET PRO 400 MPF 80A CF280A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3040.17, "currency": "MXN" } } }, { "id": "0", "description": "TONNERS ORIGINAL PARA IMPRESORA HP LASERJET 17A CF217A EN COLOR NEGRO", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 1648.626, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL PARA IMPRESORA 83A HP LASERJET PRO, TINTA NEGRA", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1893.626, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL PARA IMPRESORAS COLOR NEGRO 500A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 1823.626, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL COLOR AZUL 501A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2207.408, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL COLOR AMARILLO 502A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2207.408, "currency": "MXN" } } }, { "id": "0", "description": "TONER ORIGINAL COLOR ROSA 503A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2207.408, "currency": "MXN" } } }, { "id": "0", "description": "CERRADURA PARA PERFIL DE ALUMINIO PHILLIPS MODELO 3055, COLO GRIS", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 698.726, "currency": "MXN" } } }, { "id": "0", "description": "CERRADURA PARA PERFIL DE ALUMINIO PHILLIPS MODELO 550, COLO GRIS", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 583.044, "currency": "MXN" } } }, { "id": "0", "description": "HILO REDONDO PARA DESBROZADORA DE 2MM X 120M, MARCA TRUPER, MODELO HLB-80, 17608", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 173.978, "currency": "MXN" } } }, { "id": "0", "description": "MEZCLADORA CROMADA DE 8´´ PARA FREGADERO CUELLO LARGO", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 489.846, "currency": "MXN" } } }, { "id": "0", "description": "MEZCLADORA MONOMANDO P/FREGADERO FELXIBLE", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2013.06, "currency": "MXN" } } }, { "id": "0", "description": "CABLE VGA DE 4 METROS", "classification": { "scheme": "CUCOP", "id": "21401-0024" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 138.6, "currency": "MXN" } } }, { "id": "0", "description": "HD WEBCAM C920S PRO", "classification": { "scheme": "CUCOP", "id": "21401-0024" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 3078.6, "currency": "MXN" } } }, { "id": "0", "description": "DACE DISPENSADOR DE AGUA EAPT01, 20 LITROS, PLATA", "classification": { "scheme": "CUCOP", "id": "29301-0020" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 3521.756, "currency": "MXN" } } }, { "id": "0", "description": "CAJA CON 250 PIEZAS DE PLATOS DESHECHABLES SEMIGRUESO 7* PARA EVENTOS DEL CENTRO\nPAPEL RECUBIERTO RESISTENTES A LA GRASA, APTOS PARA MICROONDAS, ACABADO LISO", "classification": { "scheme": "CUCOP", "id": "24801-0084" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 800.8, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE PLATOS CON 330 PZS DESHECHABLES SEMIGRUESO 9* PARA EVENTOS DEL CENTRO\nPAPEL RECUBIERTO RESISTENTES A LA GRASA, APTOS PARA MICROONDAS. ACABADO LISO", "classification": { "scheme": "CUCOP", "id": "24801-0084" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1262.8, "currency": "MXN" } } }, { "id": "0", "description": "CAJA CON 12 ROLLOS ULINE EASY-SIZET\nDE ALTA CALIDAD , HOJAS PERFORADAS CADA 6\". ROLLO JUMBO, HOJAS GRUESAS DOBLES.\nDIMENSIONES:\nNÚCLEO: 1 1/2\"\nDIÁMETRO DEL ROLLO: 5 1/2\"", "classification": { "scheme": "CUCOP", "id": "24801-0084" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1139.6, "currency": "MXN" } } }, { "id": "0", "description": "TUERCAS HEXAGONALES DE 1/4 DE PULGADA PLATA", "classification": { "scheme": "CUCOP", "id": "29101-0045" }, "quantity": 300, "unit": { "name": "PIEZA", "value": { "amount": 0.546, "currency": "MXN" } } }, { "id": "0", "description": "TUERCAS HEXAGONALES DE 3/8 DE PULGADA PLATA", "classification": { "scheme": "CUCOP", "id": "29101-0045" }, "quantity": 300, "unit": { "name": "PIEZA", "value": { "amount": 0.868, "currency": "MXN" } } }, { "id": "0", "description": "TORNILLOS PARA TABLAROCA DE 1/4 PULGADA NEGRO", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 1.666, "currency": "MXN" } } }, { "id": "0", "description": "TORNILLOS PARA TABLAROCA DE 3/4 PULGADA NEGRO", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 0.084, "currency": "MXN" } } }, { "id": "0", "description": "TORNILLOS PARA TABLAROCA DE 1/2 PULGADA NEGRO", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 0.084, "currency": "MXN" } } }, { "id": "0", "description": "TORNILLOS PARA TABLAROCA DE 1´´ PULGADA NEGRO", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 0.126, "currency": "MXN" } } }, { "id": "0", "description": "TORNILLOS PARA TABLAROCA DE 2´´ PULGADA NEGRO", "classification": { "scheme": "CUCOP", "id": "29101-0228" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 0.336, "currency": "MXN" } } }, { "id": "0", "description": "TAQUETE PLASTICO DE 1/4´´", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 300, "unit": { "name": "PIEZA", "value": { "amount": 0.532, "currency": "MXN" } } }, { "id": "0", "description": "CINCHOS AMARRA CABLES BLANCO 10 CM DE LARGO", "classification": { "scheme": "CUCOP", "id": "29101-0134" }, "quantity": 600, "unit": { "name": "PIEZA", "value": { "amount": 0.154, "currency": "MXN" } } }, { "id": "0", "description": "CINCHOS AMARRA CABLES BLANCO 20 CM DE LARGO", "classification": { "scheme": "CUCOP", "id": "29101-0134" }, "quantity": 600, "unit": { "name": "PIEZA", "value": { "amount": 0.616, "currency": "MXN" } } }, { "id": "0", "description": "CINCHOS AMARRA CABLES BLANCO 15 CM DE LARGO", "classification": { "scheme": "CUCOP", "id": "29101-0134" }, "quantity": 600, "unit": { "name": "PIEZA", "value": { "amount": 0.35, "currency": "MXN" } } }, { "id": "0", "description": "GUILLOTINA MAE 12X15 METÁLICA", "classification": { "scheme": "CUCOP", "id": "21101-0020" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2378.6, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO DE TINTA HP 711 NEGRA DESIGNJET ORIGINAL CZ129A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1229.83, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO DE TINTA HP 711 MAGENTA DESIGNJET ORIGINAL CZ131A 769", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1024.66, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO DE TINTA HP 711 AMARILLO DESIGNJET ORIGINAL CZ132A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1024.66, "currency": "MXN" } } }, { "id": "0", "description": "CARTUCHO DE TINTA HP 711 CIAN DESIGNJET ORIGINAL CZ130A", "classification": { "scheme": "CUCOP", "id": "21201-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1024.66, "currency": "MXN" } } }, { "id": "0", "description": "SOPLADOR DE HOJAS ELÉCTRICO DE 21V, 350 CFM, 150 MPH CON BATERÍA DE 4.0 AH Y CARGADOR, 6 VELOCIDADES AJUSTABLES", "classification": { "scheme": "CUCOP", "id": "29101-0334" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2719.598, "currency": "MXN" } } }, { "id": "0", "description": "EXTENSIÓN ELÉCTRICA CON CARRETE IUSA 14 AWG, 12 METROS", "classification": { "scheme": "CUCOP", "id": "24601-0094" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1255.8, "currency": "MXN" } } }, { "id": "0", "description": "KOBLENZMULTICONTACTOS CON SUPRESOR DE PICOS", "classification": { "scheme": "CUCOP", "id": "24601-0098" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 566.804, "currency": "MXN" } } }, { "id": "0", "description": "BOLSAS ECOLÓGICAS PARA BASURA DE 55-60 GALONES DE CAPACIDAD, DE 39 X 58\" (CAJA CON 100 PZS)", "classification": { "scheme": "CUCOP", "id": "21601-0075" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2217.6, "currency": "MXN" } } }, { "id": "0", "description": "LLANTAS MARCA MICHELIN MEDIDA 205/65 R 16 PARA AUTO BORA VW N° 21. INCLUYE: MONTAJE, VALVULA Y BALANCEO.", "classification": { "scheme": "CUCOP", "id": "35501-0005" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 4598.272, "currency": "MXN" } } }, { "id": "0", "description": "TRÍPODE CUADRÚPEDO SELFIE STICK DE 180 CM CON MANDO A DISTANCIA RECARGABLE DESMONTABLE, TRÍPODE EXTENSIBLE CON ASA DE EQUILIBRIO DE 360°", "classification": { "scheme": "CUCOP", "id": "24801-0020" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 798, "currency": "MXN" } } }, { "id": "0", "description": "MOCHILA PARA FUMIGAR CON MOTOR A GASOLIDA DE DOS TIEMPOS MARCA HUSKY DE 25 LITROS DE CAPACIDAD", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2994.6, "currency": "MXN" } } }, { "id": "0", "description": "FUMIGADORA MANUAL 20 LITROS SWEDISH HUSKY POWER REL20EA", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 973, "currency": "MXN" } } }, { "id": "0", "description": "ESCALERA TELESCOPICA DE ALUMINO DE 10 METROS", "classification": { "scheme": "CUCOP", "id": "29101-0073" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7527.982, "currency": "MXN" } } }, { "id": "0", "description": "ESCALERA DE ALUMINIO DE TIJERA 10 PIES DE ALTURA", "classification": { "scheme": "CUCOP", "id": "29101-0073" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2048.816, "currency": "MXN" } } }, { "id": "0", "description": "CILINDRO DE GAS LP DE 20 KG", "classification": { "scheme": "CUCOP", "id": "29101-0041" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2312.24, "currency": "MXN" } } }, { "id": "0", "description": "ESCOBA DE METAL PARA JARDIN", "classification": { "scheme": "CUCOP", "id": "29101-0075" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 138.11, "currency": "MXN" } } }, { "id": "0", "description": "RASTRILLO DE METAL PARA JARDIN", "classification": { "scheme": "CUCOP", "id": "29101-0248" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 234.066, "currency": "MXN" } } }, { "id": "0", "description": "HILO REDONDO STIHL DE 2.4MM DE 869 METROS", "classification": { "scheme": "CUCOP", "id": "29101-0325" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 3430, "currency": "MXN" } } }, { "id": "0", "description": "CABEZAL DE REPUESTO PARA DESBROZADORA STIHL FS 250 2.2 HP AUTOCUT27-2", "classification": { "scheme": "CUCOP", "id": "29101-0325" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 299.6, "currency": "MXN" } } }, { "id": "0", "description": "HT 75 PODADORA DE ALTURA, 30CM/12\", 61PMM3\nREF. 41382000054", "classification": { "scheme": "CUCOP", "id": "29101-0280" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 18898.6, "currency": "MXN" } } }, { "id": "0", "description": "GALON DE PINTURA COLOR VERDE MARCA JOHN DEERE", "classification": { "scheme": "CUCOP", "id": "24901-0032" }, "quantity": 1, "unit": { "name": "GALON", "value": { "amount": 4198.6, "currency": "MXN" } } }, { "id": "0", "description": "CINTA DE AISLAR 18MX19MM MARCA TRUPER EXPERT 1 PAQUETE CON 8 PZAS CODIGO 19954 CLAVE M-33X COLOR NEGRO CON UN ESPESOR DE 0.20 MM Y ELONGACIÓN DE 280%", "classification": { "scheme": "CUCOP", "id": "24601-0027" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 15.218, "currency": "MXN" } } }, { "id": "0", "description": "TAPÓN CACHUCHA O CAPA, HIDRÁULICO DE PVC 1\" CED. 40-160 PSI", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 12.418, "currency": "MXN" } } }, { "id": "0", "description": "CINTAS SELLA ROSCAS (TEFLON) DE 3/4\" MARCA TRUPER 7 M DE LARGO CÓDIGO 12521, CLAVE CTF-3/4", "classification": { "scheme": "CUCOP", "id": "29101-0342" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 10.766, "currency": "MXN" } } }, { "id": "0", "description": "COPLE HIDR. PVC CEMENTAR 1\" CED. 40- 160 PSI", "classification": { "scheme": "CUCOP", "id": "29101-0046" }, "quantity": 25, "unit": { "name": "PIEZA", "value": { "amount": 4.186, "currency": "MXN" } } }, { "id": "0", "description": "TUBO HIDRAULICO DE PVC 1-1/4\" CED. 40-160PSI", "classification": { "scheme": "CUCOP", "id": "29101-0048" }, "quantity": 6, "unit": { "name": "LITRO", "value": { "amount": 235.088, "currency": "MXN" } } }, { "id": "0", "description": "ACEITE DE DOS TIEMPOS DE 400 ML (14 OZ) MARCA TRUPER CODIGO 17625 CLAVE ACEWS-20", "classification": { "scheme": "CUCOP", "id": "29101-0003" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 147.392, "currency": "MXN" } } }, { "id": "0", "description": "CINTA GRIS PARA DUCTOS DE REPARACION MULTIUSOS 48 MM POR 50 M", "classification": { "scheme": "CUCOP", "id": "29101-0342" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 160.832, "currency": "MXN" } } }, { "id": "0", "description": "CEMENTO PVC GRIS ¼ DE LITRO", "classification": { "scheme": "CUCOP", "id": "29101-0084" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 291.256, "currency": "MXN" } } }, { "id": "0", "description": "LANZA 12055 REFACCIÓN PARA ASPERSORA FUM-20 MARCA TRUPER, CÓDIGO FUM-085 (VARILLA)", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 637, "currency": "MXN" } } }, { "id": "0", "description": "ASPERSORA MANUAL DE MOCHILA MARCA TRUPER CAPACIDAD DE 20 L MODELO FUM-20 CÓDIGO 14193", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 658.238, "currency": "MXN" } } }, { "id": "0", "description": "FUMIGADORA ASPERSORA 25L DE DOBLE VARILLA MOTORIZADA 1HP DE 2 TIEMPOS 26 CC HUSKY HKF2515", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2994.6, "currency": "MXN" } } }, { "id": "0", "description": "ASPERSORA MANUAL DE MOCHILA MARCA TRUPER CAPACIDAD DE 12 L MODELO FUM-12 CÓDIGO 14195", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1470, "currency": "MXN" } } }, { "id": "0", "description": "SEMILLAS DE TOMATE DETERMINADO, SEMINIS VARIEDAD DRD8551. 1 MILLAR.", "classification": { "scheme": "CUCOP", "id": "23101-0070" }, "quantity": 1, "unit": { "name": "MILLAR", "value": { "amount": 3024, "currency": "MXN" } } }, { "id": "0", "description": "SEMILLAS DE JALAPEÑO, HARRIS MORAN VARIEDAD MIXTECO F1. (BOLSA CON 5 MILLARES)", "classification": { "scheme": "CUCOP", "id": "23101-0054" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8330, "currency": "MXN" } } }, { "id": "0", "description": "SEMILLAS DE TOMATE INDETERMINADO, HARRIS MORAN VARIEDAD RAMSES F1. (BOLSA CON 1 MILLAR.)", "classification": { "scheme": "CUCOP", "id": "23101-0070" }, "quantity": 1, "unit": { "name": "MILLAR", "value": { "amount": 5698, "currency": "MXN" } } }, { "id": "0", "description": "CILANTRO LONGSTANDING. 20 LIBRAS. KRISTEN SEEDS.", "classification": { "scheme": "CUCOP", "id": "23101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2098.6, "currency": "MXN" } } }, { "id": "0", "description": "FUMIGADORA ASPERSOR MANUAL SG20 STIHL TIPO MOCHILA COLOR BLANCO", "classification": { "scheme": "CUCOP", "id": "29801-0034" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3178, "currency": "MXN" } } }, { "id": "0", "description": "KANEMITE (ACEQUINOCYL) PRESENTACION DE 1 LITRO", "classification": { "scheme": "CUCOP", "id": "25201-0008" }, "quantity": 2, "unit": { "name": "LITRO", "value": { "amount": 3290, "currency": "MXN" } } }, { "id": "0", "description": "DISCO ABRASIVO PARA METAL DE 4 1/2 PULGADAS", "classification": { "scheme": "CUCOP", "id": "29101-0084" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 10.402, "currency": "MXN" } } }, { "id": "0", "description": "CINTA AISLANTE ELÉCTRICA DE VINILO 19 MM X 18 M NE", "classification": { "scheme": "CUCOP", "id": "29101-0342" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 15.218, "currency": "MXN" } } }, { "id": "0", "description": "CINTA PARA DUCTO 48 MM X 50 M GRIS TUK", "classification": { "scheme": "CUCOP", "id": "29101-0342" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 128.002, "currency": "MXN" } } }, { "id": "0", "description": "SOUTHLAND\nCINTA TEFLON 1\" X 260", "classification": { "scheme": "CUCOP", "id": "29101-0342" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 14.14, "currency": "MXN" } } }, { "id": "0", "description": "CEMENTO GRIS PARA PVC DE MEDIO LITRO", "classification": { "scheme": "CUCOP", "id": "24901-0026" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 267.792, "currency": "MXN" } } }, { "id": "0", "description": "CEMENTO GRIS PARA PVC DE UN CUARTO DE LITRO", "classification": { "scheme": "CUCOP", "id": "24901-0026" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 155.134, "currency": "MXN" } } }, { "id": "0", "description": "PIJAS TALADRANTE DE 1.5\" (BOLSA CON 100 PZA)", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 104.524, "currency": "MXN" } } }, { "id": "0", "description": "BROCA PARA FIERRO BOSCH HSS-G 5/8 PULGADAS", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 196.728, "currency": "MXN" } } }, { "id": "0", "description": "CHUPÓN UNIVERSAL COFLEX", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 22.204, "currency": "MXN" } } }, { "id": "0", "description": "CESPO PARA FREGADERO, TRAMPA CORRUGADA DE PVC 28 CM BLANCA", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 53.956, "currency": "MXN" } } }, { "id": "0", "description": "CONECTOR FLEXIBLE DE 55 CM COFLEX ALIMENTADOR DE 1/2\"", "classification": { "scheme": "CUCOP", "id": "24901-0001" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 85.05, "currency": "MXN" } } }, { "id": "0", "description": "BOLSA ZIPLOC 8X10 PULGADAS 20*25 CM (PAQUETE C/100)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 422.562, "currency": "MXN" } } }, { "id": "0", "description": "BOLSA ZIPLOC 2X2\" PULGADAS 5*5 CM (PAQUETE C/100)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 89.6, "currency": "MXN" } } }, { "id": "0", "description": "BOLSA ZIPLOC 6X5\" 15*13 CM (PAQUETE C/100)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 180.6, "currency": "MXN" } } }, { "id": "0", "description": "BOLSA ZIPLOC 4X4\" 10*10 CM (PAQUETE C/100)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 135.8, "currency": "MXN" } } }, { "id": "0", "description": "TAPONES AUDITIVOS DESECHABLES 3M (PAQUETE CON 80 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 290.08, "currency": "MXN" } } }, { "id": "0", "description": "ETIQUETAS RECTANGULARES TUK-STIK A14 (BLANCO, 480 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 47.6, "currency": "MXN" } } }, { "id": "0", "description": "MASCARILLA 2 CARTUCHOS NEGRO MARCA CABEL", "classification": { "scheme": "CUCOP", "id": "25501-0101" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 264.6, "currency": "MXN" } } }, { "id": "0", "description": "HEXANO ESPECTROSOPICO O HPLC", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5864.6, "currency": "MXN" } } }, { "id": "0", "description": "GUILLOTINA DE PAPEL", "classification": { "scheme": "CUCOP", "id": "21101-0182" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1208.634, "currency": "MXN" } } }, { "id": "0", "description": "TRITÓN X100 TENSOACTIVO. 1 L. HYCELCLAVE : 56517-1010 500 ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 435.022, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADO DE PLÁSTICO 1L, GRADUADO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 120.33, "currency": "MXN" } } }, { "id": "0", "description": "MOLYBDENUM(IV) SULFIDE POWDER, 500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 13440, "currency": "MXN" } } }, { "id": "0", "description": "IRON(II) OXIDE, (FEO)\n400866-25G\n-10 MESH, =99.6% TRACE METALS BASIS\n25 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4315.5, "currency": "MXN" } } }, { "id": "0", "description": "PAPEL PH 0-14, INDICADOR UNIVERSAL CON 100 TIRAS MARCA: MERCK", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 367.5, "currency": "MXN" } } }, { "id": "0", "description": "\"CERTIFIED KITS, SCREW THREAD VIALS, 12 X 32 MM, 9 MM THREAD, UNASSEMBLED, PKG OF 100, VOLUME 2 ML, CLEAR GLASS VIAL (WITH GRADUATED MARKING SPOT), PTFE/SILICONE SEPTUM (WITH SLIT), (SEPTA BONDED TO CAP), CÓDIGO DE SIGMA ALDRICH: 29384-U. MATERIALES\n PTFE/SILICONE SEPTUM (WITH SLIT)\n BLUE POLYPROPYLENE CAP\n CLEAR GLASS VIAL (WITH GRADUATED MARKING SPOT)\n \n CARACTERÍSTICAS\n CLOSURE TYPE BLUE POLYPROPYLENE HOLE CAP\n CLOSURE TYPE SCREW TOP VIAL\n (SEPTA BONDED TO CAP)\n \n ENVASE\n PKG OF 100 EA\n \n D.E. × AL × D.I.\n 12 MM × 32 MM × 6 MM\n \n VOLUMEN\n 2 ML\n \n ADAPTADOR\n THREAD FOR 9 MM\"", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3725.75, "currency": "MXN" } } }, { "id": "0", "description": "ß-CAROTENE SYNTHETIC, =95% (HPLC), CRYSTALLINE 5 MG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2072, "currency": "MXN" } } }, { "id": "0", "description": "BOMBA DESCARGADORA PARA PIPETA DE 10 ML, VERDE. MARCA: BEL-ART", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 302.4, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE PLASTICO GRADUADO DE 2000 ML. QUE RESISTA CICLO DE ESTERILIZACION EN AUTOCLAVE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 233.002, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE PLASTICO GRADUADO DE 1000 ML. QUE RESISTA CICLO DE ESTERILIZACION EN AUTOCLAVE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 120.33, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE PLASTICO GRADUADO DE 500 ML. QUE RESISTA CICLO DE ESTERILIZACION EN AUTOCLAVE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 70.21, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO AZUL FINECARE SIN POLVO DESECHABLES TALLA MEDIANA. REGISTRO SANITARIO 1755C2018 SSA. PAQUETE CON 100 PIEZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 444.15, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO AZUL FINECARE SIN POLVO DESECHABLES TALLA GRANDE, REGISTRO SANITARIO 1755C2018 SSA. PAQUETE CON 100 PIEZAS. MARCA CTR. CATALOGO: NCTR-001-L", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 444.15, "currency": "MXN" } } }, { "id": "0", "description": "HORNO ELÉCTRICO HAMILTON BEACH 31401", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1820.672, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPTADO DE 4 L (6 PIEZAS PAQUETE) SKU CLS10004L", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2249.982, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADO DE DOS LITROS (4 PIEZAS) UN PAQUETE SKU Z740585-4EA", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 479.276, "currency": "MXN" } } }, { "id": "0", "description": "DISPENSADOR SUPERIOR DE BOTELLA, DISPENSMATE DE 2.5 A 25 ML. SIN BOTELLA. MARCA: DLAB", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 11573.044, "currency": "MXN" } } }, { "id": "0", "description": "3 KILOS DE ROLLO DE PAPEL ALUMINIO", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1398.6, "currency": "MXN" } } }, { "id": "0", "description": "1216. PIPETA PASTEUR DE VIDRIO 5.75PULG NO ESTERIL PAQUETE C/200 PIEZAS - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 511.882, "currency": "MXN" } } }, { "id": "0", "description": "EMBUDO DE BUCHNER90 MM", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 684.6, "currency": "MXN" } } }, { "id": "0", "description": "278475-2L PROPANOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5356.75, "currency": "MXN" } } }, { "id": "0", "description": "HORNO DE MICROONDAS DE 1.6 PIES CUBICOS MARCA DAEWOO", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5578.272, "currency": "MXN" } } }, { "id": "0", "description": "SOFTWARE BALSAMIQ WIREFRAMES PARA MAQUETACIÓN DE SITIOS Y APLICACIONES WEB.", "classification": { "scheme": "CUCOP", "id": "32701-0003" }, "quantity": 1, "unit": { "name": "UNIDAD", "value": { "amount": 2889.6, "currency": "MXN" } } }, { "id": "0", "description": "TALLER FRACAS PARA LA MEJORA CONTINUA (SISTEMA DE INFORME, REGISTRO Y ANÁLISIS DE NO CONFORMIDAD Y ACCIONES CORRECTIVAS)", "classification": { "scheme": "CUCOP", "id": "33401-0001" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 16800, "currency": "MXN" } } }, { "id": "0", "description": "DREMEL EZ725 EQUIPO DE ALMACENAMIENTO TODO PROPÓSITO PARA ACCESORIOS, 70 PIEZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1631.574, "currency": "MXN" } } }, { "id": "0", "description": "BOSCH DISCO DIAMANTADO DE 38,1MM EZ LOCK", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 957.6, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 105087 NO. DE CATALOGO 5640-5 MATRAZ VOLUMETRICO DE VIDRIO 5ML CLASE A LINEA BLANCA C/TAPON\n\nESMERILADO PIEZA(S) CON 1 PIEZA(S) PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 187.74, "currency": "MXN" } } }, { "id": "0", "description": "CÓDIGO 527434 NO. DE CATALOGO 7095D-9 2 CAJA DE PIPETA PASTEUR DE VIDRIO 9PULG NO ESTERIL DESECHABLE PAQUETE(S) CON\n\n200 PIEZA(S) CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 300.1, "currency": "MXN" } } }, { "id": "0", "description": "527434 7095D-9 CAJA DE PIPETA PASTEUR DE VIDRIO 9PULG NO ESTERIL DESECHABLE PAQUETE(S) CON\n\n200 PIEZA(S) CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 300.1, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 105256 CATALOGO 5020-125 MATRAZ ERLENMEYER DE VIDRIO 125ML BOCA ANGOSTA C/TAPON ESMERILADO\n\nPIEZA(S) CON 1 PIEZA(S) PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 360, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE 500ML DE VIDRIO, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS AZULES DE 1 ML, MARCA: AXIGEN, BOLSAS CON 1000 PIEZAS, NO ESTERIL", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 290, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS AZULES DE 1 ML, MARCA: AXIGEN, BOLSAS CON 1000 PIEZAS, NO ESTERIL. CATALOGO: T-1000-B", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 290, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS AMARILLAS PARA 200 UL, MARCA AXYGEN, BOLSA CON 1000 PIEZAS. CATALOGO: T-200-Y", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 195, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS BLANCAS DE 10 UL, BOLSA CON 1000 PIEZAS, MARCA: AXYGEN, CATALOGO: T-300", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 255, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS DE ENSAYE CON TAPA DE ROSCA 16 X 150 MM, DE VIDRIO, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0047" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 20, "currency": "MXN" } } }, { "id": "0", "description": "WESTERN BLOTTING LUMINOL REAGENT IS A NON-RADIOACTIVE, LIGHT-EMITTING SYSTEM FOR DETECTING PROTEINS ON A\nWESTERN BLOT MEMBRANE. PRESENTACION: 1 KIT .", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3457.09, "currency": "MXN" } } }, { "id": "0", "description": "CELDAS DESECHABLES PARA ESPECTROFOTOMETRO SEMI MICRO DE 4.5 ML. PAQUETE CON 100 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 410, "currency": "MXN" } } }, { "id": "0", "description": "ACEITE PARA BOMBA DE VACIO 6 LITROS", "classification": { "scheme": "CUCOP", "id": "25501-0059" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2760, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO CORRECTVIO DE CAMPANA DE FLUJO LAMINAR HORIZONTAL. MARCA: NACIONAL, MODELO: 3FT, ID EQUIPO: 1183. SE REQUIERE DE CAMBIO DE PREFILTRO, SE REQUIERE DE REVISION DE MOTOVENTILADOR, LIMPIEZA INTERIOR, REVISION DEL SISTEMA ELECTRICO, REVISION DE LAMPARA UV Y CONSIDERAR EL CAMBIO SI ES NECESARIO, REVISION DEL FLUJO DE AIRE. REVISION DE LA INTEGRIDAD Y FUNCIONAMIENTO DEL FILTRO HEPA QUE CUMPLA CON LAS ESPECIFICACIONES DEL EQUIPO. CONSIDERAR QUE SI EL FILTRO HEPA NO PASA LA PRUEBA CONSIDERAR QUE SE REALICE EL CAMBIO. AL FINAL DEL MANTEMIENTO REVISAR Y ASEGURARSE QUE EL EQUIPO QUEDE FUNCIONANDO CORRECTAMENTE", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 11000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO DE CAMPANA DE FLUJO LAMINAR VERTICAL, MARCA: CHD-LAB, MODELO: B-CV-03 (CLB-201-03), ID EQUIPO: 1202. REVISION DEL MECANISMO DE CERRADO DE LA PUERTA, LIMPIEZA Y LUBRICACION DE POLEAS, REVISION DE LAMPARA UV Y CONSIDERAR EL CAMBIO EN CASO NECESARIO. REVISION DE MOTOVENTILADOR, REVISION Y LIMPIEZA DEL INTERIOR DE LA CABINA. REVISION DEL SISTEMA ELECTRICO. REVISION DEL FLUJO DE AIRE, REVISION DE LA INTEGRIDAD Y FUNCIONAMIENTO DEL FILTRO HEPA QUE CUMPLA CON LAS ESPECIFICACIONES REQUERIDAS Y SI NO PASA LAS PRUEBAS CONSIDERAR QUE SE REALICE EL CAMBIO. AL FINAL DEL MANTEMIENTO REVISAR Y ASEGURARSE QUE EL EQUIPO QUEDE FUNCIONANDO CORRECTAMENTE.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 9000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO DE CAMPANA DE FLUJO LAMINAR VERTICAL, MARCA: CHD-LAB, MODELO: B-CV-03 (CLB-201-03), ID EQUIPO: 1203. REVISION DEL MECANISMO DE CERRADO DE LA PUERTA, LIMPIEZA Y LUBRICACION DE POLEAS, REVISION DE LAMPARA UV Y CONSIDERAR EL CAMBIO EN CASO NECESARIO. REVISION DE MOTOVENTILADOR, REVISION Y LIMPIEZA DEL INTERIOR DE LA CABINA. REVISION DEL SISTEMA ELECTRICO. REVISION DEL FLUJO DE AIRE, REVISION DE LA INTEGRIDAD Y FUNCIONAMIENTO DEL FILTRO HEPA QUE CUMPLA CON LAS ESPECIFICACIONES REQUERIDAS Y SI NO PASA LAS PRUEBAS CONSIDERAR QUE SE REALICE EL CAMBIO. AL FINAL DEL MANTEMIENTO REVISAR Y ASEGURARSE QUE EL EQUIPO QUEDE FUNCIONANDO CORRECTAMENTE.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 9000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO DE CENTRIFUGA REFRIGERADA CON PANEL DE CONTROL. MARCA: LABNET, MODELO: Z36HK, ID DEL EQUIPO: 1176. LIMPIEZA GENERAL, REVISION DEL SISTEMA ELECTRICO, DEL SISTEMA DE ENFRIAMIENTO, LUBRICACION DE EMPAQUES DE LA TAPA, REVISION DE SEGUROS DE LA TAPA, MANTENIMIENTO DE MOTOR, REVISION DE FLECHA DE MOTOR. AL FINALIZAR MANTENIMIENTO REVISAR DE SU CORRECTO FUNCIONAMIENTO DEL EQUIPO.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 4750, "currency": "MXN" } } }, { "id": "0", "description": "METANOL 20L JT BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3630, "currency": "MXN" } } }, { "id": "0", "description": "2 PISETA INTEGRAL DE 500ML. MODELO C46045-500, SKU: C46045-500.", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 205, "currency": "MXN" } } }, { "id": "0", "description": "KARL FISHER REACTIVO SIN PIRIDINA COMPONENTE UNICO 5 MG/ML 1 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 3535, "currency": "MXN" } } }, { "id": "0", "description": "ÉTER ETÍLICO ANHIDRO R.A, FRASCO 4 LITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2350, "currency": "MXN" } } }, { "id": "0", "description": "ESTANDAR DE MERCURIO PARA ICP CON CERTIFICADO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2350, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS DE PETRI DE VIDRIO DE LABORATORIO PARA INSTRUMENTOS BIOLOGICOS. (1 CAJA CON 10 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1450, "currency": "MXN" } } }, { "id": "0", "description": "PROBETAS. CILINDROS GRADUADOS DE 10 ML. DE VIDRIO DE BOROSILICATO 3.3 ESCALA MILIMÉTRICA. CARTER SCIENTIFIC 213110.", "classification": { "scheme": "CUCOP", "id": "25501-0037" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 90, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADO LABVIDA. VASO GRUESO DE 100ML. JUEGO DE VASOS GRIFFIN DE FORMA BAJA CON DOBLE ESCALA 3.3 BORO LVA005. 2 PAQUETES DE 12 PIEZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 660, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADO LABVIDA LVA017. JUEGO DE VASOS DE CRISTAL (3 TAMAÑOS, 50 ML, 100ML, 250ML. 3.3 BOROSILICATO CON GRADUACION IMPRESA (2PAQUETES DE 12 PIEZAS.)", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 648, "currency": "MXN" } } }, { "id": "0", "description": "QWORK LAB. CRISOL DE PARCELANA CON TAPA. PAQUETE DE 6. CAPACIDAD DE 50 ML. COLOR BLANCO, SUPERFICIE LISA, PARA LABORATORIO PARA CALENTAR COMPUESTOS QUÍMICOS.", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 510, "currency": "MXN" } } }, { "id": "0", "description": "EMBUDO DE SEPARACIÓN. EMBUDO DE SEPARACIÓN DE QUÍMICA. EQUIPOS DE DESTILACIÓN. EMBUDO DE DECANTACION DE 25ML. EMBUDO DE LABORATORIO PEQUEÑO LUNG JADE DESTILADOR DE VIDRIO.", "classification": { "scheme": "CUCOP", "id": "25501-0076" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2080, "currency": "MXN" } } }, { "id": "0", "description": "BOMBILLA DE SUCCIÓN DE GOMA DE 1 PIEZA, BOMBILLA DE SUCCIÓN DE GOMA DE LABORATORIO CON VÁLVULAS DE PRESIÓN SEGURA RELLENO DE PIPETA CUANTITATIVO ELASTICA (VERDE)", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 160, "currency": "MXN" } } }, { "id": "0", "description": "CRISOL DE PORCELANA CON TAPA COPA DE CRISOL DE PTFE DE ALTA FORMA PARA SUMINISTROS DE LABORATORIO DE BIOLOGIA Y QUIMICA (30ML)", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 56, "currency": "MXN" } } }, { "id": "0", "description": "SOPORTE PARA PIPETAS DE LABORATORIO, CON SUJECIÓN ESTABLE PARA 6 PIPETAS, ÚTIL SOPORTE LINEAL PARA PIPETAS PARA LABORATORIO\nMARCA: V-LAB", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1220, "currency": "MXN" } } }, { "id": "0", "description": "GRASA COMPOUND 7, -40°/204°C, 1927582 - DOW CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0093" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 895.5, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 150 ML.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 59, "currency": "MXN" } } }, { "id": "0", "description": "VASO PRECIPITADO DE VIDRIO ASTM 250ML EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 77, "currency": "MXN" } } }, { "id": "0", "description": "VASO PRECIPITADO GRADUADO DE VIDRIO 2000ML\nEISCO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 327, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ KITAZATO DE VIDRIO 1000ML EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 675, "currency": "MXN" } } }, { "id": "0", "description": "PIPETA DE TRANSFERENCIA PLÁST. ESTÉRIL 1/5 ML", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1950, "currency": "MXN" } } }, { "id": "0", "description": "20456. CRISOL DE PORCELANA 40ML, ALTURA 40MM, DIAMETRO EXTERIOR 50MM - COORS", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 495, "currency": "MXN" } } }, { "id": "0", "description": "26363. CRISOL DE PORCELANA 62ML, DIAMETRO 60MM, ALTURA 38MM, FORMA ANCHA - COORS", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 550, "currency": "MXN" } } }, { "id": "0", "description": "5792. VASO DE PRECIPITADO DE VIDRIO 50ML, FORMA BAJA GRIFFIN, PAQUETE C/5 PIEZAS - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 220, "currency": "MXN" } } }, { "id": "0", "description": "14893. PINZA PUNTA CURVA DE ACERO INOXIDABLE 4\", PAQUETE C/2 PIEZAS - DR INTRUMENTS", "classification": { "scheme": "CUCOP", "id": "25501-0080" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 500, "currency": "MXN" } } }, { "id": "0", "description": "6239. VIAL VIDRIO CLARO 20ML CENTELLEO, C/TAPA ROSCA, PAQUETE C/20 PIEZAS - KIMBLE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1337.5, "currency": "MXN" } } }, { "id": "0", "description": "LENTES DE SEGURIDAD TRANSPARENTES ESLAB L062SM. SKU: FER-L062SM", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 320, "currency": "MXN" } } }, { "id": "0", "description": "AGAR NUTRITIVO, 450 GRAMOS, MARCA BIOXON. CATALOGO: 210400", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 1865, "currency": "MXN" } } }, { "id": "0", "description": "AGAROSA GRADO BIOLOGIA MOLECULAR. MARCA: GOLDBIO. 500 GRAMOS. CATALOGO: DBK-A201-500G", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 12228.71, "currency": "MXN" } } }, { "id": "0", "description": "\"3 CAJAS DE FRASCOS RECTOS DE VIDRIO TRANSPARENTE DE 4 OZ CON TAPA PLÁSTICA COLOR NEGRA. LOS FRASCOS SOPORTAN TEMPERATURAS EXTREMAS DE -18° A 454°C (0° A 850°F).\n CUMPLEN CON FDA\"", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 400, "currency": "MXN" } } }, { "id": "0", "description": "SYRINGE PP/PE WITHOUT NEEDLE, UER LOCK TIP, CENTERED, CAPACITY 20 ML, GRADUATED, 1 ML, NON-STERILE, Z683620-100EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1800, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® MAGNETIC STIRRING BAR, PTFE, CYLINDRICAL, L 8 MM, BAR DIAM. 1.7 MM, CÓDIGO : Z328928-10EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1450, "currency": "MXN" } } }, { "id": "0", "description": "MICROFLEX® DIAMOND GRIP® CAJA GUANTES DE LÁTEX - LIBRES DE TALCO, CHICOS - 100/CAJA, MODELO: S-11886S", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 672, "currency": "MXN" } } }, { "id": "0", "description": "BROMOPHENOL BLUE, 10 G, NÚMERO DE CATALOGO 1610404", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 695, "currency": "MXN" } } }, { "id": "0", "description": "GLYCINE, 2 KG, NÚMERO DE CATALOGO 1610724", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 695, "currency": "MXN" } } }, { "id": "0", "description": "\"ACETONITRILE SUITABLE FOR HPLC, GRADIENT GRADE, =99.9%, 34851-4L. GRADO\nGRADIENT GRADE\n\nNIVEL DE CALIDAD\n100\n\nDENSIDAD DE VAPOR\n1.41 (VS AIR)\n\nPRESIÓN DE VAPOR\n72.8 MMHG ( 20 °C)\n\nANÁLISIS\n=99.9%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n973 °F\n\nLIM. EXPL.\n16 %\n\nBASELINE DRIFT MEASURING RANGE\n=15 MAU (210 NM)\n\nTECHNIQUE(S)\nHPLC: SUITABLE\n\nIMPUREZAS\n=0.0002% FREE ALKALI (AS NH3)\n=0.0005% NON-VOLATILE MATTER\n=0.001% FREE ACID (AS CH3COOH)\n=0.02% WATER (KARL FISCHER)\n=0.5 PPB FLUORESCENCE (QUININE) AT 365 NM\n=1 PPB FLUORESCENCE (QUININE) AT 254 NM\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.344 (LIT.)\n\nBP\n81-82 °C (LIT.)\n\nMP\n-45 °C (LIT.)\n\nDENSIDAD\n0.786 G/ML AT 25 °C (LIT.)\n\nGRADIENTE DE HPLC\n=0.5 MAU AT 254 NM\n=3 MAU AT 210 NM\n\nABSORCIÓN UV\n?: 195 NM AMAX: =0.12\n?: 200 NM AMAX: =0.032\n?: 230 NM AMAX: =0.0044\n?: 235 NM AMAX: =0.0044\n?: 250 NM AMAX: =0.0044\n?: 400 NM AMAX: =0.0044\n\nAPPLICATION(S)\nFOOD AND BEVERAGES\n\nFORMATO\nNEAT\n\nTEMP. DE ALMACENAMIENTO\nROOM TEMP\n\nSMILES STRING\nCC#N\n\nINCHI\n1S/C2H3N/C1-2-3/H1H3\n\nINCHI KEY\nWEVYAHXRMPXWCK-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1550, "currency": "MXN" } } }, { "id": "0", "description": "\"AGUA SUITABLE FOR ION CHROMATOGRAPHY, : 00612-5L. NIVEL DE CALIDAD\n100\n\nTECHNIQUE(S)\nION CHROMATOGRAPHY: SUITABLE\n\nIMPUREZAS\n=10 µG/KG ACETATE\n=10 µG/KG FORMIATE\n=10 µG/KG GLYCOLATE\n=10 µG/KG OXALATE\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.34 (LIT.)\n\nCONDUCTIVIDAD\n=2 µS/CM\n\nBP\n100 °C (LIT.)\n\nMP\n0 °C (LIT.)\n\nDENSIDAD\n1.000 G/ML AT 3.98 °C (LIT.)\n\nTRAZAS DE ANIÓN\nBROMATE (BRO3-): =1 µG/KG\nBROMIDE (BR-): =1 µG/KG\nCHLORATE (CLO3-): =1 µG/KG\nCHLORIDE (CL-): =1 µG/KG\nCHLORITE (CLO2-): =1 µG/KG\nFLUORIDE (F-): =1 µG/KG\nIODIDE (I-): =1 µG/KG\nNITRATE (NO3-): =1 µG/KG\nNITRITE (NO2-): =1 µG/KG\nPHOSPHATE (PO43-): =1 µG/KG\nSULFATE (SO42-): =1 µG/KG\n\nTRAZAS DE CATIÓN\nAL: =0.005 MG/KG\nBA: =0.005 MG/KG\nBI: =0.005 MG/KG\nCA: =0.01 MG/KG\nCD: =0.005 MG/KG\nCO: =0.005 MG/KG\nCR: =0.005 MG/KG\nCU: =0.005 MG/KG\nFE: =0.005 MG/KG\nK: =0.01 MG/KG\nLI: =0.005 MG/KG\nMG: =0.005 MG/KG\nMN: =0.005 MG/KG\nMO: =0.005 MG/KG\nNH4+: =0.01 MG/KG\nNA: =0.01 MG/KG\nNI: =0.005 MG/KG\nPB: =0.005 MG/KG\nSR: =0.005 MG/KG\nZN: =0.005 MG/KG\n\nSMILES STRING\nO\n\nINCHI\n1S/H2O/H1H2\n\nINCHI KEY\nXLYOFNOQVPJJNP-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 1000, "currency": "MXN" } } }, { "id": "0", "description": "\"ACETATO DE ETILO ACS REAGENT, =99.5%, 319902-6X1L. GRADO\nACS REAGENT\n\nNIVEL DE CALIDAD\n200\n\nAGENCY\nSUITABLE FOR EPA ACB B21-02\nSUITABLE FOR EPA ACB B23-05B\n\nDENSIDAD DE VAPOR\n3 (20 °C, VS AIR)\n\nPRESIÓN DE VAPOR\n73 MMHG ( 20 °C)\n\nANÁLISIS\n=99.5%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n801 °F\n\nLIM. EXPL.\n2.2-11.5 %, 38 °F\n\nIMPUREZAS\nH2SO4, PASSES TEST (DARKENED)\n=0.0009 MEQ/G TITR. ACID\n=0.200% WATER\n\nRESIDUO DE EVAP.\n=0.0030%\n\nCOLOR\nAPHA: =10\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.3720 (LIT.)\n\nBP\n76.5-77.5 °C (LIT.)\n\nMP\n-84 °C (LIT.)\n\nDENSIDAD\n0.902 G/ML AT 25 °C (LIT.)\n\nFORMATO\nNEAT\n\nSMILES STRING\nCCOC(C)=O\n\nINCHI\n1S/C4H8O2/C1-3-6-4(2)5/H3H2,1-2H3\n\nINCHI KEY\nXEKOWRVHYACXOJ-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2232, "currency": "MXN" } } }, { "id": "0", "description": "MICROFLEX® DIAMOND GRIP® GUANTES DE LÁTEX - LIBRES DE TALCO, GRANDES - CAJA CON 100 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 650, "currency": "MXN" } } }, { "id": "0", "description": "MICROFLEX® DIAMOND GRIP® GUANTES DE LÁTEX - LIBRES DE TALCO, CHICOS - CAJA CON 100 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 650, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® DISPOSABLE PETRI DISH WITH LID. CAT. BR452005-480EA UNIDAD DE MEDIDA CAJA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2655, "currency": "MXN" } } }, { "id": "0", "description": "PORTAOBJETOS 25X75MM DE VIDRIO BORDE DIAMANTADO GROSOR 0.90-1.10MM PAQUETE CON 50 PIEZAS. MARCA PIREX. CATALOGO: 2947N-25X75", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 30, "unit": { "name": "PIEZA", "value": { "amount": 28, "currency": "MXN" } } }, { "id": "0", "description": "TUBO PARA CENTRIFUGA 50 ML DE POLIPROPILENO ESTERIL FONDO CONICO CON TAPA PLUG SEAL. RACK CON 25 PIEZAS. MARCA CORNING. CATALOGO: 430290.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 20, "unit": { "name": "PIEZA", "value": { "amount": 185, "currency": "MXN" } } }, { "id": "0", "description": "ESPATULA DOBLE CON CUCHARA DE PLASTICO ABS VERDE, LARGO 180 MM CAJA CON 3 PAQUETES CON 6 PIEZAS CRM. CATALOGO: 28424", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2250, "currency": "MXN" } } }, { "id": "0", "description": "MEDIO DE CULTIVO DESHIDRADATADO BIOXON, 500 GRAMOS, NÚMERO DE CATÁLOGO 210400", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1870, "currency": "MXN" } } }, { "id": "0", "description": "\"HIDRÓXIDO DE SODIO, EN FORMA DE PELLETS, 99 % DE PUREZA, NÚMERO DE CATÁLOGO S5881-500G . GRADO\n REAGENT GRADE\n \n NIVEL DE CALIDAD\n 200\n \n AGENCY\n SUITABLE FOR EPA 1621\n SUITABLE FOR SM 4500 - NH3\n \n DENSIDAD DE VAPOR\n )1 (VS AIR)\n \n PRESIÓN DE VAPOR\n (18 MMHG ( 20 °C)\n 3 MMHG ( 37 °C)\n \n ANÁLISIS\n =98%\n \n FORMULARIO\n PELLETS (ANHYDROUS)\n \n TECHNIQUE(S)\n CELL CULTURE | MAMMALIAN: SUITABLE\n \n IMPUREZAS\n =1.0% SODIUM CARBONATE\n \n MP\n 318 °C (LIT.)\n \n SOLUBILIDAD\n WATER: SOLUBLE 1260 G/L AT 20 °C\n \n DENSIDAD\n 2.13 G/CM3 AT 20 °C\n \n SMILES STRING\n [OH-].[NA+]\n \n INCHI\n 1S/NA.H2O/H;1H2/Q+1;/P-1\n \n INCHI KEY\n HEMHJVSKTPXQMS-UHFFFAOYSA-M\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "\"ACIDO ACÉTICO GLACIAL, GRADO REACTIVO (ACS), CON PUREZA DEL GLACIAL, =99.7%. BOTELLAS DE 2.5 LITROS. CATÁLOGO S5881-500G . GRADO\n ACS REAGENT\n \n NIVEL DE CALIDAD\n 200\n \n DENSIDAD DE VAPOR\n 2.07 (VS AIR)\n \n PRESIÓN DE VAPOR\n 11.4 MMHG ( 20 °C)\n \n ANÁLISIS\n =99.7%\n \n FORMULARIO\n LIQUID\n \n TEMP. DE AUTOIGNICIÓN\n 800 °F\n \n LIM. EXPL.\n 16 %, 92 °F\n 4 %, 59 °F\n \n TECHNIQUE(S)\n MASS SPECTROMETRY (MS): SUITABLE\n \n IMPUREZAS\n CR2O72- REDUCERS, PASSES TEST\n MNO4- REDUCERS, PASSES TEST\n =0.0004 MEQ/G TITR. BASE\n =0.01% ACETIC ANHYDRIDE\n \n RESIDUO DE EVAP.\n =0.001%\n \n COLOR\n APHA: =10\n \n ÍNDICE DE REFRACCIÓN\n N20/D 1.371 (LIT.)\n \n PH\n 2.5 (20 °C, 50 G/L)\n \n BP\n 117-118 °C (LIT.)\n \n MP\n 16.2 °C (LIT.)\n \n DENSIDAD\n 1.049 G/ML AT 25 °C (LIT.)\n \n TRAZAS DE ANIÓN\n CHLORIDE (CL-): =1 PPM\n SULFATE (SO42-): =1 PPM\n \n TRAZAS DE CATIÓN\n FE: =0.2 PPM\n HEAVY METALS: =0.5 PPM (BY ICP)\n \n SMILES STRING\n CC(O)=O\n \n INCHI\n 1S/C2H4O2/C1-2(3)4/H1H3,(H,3,4)\n \n INCHI KEY\n QTBSBXVTEAMEQO-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 956, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS AZULES GRADUADAS CAPACIDAD DE 1000µL RACK DE 100 PIEZAS. PARA SU USO EN SOLUCIONES DE APLICACIONES BIOLÓGICAS. FABRICADAS EN POLIPROPILENO - 1000UL CAPACIDAD. - COLOR CLARO TRASLUCIDO.MPTR1000-100", "classification": { "scheme": "CUCOP", "id": "25501-0095" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 337.5, "currency": "MXN" } } }, { "id": "0", "description": "PIPETA PASTEUR DESECHABLE PIPETA PASTEUR DE VIDRIO 5.75PULG SODA LIME 5-3/4,CAJA CON 250 PIPETAS, DE PUNTA CORTA - MODELO KIMBLE. KIMB-63A53", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "MICROPLACA DE PS, 24 POZOS DE 1ML, ESTER. 50 PIEZAS /CAJA MICROPLACA DE PS, 24 POZOS DE MEDIDAS DE 85.4 X 127.6 X 20.2MM, POZO DE 15.5X17.5MM, 1ML, AREA 1.9CM2 (TC) ESTERIL EMPAQUE INDIVIDUAL. 50/CAJA DE LA MARCA BIOLOGIX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3490, "currency": "MXN" } } }, { "id": "0", "description": "MICROPLACA 96 POZOS CULTIVO CELULAR, TRATADA, CLARA, FONDO PLANO,\nCON TAPA, ESTERIL, EMPAQUE INDIVIDUAL PAQUETE(S) CON 5 PIEZA(S)\nCORNING", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 134, "currency": "MXN" } } }, { "id": "0", "description": "MEMBRANA FILTRANTE NYLON 47MM, 0.2UM NO ESTERIL C/100 WHATMAN", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3800, "currency": "MXN" } } }, { "id": "0", "description": "HIDROXIDO DE SODIO (500G) SKU 221465-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "GRAMO", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO SKU Z677280 (100 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 610, "currency": "MXN" } } }, { "id": "0", "description": "VARILLAS DE AGITACIÓN DE VIDRIO (50/PKT) SKU BR135825-50EA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2850, "currency": "MXN" } } }, { "id": "0", "description": "GOGLES (LENTES) DE SEGURIDAD SKU Z758973-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 330, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO CLORHIDRICO DE 2.5 LTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 505, "currency": "MXN" } } }, { "id": "0", "description": "DIMETILSULFÓXIDO 1LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 7800, "currency": "MXN" } } }, { "id": "0", "description": "CLEAR-VIEWT SNAP-CAP MICROTUBES, SIZE 1.5 ML, NATURAL,, T3566-500EA", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 266, "currency": "MXN" } } }, { "id": "0", "description": "ALDRICH® TWO-NECK ROUND-BOTTOM FLASK, CAPACITY 100 ML, JOINTS: ST/NS 14/20, NÚMERO DE CATÁLOGO: Z516848-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2600, "currency": "MXN" } } }, { "id": "0", "description": "NITRATO DE PLATA, 85229-50G;", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1545, "currency": "MXN" } } }, { "id": "0", "description": "PYREX® ROUND MEDIA STORAGE BOTTLES AND REUSABLE SCREW CAPS; CLS1395250-10EA;", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1550, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO DE VIDRIO CLARO 300 ML FREEZONE COMPLETO LABCONCO\n 7540600", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6007, "currency": "MXN" } } }, { "id": "0", "description": "NALGENE® CENTRIFUGE TUBES, OAK RIDGE STYLE 3114, NOMINAL CAPACITY 50 ML, ALDRICH, T2418-2EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2950, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO SULFÚRICO ACS 95-98% DE 2.5 LTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 825, "currency": "MXN" } } }, { "id": "0", "description": "METANOL HPLC DE 4L. JT BAKER, CLAVE EL CRISOL: 49093-6304, FRASCOD E 4L, PARA USO EN CROMATOGRAFÍA Y ESPECTROFOTOMETRÍA.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 645, "currency": "MXN" } } }, { "id": "0", "description": "CELDA DE POLIESTIRENO MACRO-2-5-4-5ML-C-100-BRANDTECH (759007)", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 415, "currency": "MXN" } } }, { "id": "0", "description": "JUEGO DE REACTIVOS P/NITROGENO TOTAL (50 PRUEBAS).", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6490, "currency": "MXN" } } }, { "id": "0", "description": "CORNING MICROSCOPE SLIDES - CAT. NO. 2497 - 25X75", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 28, "currency": "MXN" } } }, { "id": "0", "description": "JERINGA DE INYECCION DE 10 ML PARA MUESTRAS GASEOSAS EN CROMATOGRAFIA CON VALVULA DE CIERRE HERMETICA Y CONECTOR LUER", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4050, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE CARTUCHOS DE CELULOSA PARA EXTRACCIÓN 33 X 80 MM", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1875, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO DE 4 LTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1645, "currency": "MXN" } } }, { "id": "0", "description": "HYCEL 5342-19 HYCLIN PLUS NEUTRO 5 LTS", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 420, "currency": "MXN" } } }, { "id": "0", "description": "DUVE\nEMBUDO DE BUCHNER 110MM", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 435, "currency": "MXN" } } }, { "id": "0", "description": "UREA \nU5128\tACS REAGENT, 99.0-100.5%\nU5128-100G\t100 G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 145, "currency": "MXN" } } }, { "id": "0", "description": "THIOUREA\nT8656-50G\nACS REAGENT, =99.0%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 425, "currency": "MXN" } } }, { "id": "0", "description": "MICRO SPOON AND SPATULA WEIGHING SET, Z648299-1EA,", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3700, "currency": "MXN" } } }, { "id": "0", "description": "CRIMP TOP VIAL WITH BEVELED FINISH, CONVENIENCE PACK, 29127-U,", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1325, "currency": "MXN" } } }, { "id": "0", "description": "SCIENCEWARE® SAFETY LABELED WASH BOTTLES, Z423149-1PAK,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 195, "currency": "MXN" } } }, { "id": "0", "description": "248614-500G PERSULFATO DE AMONIO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 925, "currency": "MXN" } } }, { "id": "0", "description": "484016-1KG HIDROXIDO DE POTASIO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 506, "currency": "MXN" } } }, { "id": "0", "description": "258148-2.5L-GL ACIDO CLORHIDRICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 508, "currency": "MXN" } } }, { "id": "0", "description": "459844-2.5L ETANOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 737, "currency": "MXN" } } }, { "id": "0", "description": "S5881-1KG HIDROXIDO DE SODIO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 690, "currency": "MXN" } } }, { "id": "0", "description": "258105-2.5L ACIDO SULFURICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 905, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO 4L HPLC JT BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3052, "currency": "MXN" } } }, { "id": "0", "description": "TAMIZ DE 8\" DE DIAMETRO EN ACERO INOXIDABLE\nMALLA NO 40 (425 MICRAS)", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3350, "currency": "MXN" } } }, { "id": "0", "description": "WHA1825047. WHATMAN® GLASS MICROFIBER FILTERS, GRADE GF/F\nGRADE GF/F CIRCLES, 47 MM, 100/PK.", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 3700, "currency": "MXN" } } }, { "id": "0", "description": "WHA1821047. FILTROS DE MICROFIBRA DE VIDRIO WHATMAN® , CALIDAD GF/B. GRADE GF/B CIRCLES, 47 MM, 100/PK.", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 2200, "currency": "MXN" } } }, { "id": "0", "description": "LEIBOVITZ´S L-15 MEDIUM\n30-2008, ATCC\n500ML", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3524.31, "currency": "MXN" } } }, { "id": "0", "description": "DIMETIL FORMAMIDA (N,N), A.C.S. MCA MEYER, 4 L. CAT. 1200-4000", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 1995, "currency": "MXN" } } }, { "id": "0", "description": "MICROTUBOS 1.5 ML ÁMBAR BOLSA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 705, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ AFORADO 50ML.\nPYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 372, "currency": "MXN" } } }, { "id": "0", "description": "1017992500. ÁCIDO NÍTRICO 69% (HNO3), 2.5 L.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 645, "currency": "MXN" } } }, { "id": "0", "description": "1029524000. DIMETILSULFOXIDO ((CH³)²SO), 4 L, Nº CAS: 67-68-5, NÚMERO CE : 200-664-3", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 6740, "currency": "MXN" } } }, { "id": "0", "description": "8222512500. ACETONA (CH3COCH3), 2.5 L, Nº CAS: 67-64-1, NÚMERO CE : 200-662-2", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 655, "currency": "MXN" } } }, { "id": "0", "description": "1916-01 DEXTROSA ANHIDRA POLVO, 500 G. J.T BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 316, "currency": "MXN" } } }, { "id": "0", "description": "6095-500 FERROSO SULFATO CRISTAL HEPTAHIDRATADO\nPURO, 500 GR.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 440, "currency": "MXN" } } }, { "id": "0", "description": "S3025-05 SODIO HIDRÓXIDO (LENTEJAS) ACS 500 G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 380, "currency": "MXN" } } }, { "id": "0", "description": "H1425-15 HIDRÓGENO PERÓXIDO AL 30% P/P 3.5 LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1040, "currency": "MXN" } } }, { "id": "0", "description": "FJ25BNPNY002AD01, FILTRO PARA JERINGA CON MEMBRANA DE NYLON, 25MM, 0.22UM, 50/PAQ.", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1495, "currency": "MXN" } } }, { "id": "0", "description": "C21C0007-1 PORTA OBJETOS DE 25 X 75 C/50 PZAS. CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 30, "currency": "MXN" } } }, { "id": "0", "description": "CH0345L-WT PROBETA GRADUADA VIDRIO 250ML CLASE \"A\"\nBLANCA EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 475, "currency": "MXN" } } }, { "id": "0", "description": "CLS6402250FO\nPYREX® SQUIBB SEPARATORY FUNNEL, FUNNEL ONLY\nFUNNEL ONLY, CAPACITY 250 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1515, "currency": "MXN" } } }, { "id": "0", "description": "PYREX® SQUIBB SEPARATORY FUNNEL, FUNNEL ONLY\nFUNNEL ONLY, CAPACITY 500 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1885, "currency": "MXN" } } }, { "id": "0", "description": "S-19220. GUANTES DE CALOR, GRIP-NT HOT MILL, UNITALLA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 725, "currency": "MXN" } } }, { "id": "0", "description": "S-25276. VIALES DE VIDRIO, 15 ML, TRANSPARENTES", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2885, "currency": "MXN" } } }, { "id": "0", "description": "\"HIDROXIDO DE SODIO, ACS REAGENT, =97.0%, PELLETS, CÓDIGO : 221465-500G. GRADO\nACS REAGENT\n\nNIVEL DE CALIDAD\n200\n\nAGENCY\nSUITABLE FOR DIN 38407-42\nSUITABLE FOR EPA 1621\nSUITABLE FOR EPA 533\nSUITABLE FOR EPA 8327\nSUITABLE FOR EPA OTM-45\nSUITABLE FOR SM 4500 - NH3\n\nDENSIDAD DE VAPOR\n)1 (VS AIR)\n\nPRESIÓN DE VAPOR\n(18 MMHG ( 20 °C)\n3 MMHG ( 37 °C)\n\nANÁLISIS\n=97.0%\n\nFORMULARIO\nPELLETS\n\nTECHNIQUE(S)\nCELL CULTURE | MAMMALIAN: SUITABLE\nTITRATION: SUITABLE\n\nIMPUREZAS\n=0.001% N COMPOUNDS\n=0.02% NH4OH PPT.\n=1.0% NA2CO3\n\nMP\n318 °C (LIT.)\n\nSOLUBILIDAD\nWATER: SOLUBLE 1,260 G/L AT 20 °C\n\nDENSIDAD\n2.13 G/CM3 AT 20 °C\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =0.005%\nPHOSPHATE (PO43-): =0.001%\nSULFATE (SO42-): =0.003%\n\nTRAZAS DE CATIÓN\nFE: =0.001%\nHG: =0.1 PPM\nK: =0.02%\nNI: =0.001%\nHEAVY METALS (AS AG): =0.002%\n\nSMILES STRING\n[OH-].[NA+]\n\nINCHI\n1S/NA.H2O/H;1H2/Q+1;/P-1\n\nINCHI KEY\nHEMHJVSKTPXQMS-UHFFFAOYSA-M\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "FILTRO NO ESTERIL CON MEMBRANA DE ACETATO DE\nCELULOSA, DIAMETRO 26 MM, TAMANO DE PORO 0.22\nMICROMETROS. ESTRUCTURA DE ACRILICO, COLOR AZUL,\n100 PIEZAS POR PAQUETE. NO ESTERIL", "classification": { "scheme": "CUCOP", "id": "25501-0082" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2720, "currency": "MXN" } } }, { "id": "0", "description": "DESECADOR DE VIDRIO CON VACÍO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7381.11, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS 250 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 73, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS 100 ML CIVEQ", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 49, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS 600 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ BOLA DE 250 ML", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "\"PARAFILM PM-996\t4IN X 125FT (10.16CM X 38.10M)\"", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 735, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL METILICO RA ACS (METANOL)\tW7561, WHOLER\t4 L", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 575, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ KITAZATO DE VIDRIO MODELO 1432-500 DE 500 ML, MARCA CIVEQ", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 435, "currency": "MXN" } } }, { "id": "0", "description": "ESCOBILLÓN PARA PROBETA MODELO CVQ05 TAMAÑO CHICOO, 16 CM DE LARGO.", "classification": { "scheme": "CUCOP", "id": "25501-0097" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 75, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS PARA RMN WILMAD® 5 MM DE DIÁMETRO, ECONOMÍA\tALDRICH\t\t\nSKU:Z562734", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 745, "currency": "MXN" } } }, { "id": "0", "description": "LB BROTH, MILLER. CAT. L3152-1KG. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4040, "currency": "MXN" } } }, { "id": "0", "description": "BROMOTHYMOL BLUE. 114413-5G. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 525, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® DISPOSABLE PETRI DISH WITH LID, BR452005-480EA. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3700, "currency": "MXN" } } }, { "id": "0", "description": "SELLO DE ALUMINIO PARA VIALES TIPO CRIMP DE 13MM. CRISA\t\t\t\nSKU: CRISA05721", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1600, "currency": "MXN" } } }, { "id": "0", "description": "VIAL 12 X 32MM TIPO CRIMP. CON ÁREA PARA ESCRITURA. BOCA ANCHA. CRISA\t\tCRISA \nSKU:05721", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1505, "currency": "MXN" } } }, { "id": "0", "description": "NITRATO DE PLATA 209139-25G, ACS REAGENT, =99.0%, \nNIVEL DE CALIDAD 200, DENSIDAD DE VAPOR 5.8 (VS AIR)\nANÁLISIS PAQUETE \n=99.0%\nREACTION SUITABILITY\nREAGENT TYPE: CATALYST\nCORE: SILVER\n\nTRANSPARENCIA DE LA SOLUCIÓN\nPASSES TEST\n\nIMPUREZAS\nFREE ACID, PASSES TEST\n=0.01% NOT HCL PPTD.\n\nMP\n212 °C (DEC.) (LIT.)\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =5 PPM\nSULFATE (SO42-): =0.002%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1875, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® PASTEUR PIPETTE,ALDRICH,BR747725-1000EA4578 PAQUETE", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 4400, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® PASTEUR PIPETTE,ALDRICH,BR747725-1000EA\t4578 PAQUETE", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 4400, "currency": "MXN" } } }, { "id": "0", "description": "WHEATON SAMPLE VIALS WITH RUBBER LINED CAPS,\tALDRICH\tZ256196-1PAK\t4844", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5780, "currency": "MXN" } } }, { "id": "0", "description": "ALDRICH® TWO-NECK ROUND-BOTTOM FLASK, CAPACITY 100 ML, JOINTS: ST/NS 24/40 (2), Z516856-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3575, "currency": "MXN" } } }, { "id": "0", "description": "ALDRICH® ERLENMEYER FLASK WITH ST JOINT, CAPACITY 250 ML, JOINT: ST/NS 24/40, ALDRICH, Z723088-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 345, "currency": "MXN" } } }, { "id": "0", "description": "ALDRICH® ERLENMEYER FLASK WITH ST JOINT, CAPACITY 500 ML, JOINT: ST/NS 24/40, ALDRICH, Z723096-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 805, "currency": "MXN" } } }, { "id": "0", "description": "NORELL® STANDARD SERIEST 5 MM NMR TUBES, FREQUENCY 500 MHZ, ALDRICH, NOR508UP7-5EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1120, "currency": "MXN" } } }, { "id": "0", "description": "\"TERMÓMETRO DIGITAL DE -50 A 300°C TRACEABLE. VÁSTAGO DE 29CM. CONTROL COMPANY\t\nSKU:EF24083D", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1100, "currency": "MXN" } } }, { "id": "0", "description": "25928. TERMOMETRO DIGITAL -50/+150°C C/VASTAGO 8PULG TRACEABLE, 4052 CONTROL COMPANY\t\tSKU: EF24083A", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 930, "currency": "MXN" } } }, { "id": "0", "description": "10844. VASO DE PRECIPITADO DE VIDRIO 600ML FORMA BAJA GRIFFIN C/2 KIMAX\t\t\t\nSKU: 1400-600", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 158, "currency": "MXN" } } }, { "id": "0", "description": "5669. VASO DE PRECIPITADO DE VIDRIO 250ML FORMA BAJA GRIFFIN PAQUETE C/2 PIEZAS - KIMAX\t\t\tSKU: 1400-250", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 148, "currency": "MXN" } } }, { "id": "0", "description": "5794. VASO DE PRECIPITADO DE VIDRIO 100ML FORMA BAJA GRIFFIN PAQUETE C/5 PIEZAS PYREX\t\nSKU: 1000-100", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 275, "currency": "MXN" } } }, { "id": "0", "description": "5792. VASO DE PRECIPITADO DE VIDRIO 50ML FORMA BAJA GRIFFIN PAQUETE C/5 PIEZAS PYREX\t\t\t3\nSKU:1000-50", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 215, "currency": "MXN" } } }, { "id": "0", "description": "1216. PIPETA PASTEUR DE VIDRIO 5.75PULG NO ESTERIL PAQUETE C/200 PIEZAS - PYREX\t\t\nSKU: 7095B-5X", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 300, "currency": "MXN" } } }, { "id": "0", "description": "2010. PROBETA (MEDIDA CILINDRICA) DE VIDRIO 50ML CLASE B LINEA AZUL - KIMAX\t\nSKU:20025-50", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 270, "currency": "MXN" } } }, { "id": "0", "description": "2977. PROBETA (MEDIDA CILINDRICA) DE VIDRIO 10ML ESCOLAR ESCALA METRICA BLANCA, BASE HEXAGONAL - KIMAX\t\t\nSKU:20025-10", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 218, "currency": "MXN" } } }, { "id": "0", "description": "5471. PIPETA SEROLOGICA DE POLIESTIRENO 10MLX0.1ML ESTERIL - FALCON\t\t\nSKU: 356551", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1400, "currency": "MXN" } } }, { "id": "0", "description": "23153. FILTRO JERINGA PTFE 25MM, 0.2UM NO ESTERIL UNIFLO C/100 WHATMAN\tCTR\t\t\nSKU:9911-2502R", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 12477.45, "currency": "MXN" } } }, { "id": "0", "description": "5067. GUANTES DE NITRILO AZUL DESECHABLES PAQUETE C/100 PIEZAS TOUCHNTUFF\t\t\t\nSKU:92-675-M", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 1400, "currency": "MXN" } } }, { "id": "0", "description": "12033. LENTES DE SEGURIDAD DE POLICARBONATO VERATTI GT C/MARCO CLARO, ANTIRAYAS - ENCON\t\t\tSKU:4328004", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 425, "currency": "MXN" } } }, { "id": "0", "description": "PLATILLO DE ALUMINIO DESECH 60MM, PROFUNDIDAD 5/8PULG, 60ML PAQUETE C/200 PIEZAS - EAGLE SKU: D57-100 CTR", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 330, "currency": "MXN" } } }, { "id": "0", "description": "18959. ALCOHOL ETILICO (ETANOL) ABSOLUTO EMPLURA 2.5LT - MERCK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1150, "currency": "MXN" } } }, { "id": "0", "description": "PLACA 12 POZOS DE POLIESTIRENO TRATADA FONDO PLANO C/TAPA, ESTERIL, P/CULTIVO CELULAR, EMPAQUE INDIVIDUAL PIEZA(S) CON 1 PIEZA(S) FALCON", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 200, "unit": { "name": "PIEZA", "value": { "amount": 31.6, "currency": "MXN" } } }, { "id": "0", "description": "EXTRAN® MA 01A 01 ALCALINO, 107555 SUPELCO MERK\nMILLIPORE. NUMERO DE REFERENCIA MX11075555004.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 31.6, "currency": "MXN" } } }, { "id": "0", "description": "33820-99 KIMAX® JUEGO DE QUÍM.NO .5 JUNTAS 24/40", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8900, "currency": "MXN" } } }, { "id": "0", "description": "986540\nCAJA 500 PZAS VIAL DE VIDRIO DE CENTELLEO DE 20 ML, TAPA DE POLIPROPILENO/POLIETILENO ESPUMADO\nREVESTIDO MCA WHEATON. CAT. 986540", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 13800, "currency": "MXN" } } }, { "id": "0", "description": "BARRA MAGNETICA POLIGONAL LISA DE 12 X 5MM", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 175, "currency": "MXN" } } }, { "id": "0", "description": "BARRA MAGNETICA POLIGONAL LISA DE 25 X 6 MM", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 175, "currency": "MXN" } } }, { "id": "0", "description": "EAPATULA TIPO HEYMAN (150MM)", "classification": { "scheme": "CUCOP", "id": "25501-0091" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "5342-19 HYCLIN PLUS NEUTRO 5 L", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "CAJA PARA ARCHIVAR-TRANSPORTAR PORTAOBJETOS", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 225, "currency": "MXN" } } }, { "id": "0", "description": "WHATMAN® QUALITATIVE FILTER PAPER, GRADE 1, CIRCLES, DIAM. 185 MM, PACK OF 100, ALDRICH, WHA1001185", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 810, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO DE 4 LITROS F-06205. FERMONT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2100, "currency": "MXN" } } }, { "id": "0", "description": "LAUKA.B38252 BOMBA DESCARGADORA PARA PIPETA 10ML. LAUKA", "classification": { "scheme": "CUCOP", "id": "25501-0069" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "LAUKA.B38251 BOMBA DESCARGADORA PARA PIPETA 2ML. LAUKA", "classification": { "scheme": "CUCOP", "id": "25501-0069" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 375, "currency": "MXN" } } }, { "id": "0", "description": "24965-2509 MATRAZ DE DESTILACIÓN DE 250ML CON TRES BOCAS EN ÁNGULO 24/40. PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1430, "currency": "MXN" } } }, { "id": "0", "description": "114000-300 VASO DE PRECIPITADO DE 30ML. KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 25, "unit": { "name": "PIEZA", "value": { "amount": 53, "currency": "MXN" } } }, { "id": "0", "description": "WHEAT10012 VIAL DE 4ML CON TAPÓN ROSCADO. WHEATON CJ/72 PZAS", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2700, "currency": "MXN" } } }, { "id": "0", "description": "SERVICIO DE MANO DE OBRA PARA CAMBIO DE FILTROS DE CAMPANAS EXTRACTORAS.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 8500, "currency": "MXN" } } }, { "id": "0", "description": "21544. CAJA PETRI 90X15MM DE PLASTICO ESTERIL CAJA C/54 PAQUETES C/10 PIEZAS - BBL", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1750, "currency": "MXN" } } }, { "id": "0", "description": "2410. BOLSA WHIRL-PAK 18OZ (532ML) 11.5X23CM ESTANDAR ESTERIL C/500 NASCO", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1850, "currency": "MXN" } } }, { "id": "0", "description": "12467. CAJA PETRI 100X15MM DE PLASTICO DESECHABLE C/3 DIVISIONES ESTERIL PAQUETE C/50 PIEZAS - SYM", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 875, "currency": "MXN" } } }, { "id": "0", "description": "3482. TUBO DE CULTIVO DE VIDRIO 16X125MM, 15ML REUSABLE C/TAPON ROSCADO PAQUETE C/20 PIEZAS - PYREX VISTA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 380, "currency": "MXN" } } }, { "id": "0", "description": "6078. TUBO DE CULTIVO DE VIDRIO 6X50MM REUSABLE S/LABIO PAQUETE C/30 PIEZAS PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 195, "currency": "MXN" } } }, { "id": "0", "description": "4332. PAPEL PARAFILM 2\" X 250´ (5CM X 76MT) PM992 - HEATHROW", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 905, "currency": "MXN" } } }, { "id": "0", "description": "2656. MATRAZ FILTRACION DE VIDRIO KITAZATO 1LT REFORZADO - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 598, "currency": "MXN" } } }, { "id": "0", "description": "2761. MATRAZ VOLUMETRICO DE VIDRIO 100ML CLASE - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 352, "currency": "MXN" } } }, { "id": "0", "description": "CONJUNTO DE RECUPERADOR Y CAJA PARA BARRAS DE AGITACIÓN DE PTFE", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8288, "currency": "MXN" } } }, { "id": "0", "description": "CORNING® ISOTIP® FILTERED PIPET TIPS, CLS4823-960EA,", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1730, "currency": "MXN" } } }, { "id": "0", "description": "CORNING® UNIVERSAL FIT PIPET TIPS\n100-1000 µL UNIVERSAL FIT BULK PACKED PIPET TIPS, BLUE, NON-STERILE, 1000 TIPS/BAG, 1000 TIPS/CASE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 370, "currency": "MXN" } } }, { "id": "0", "description": "NALGENE® CENTRIFUGE TUBES, OAK RIDGE STYLE 3114, T2418-2EA, HTTPS://WWW.SIGMAALDRICH.COM/MX/ES/PRODUCT/SIGMA/T2418", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1900, "currency": "MXN" } } }, { "id": "0", "description": "PYREX® ROUND MEDIA STORAGE BOTTLES AND REUSABLE SCREW CAPS, CLS1395500-10EA, HTTPS://WWW.SIGMAALDRICH.COM/MX/ES/PRODUCT/ALDRICH/CLS1395500", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2020, "currency": "MXN" } } }, { "id": "0", "description": "CVQ-0012 SOPORTE UNIVERSAL CON VARILLA DE 60 CM", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 620, "currency": "MXN" } } }, { "id": "0", "description": "Z189049\t\n1 PZA\t\nACE FOUR-NECK ROUND-BOTTOM FLASK", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8150, "currency": "MXN" } } }, { "id": "0", "description": "Z560472\n\t1 PZA\t\nALDRICH® CALIBRATED CHROMATOGRAPHY COLUMN WITH SOLVENT RESERVOIR", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1460, "currency": "MXN" } } }, { "id": "0", "description": "Z418684\n\t1 PZA\t\nALDRICH® THREE-NECK ROUND-BOTTOM FLASK", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2550, "currency": "MXN" } } }, { "id": "0", "description": "Z423467\t\t\nEASY-READ® THERMOMETER", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3530, "currency": "MXN" } } }, { "id": "0", "description": "SYNC184171\n\t\t\nSYNTHWARET CHROMATOGRAPHY COLUMN WITH PTFE STOPCOCK", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6100, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE METILENNO, 1.0 L. \nCATÁLOGO SIGMA-ALDRICH 270997", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 467, "currency": "MXN" } } }, { "id": "0", "description": "CONDENSADOR, 1 PZA. CATÁLOGO SIGMA-ALDRICH Z556920 (CONDENSADOR ALDRICH OESTE, ALTURA TOTAL 200 MM, ARTICULACION: ST/NS 24/40 SIGMA-ALDRICH),", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5550, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES MICROFLEX (M)\nNO. CAT. Z412392-1PAK", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 610, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES MICROFLEX (G)\nNO. CAT. Z412406-1PAK", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 510, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 1 KILOGRAMOS DE BICARBONATO DE SODIO\nNO. CAT. S6014", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1050, "currency": "MXN" } } }, { "id": "0", "description": "NITRATO DE PLATA\nNO. CAT. 209139-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1860, "currency": "MXN" } } }, { "id": "0", "description": "ESTAND. COND. 12.88 MS/CM, 250 ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 944.7, "currency": "MXN" } } }, { "id": "0", "description": "BUFFER DE PH MATERIAL DE REFERENCIA CERTIFICADO DE 7 UNIDADES DE PH 500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2320, "currency": "MXN" } } }, { "id": "0", "description": "BUFFER DE PH MATERIAL DE REFERENCIA CERTIFICADO DE 0 UNIDADES DE PH 500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2550, "currency": "MXN" } } }, { "id": "0", "description": "BUFFER DE PH MATERIAL DE REFERENCIA CERTIFICADO DE 4 UNIDADES DE PH 500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2320, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 250ML FORMA BAJA GRIFFIN PIEZA(S) CON 1\nPIEZA(S) PYREX CTR", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 74, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 600ML FORMA BAJA GRIFFIN PIEZA(S) CON 1\nPIEZA(S) PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 102, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 4LT FORMA BAJA GRIFFIN PIEZA(S) CON 1\nPIEZA(S) PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1220, "currency": "MXN" } } }, { "id": "0", "description": "TERMOMETRO DIGITAL -50/+300°C IMPERMEABLE TIPO PALETA TRACEABLE 4371\nCONTROL COMPANY", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 920, "currency": "MXN" } } }, { "id": "0", "description": "PINZA (TENAZA) DE EXTENSION GARRA 3 DEDOS AESA", "classification": { "scheme": "CUCOP", "id": "25501-0080" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 405, "currency": "MXN" } } }, { "id": "0", "description": "HEXADECANE 99% (CETANE)\nNO. CATÁLOGO H6703-1L (500 ML)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3510, "currency": "MXN" } } }, { "id": "0", "description": "TOLUENO\nSINÓNIMOS: TOLUENE\nNO. CATÁLOGO 179418-4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 975, "currency": "MXN" } } }, { "id": "0", "description": "EASY-READ® THERMOMETER\nZ423475-25EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3100, "currency": "MXN" } } }, { "id": "0", "description": "GL-139.464.06A. PROBETA CLASE A GLASSCO 139.464, 500 ML, CALIBRADA PARA ENTREGAR CON DOBLE ESCALA, BASE HEXAGONAL Y BUMPER", "classification": { "scheme": "CUCOP", "id": "25501-0037" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 777, "currency": "MXN" } } }, { "id": "0", "description": "GL-139.464.07A. PROBETA CLASE A GLASSCO 139.464, 1 LT, CALIBRADA PARA ENTREGAR CON DOBLE ESCALA, BASE HEXAGONAL Y BUMPER", "classification": { "scheme": "CUCOP", "id": "25501-0037" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 983, "currency": "MXN" } } }, { "id": "0", "description": "KX-37025-1110. PIPETA MOHR CLASE A SERIADA Y CERTIFICADA, 1 ML, KIMAX 37025 CON ESCALA ÁMBAR Y CÓDIGO DE COLOR", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 136, "currency": "MXN" } } }, { "id": "0", "description": "KX-37025-5. PIPETA MOHR CLASE A SERIADA Y CERTIFICADA, 5 ML, KIMAX 37025 CON ESCALA ÁMBAR Y CÓDIGO DE COLOR", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 166, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO Y CALIBRACIÓN DE LOTE DE 77 BALANZAS ANALÍTICAS Y 2 TERMOBALANZAS . NOTA LA CALIBRACIÓN LA DEBE REALIZAR UN LABORATORIO ACREDITADO BAJO LOS REQUISITOS DE 17025 , DEBEN SER AL MENOS 5 PUNTOS DE CALIBRACIÓN.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 425250, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A BOMBA DE VACÍO FELISA MODELO FE-1405", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 8500, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO DE UN ENFRIADOR DE AGUA MARCA VWR MODELO 1167P NO DE SERIE 108ª00776. QUE INCLUYA PARTES", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 8500, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A CENTRÍFUGA SORVAL RC-6 PLUS CON ROTOR", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 5250, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO A EQUIPO DE REFRIGERACIÓN VERTICAL TIPO CONSERVADOR Y AL EQUIPO", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 4750, "currency": "MXN" } } }, { "id": "0", "description": "BALANZA DE BANCO COMPACTA OHAUS VALOR 1000 MODELO V12P15 (30539392) DE 30 LIBRAS /13.6 KG X 0.0LB/0.0KG, DE ACERO INOXIDABLE, COLOR BLANCA.", "classification": { "scheme": "CUCOP", "id": "29101-0030" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2000, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 524943. NO. DE CATALOGO 94-253-M CAJA DE GUANTES DE NITRILO MORADO PUNO LARGO TALLA MEDIANO PAQUETE(S)CON 50 PIEZA(S) MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 215, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 524945 NO. DE CATALOGO 94-253-L CAJA DE GUANTES DE NITRILO MORADO PUNO LARGO TALLA GRANDE PAQUETE(S) CON\n50 MICROFLEX\n50 MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 215, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 123447 NO. DE CATALOGO 2800-338 CAJA DE DEDALES (CARTUCHO) FILTRANTES DE EXTRACCION 33X80MM, GROSOR 1MMC/25 WHATMAN", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 1710, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO 105029 NO. DE CATALOGO CTR00140 ACETATO DE AMONIO ACS 500GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 268, "currency": "MXN" } } }, { "id": "0", "description": "105234 CTR01164 ALCOHOL ETÍLICO (ETANOL) ABSOLUTO RA PLASTICO 3.5LT CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 282, "currency": "MXN" } } }, { "id": "0", "description": "FÓRMULA LINEAL: CH3CO2NH4. ACETATO DE AMINIO 25GR. SKU 73594-25G-F.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4125, "currency": "MXN" } } }, { "id": "0", "description": "1 KILO DE 1-VINIL-2-PIRROLIDINONA\nNO. CAT. SIGMA ALDRICH: V3409-1KG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 3618, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ ERLENMEYER DE VIDRIO DE 500 ML MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 126, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ ERLENMEYER DE 125 ML DE VIDRIO MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 93, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ ERLENMEYER DE 250 ML DE VIDIRO, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ ERLENMEYER DE 50 ML DE VIDRIO, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 8, "unit": { "name": "SERVICIO", "value": { "amount": 87, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ ERLENMEYER DE 1000 ML DE VIDRIO, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 189, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO DE 100ML MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 53, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO DE 250 ML, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 8, "unit": { "name": "PIEZA", "value": { "amount": 72, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO DE 1000ML, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0052" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 165, "currency": "MXN" } } }, { "id": "0", "description": "MICROTUBOS DE 1.5 ML DE POLIPROPILENO, MARCA: AXYGEN, BOLSA CON 500 PIEZAS, CATALOGO: MCT-150-C", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 223, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO AZUL TALLA GRANDE, PAQUETE CON 100 PIEZAS, MARCA: MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 268, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO AZUL, PAQUETE CON 100 PIEZAS, TALLA CHICA, MARCA: MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 268, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO AZUL, TALLA MEDIANA, PAQUETE CON 100 PIEZAS, MARCA MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 268, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 250 GRAMOS DE CARBÓN ACTIVADO\nNÚMERO DE CAS:7440-44 31616-250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1719, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 500 GRAMOS DE SODIUM METABISULFITE REAGENTPLUS®, =99% S9000-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 919, "currency": "MXN" } } }, { "id": "0", "description": "INDIUM(III) NITRATE HYDRATE 99.999% TRACE METALS BASIS, CÓDIGO DE CATÁLOGO: 254215-10G, FRASCO DE 10 G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2677, "currency": "MXN" } } }, { "id": "0", "description": "1,2-BIS(2-CHLOROETHOXY)ETHANE, 97%\n241628-100G", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1359, "currency": "MXN" } } }, { "id": "0", "description": "385506-100ML\n2,2´-(ETHYLENEDIOXY)BIS(ETHYLAMINE), 98%", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1874, "currency": "MXN" } } }, { "id": "0", "description": "162973-10G\n2-[2-(2-CHLOROETHOXY)ETHOXY]ETHANOL, 96%", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1325, "currency": "MXN" } } }, { "id": "0", "description": "FRASCOS DE DEXTRANO NO. DE CATALOGO 31389-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3266, "currency": "MXN" } } }, { "id": "0", "description": "ACETONITRILO. NUMERO DE REFERENCIA DEL PRODUCTO 34998-4X4L. (1 PAQUETE DE 4X4L)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3520, "currency": "MXN" } } }, { "id": "0", "description": "ACETONA. NUMERO DE REFERENCIA DEL PRODUCTO 270725-4L. HPLC", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1159, "currency": "MXN" } } }, { "id": "0", "description": "\"DIMETHYLSULFOXIDE, =99.5% (GC), SUITABLE FOR PLANT CELL CULTURE, CÓDIGO : D4540-100ML. DENSIDAD DE VAPOR\n2.7 (VS AIR)\n\nNIVEL DE CALIDAD\n200\n\nPRESIÓN DE VAPOR\n0.42 MMHG ( 20 °C)\n\nANÁLISIS\n=99.5% (GC)\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n573 °F\n\nLIM. EXPL.\n42 %, 63 °F\n\nTECHNIQUE(S)\nCELL CULTURE | PLANT: SUITABLE\nCRYOPRESERVATION: SUITABLE\n\nIMPUREZAS\n(0.1% WATER (KARL FISCHER)\n\nCOLOR\nCOLORLESS\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.479 (LIT.)\n\nBP\n189 °C (LIT.)\n\nMP\n16-19 °C (LIT.)\n\nSOLUBILIDAD\nH2O: MISCIBLE (COMPLETELY)\n\nDENSIDAD\n1.10 G/ML (LIT.)\n\nSMILES STRING\nCS(C)=O\n\nINCHI\n1S/C2H6OS/C1-4(2)3/H1-2H3\n\nINCHI KEY\nIAZDPXIOMUYVGZ-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "\"ITACONIC ANHYDRIDE 95%, CÓDIGO DE SIGMA ALDRICH: 259926-25G. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n95%\n\nFORMULARIO\nSOLID\n\nBP\n114-115 °C/12 MMHG (LIT.)\n\nMP\n66-68 °C (LIT.)\n\nSMILES STRING\nC=C1CC(=O)OC1=O\n\nINCHI\n1S/C5H4O3/C1-3-2-4(6)8-5(3)7/H1-2H2\n\nINCHI KEY\nOFNISBHGPNMTMS-UHFFFAOYSA-N\n\nGENE INFORMATION\nHUMAN ... FNTA(2339) , PGGT1B(5229)\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1219, "currency": "MXN" } } }, { "id": "0", "description": "METANOL R.A, FRASCO 4 LITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 166, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO R.A 4 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2092, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO RA 4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1206, "currency": "MXN" } } }, { "id": "0", "description": "\"COPPER(I) SELENIDE, 99.95% TRACE METALS BASIS, CÓDIGO: 481629-5G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n99.95% TRACE METALS BASIS\n\nFORMULARIO\nPOWDER AND CHUNKS\n\nCARACTERÍSTICAS DE LOS PRODUCTOS ALTERNATIVOS MÁS SOSTENIBLES\nDESIGN FOR ENERGY EFFICIENCY\nLEARN MORE ABOUT THE PRINCIPLES OF GREEN CHEMISTRY.\n\nDENSIDAD\n6.84 G/ML AT 25 °C (LIT.)\n\nCATEGORÍA ALTERNATIVA MÁS SOSTENIBLE\nENABLING,\n\nSMILES STRING\n[CU][SE][CU]\n\nINCHI\n1S/2CU.SE\n\nINCHI KEY\nKTLOQXXVQYUCJU-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3877, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO HPLC 4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 969, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO ACS 20L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3568, "currency": "MXN" } } }, { "id": "0", "description": "1 LITRO ALCOHOL ISOPROPÍLICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 93, "currency": "MXN" } } }, { "id": "0", "description": "1026. MEDIDOR DE BOLSILLO DE PH IMPERMEABLE PHEP CON RESOLUCIÓN DE 0.1 MOD. HI98107, HANNA INSTRUMENTS", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 981, "currency": "MXN" } } }, { "id": "0", "description": "10759. MATRAZ VOLUMETRICO AFORADO CLASE A 100ML - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 213, "currency": "MXN" } } }, { "id": "0", "description": "5069. GUANTES DE NITRILO NEGRO SIN POLVO, TEXTURIZADOS, PAQUETE C/100 PIEZAS, TALLA G - MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 214, "currency": "MXN" } } }, { "id": "0", "description": "5069. GUANTES DE NITRILO NEGRO SIN POLVO, TEXTURIZADOS, PAQUETE C/100 PIEZAS, TALLA M - MICROFLEX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 214, "currency": "MXN" } } }, { "id": "0", "description": "20190. PEROXIDO DE HIDROGENO SOLN 30%, PLASTICO 3.5LT - CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 248, "currency": "MXN" } } }, { "id": "0", "description": "NITRITO DE SODIO CRISTALES, A.C.S. MCA \nMEYER, 500 GR, CAT. 2470-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 496, "currency": "MXN" } } }, { "id": "0", "description": "1-ALLYL-3-METHYLIMIDAZOLIUM CHLORIDE (50 G)\nSIGMA ALDRICH NO. CATALOGO 43961-50G-F", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7019, "currency": "MXN" } } }, { "id": "0", "description": "1-BUTYL-3-METHYLIMIDAZOLIUM CHLORIDE (50 G)\nSIGMA ALDRICH NO. CATALOGO 94128-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4413, "currency": "MXN" } } }, { "id": "0", "description": "1-ETHYL-3-METHYLIMIDAZOLIUM ACETATE (5 G)\nSIGMA ALDRICH NO. CATALOGO 689483-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6260, "currency": "MXN" } } }, { "id": "0", "description": "DIMETIL SULFÓXIDO-D6 (50 G)\nSIGMA ALDRICH. 151874-50G-GL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4404, "currency": "MXN" } } }, { "id": "0", "description": "1-ETHYL-3-METHYLIMIDAZOLIUM ACETATE. (5 G)\nSIGMA ALDRICH NO. CATALOGO 689483-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6260, "currency": "MXN" } } }, { "id": "0", "description": "SILICON DIOXIDE NANOPOWDER, 10-20 NM PA& \n50 G SIGMA ALDRICH NO. CATALOGO 637238-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2925, "currency": "MXN" } } }, { "id": "0", "description": "COPPER(II) OXIDE, (CUO)\n241741-100G\n100 GRAMOS\nACS REAGENT, =99.0%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1732, "currency": "MXN" } } }, { "id": "0", "description": "NICKEL(II) OXIDE (NIO)\n399523-100G\nGREEN, -325 MESH, 99%\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2307, "currency": "MXN" } } }, { "id": "0", "description": "IRON(III) OXIDE, (FE2O3)\n 310050-2.5KG\nPOWDER, (5 µM, =96%\n2.5 KILOGRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5998, "currency": "MXN" } } }, { "id": "0", "description": "GADOLINIUM (III) OXIDE, (GD2O3)\n48220-25G\nACS REAGENT PLUS, =99.9%\n25 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2654, "currency": "MXN" } } }, { "id": "0", "description": "IRON(III) NITRATE NONAHYDRATE - FE(NO3)3 · 9H2O\n216828-500G\nACS REAGENT, =98%\n500 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2190, "currency": "MXN" } } }, { "id": "0", "description": "GADOLINIUM(III) NITRATE HEXAHYDRATE - GD(NO3)3 · 6H2O\n451134-50G\n99.99% TRACE METALS BASIS\n50 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 10232, "currency": "MXN" } } }, { "id": "0", "description": "COBALT(II) NITRATE HEXAHYDRATE - CO(NO3)2 · 6H2O\n239267-100G\nACS REAGENT, =98%\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1938, "currency": "MXN" } } }, { "id": "0", "description": "NICKEL(II) NITRATE HEXAHYDRATE - NI(NO3)2 · 6H2O\n203874-100G\n99.999% TRACE METALS BASIS\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5917, "currency": "MXN" } } }, { "id": "0", "description": "COPPER(II) NITRATE HEMI(PENTAHYDRATE) - CU(NO3)2 · 2.5H2O\n223395-100G\nACS REAGENT, 98%\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1577, "currency": "MXN" } } }, { "id": "0", "description": "ZINC NITRATE HEXAHYDRATE - ZN(NO3)2 · 6H2O\n228737-100G\nREAGENT GRADE, 98%\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 639, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIMETILFORMAMIDA - HCON(CH3)2\n319937-1L\nACS REAGENT, =99.8%\n1 LITRO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3350, "currency": "MXN" } } }, { "id": "0", "description": "POLYVINYLPYRROLIDONE - (C6H9NO)N\nPVP360-500G\nMOL WT (NUMBER AVERAGE MOLECULAR WEIGHT MN 360KDA)\n500 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3295, "currency": "MXN" } } }, { "id": "0", "description": "LENTES DE SEGURIDAD DE POLICARBONATO VERATTI GT CON MARCO CLARO ANTIRAYAS,", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 30, "unit": { "name": "PIEZA", "value": { "amount": 45, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS DE CULTIVO DE VIDRIO 16X150MM DECORADO CON TAPA DE ROSCA, MARCA KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 30, "unit": { "name": "PIEZA", "value": { "amount": 19, "currency": "MXN" } } }, { "id": "0", "description": "PHYTAGEL POLVO BIOREAGENT PARA CULTIVO CELULAR DE PLANTAS 1KG . CATALOGO: P8169-1KG", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 9351, "currency": "MXN" } } }, { "id": "0", "description": "AGAR BACTERIOLOGICO 450 GRAMOS, MARCA: BIOXON. CATALOGO: 215000", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1671, "currency": "MXN" } } }, { "id": "0", "description": "CALDO DEXTROSA PAPA, 450 GRAMOS, MARCA DIFCO. CATALOGO: 254920", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1938, "currency": "MXN" } } }, { "id": "0", "description": "\"LUPEROX® A98, BENZOYL PEROXIDE, REAGENT GRADE, =98%, CÓDIGO: 179981-500G. GRADO: REAGENT GRADE; NIVEL DE CALIDAD: 200; ANÁLISIS: =98%; FORMULARIO: SOLID; TEMP. DE AUTOIGNICIÓN: 176 °F; REACTION SUITABILITY: REAGENT TYPE: OXIDANT; MP: 105 °C (LIT.); \n SMILES STRING: O=C(OOC(=O)C1CCCCC1)C2CCCCC2; INCHI: 1S/C14H10O4/C15-13(11-7-3-1-4-8-11)17-18-14(16)12-9-5-2-6-10-12/H1-10H; INCHI KEY: OMPJBNCRMGITSC-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3161, "currency": "MXN" } } }, { "id": "0", "description": "\"MYRCENE, TECHNICAL GRADE, M100005-500ML. GRADO\n TECHNICAL GRADE\n \n NIVEL DE CALIDAD\n 200\n \n DENSIDAD DE VAPOR\n 4.7 (VS AIR)\n \n PRESIÓN DE VAPOR\n ~7 MMHG ( 20 °C)\n \n CONTIENE\n 0.1% ALPHA-TOCOPHEROL\n \n ÍNDICE DE REFRACCIÓN\n N20/D 1.469 (LIT.)\n \n BP\n 167 °C (LIT.)\n \n SOLUBILIDAD\n WATER: SOLUBLE 0.00109 G/L AT 20 °C\n \n DENSIDAD\n 0.791 G/ML AT 25 °C (LIT.)\n \n TEMP. DE ALMACENAMIENTO\n -20°C\n \n SMILES STRING\n C\\C(C)=C/CCC(=C)C=C\n \n INCHI\n 1S/C10H16/C1-5-10(4)8-6-7-9(2)3/H5,7H,1,4,6,8H2,2-3H3\n \n INCHI KEY\n UAHWPYUMFXYFJY-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1816, "currency": "MXN" } } }, { "id": "0", "description": "\"GLYCIDYL METHACRYLATE, 97%, CONTAINS 100 PPM MONOMETHYL ETHER HYDROQUINONE AS INHIBITOR, CÓDIGO : 151238-500G. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n97%\n\nFORMULARIO\nLIQUID\n\nCONTIENE\n100 PPM MONOMETHYL ETHER HYDROQUINONE AS INHIBITOR\n\nIMPUREZAS\n0.02% EPICHLOROHYDRIN\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.449 (LIT.)\n\nBP\n189 °C (LIT.)\n\nDENSIDAD\n1.042 G/ML AT 25 °C (LIT.)\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nCC(=C)C(=O)OCC1CO1\n\nINCHI\n1S/C7H10O3/C1-5(2)7(8)10-4-6-3-9-6/H6H,1,3-4H2,2H3\n\nINCHI KEY\nVOZRXNHHFUQHIL-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3675, "currency": "MXN" } } }, { "id": "0", "description": "\"2-(DODECYLTHIOCARBONOTHIOYLTHIO)-2-METHYLPROPIONIC ACID, 98% (HPLC), CÓDIGO : 723010-5G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n98% (HPLC)\n\nFORMULARIO\nPOWDER\n\nMP\n57-63 °C\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nCCCCCCCCCCCCSC(=S)SC(C)(C)C(O)=O\n\nINCHI\n1S/C17H32O2S3/C1-4-5-6-7-8-9-10-11-12-13-14-21-16(20)22-17(2,3)15(18)19/H4-14H2,1-3H3,(H,18,19)\n\nINCHI KEY\nDZFGVGDQHQHOKZ-UHFFFAOYSA-N\n\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 12475, "currency": "MXN" } } }, { "id": "0", "description": "\"TETRAHIDROFURAN, INHIBITOR-FREE, SUITABLE FOR HPLC, =99.9%, CÓDIGO : 34865-4L. DENSIDAD DE VAPOR\n2.5 (VS AIR)\n\nNIVEL DE CALIDAD\n100\n\nPRESIÓN DE VAPOR\n114 MMHG ( 15 °C)\n143 MMHG ( 20 °C)\n\nANÁLISIS\n=99.9%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n610 °F\n\nLIM. EXPL.\n1.8-11.8 %\n\nTECHNIQUE(S)\nHPLC: SUITABLE\n\nIMPUREZAS\n=0.0005% NON-VOLATILE MATTER\n=0.002% FREE ACID (AS CH3COOH)\n=0.05% PEROXIDES (AS H2O2)\n=0.05% WATER (KARL FISCHER)\n\nRESIDUO DE EVAP.\n=0.0005%\n\nCOLOR\nAPHA: =10\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.407 (LIT.)\n\nPH\n~7\n\nBP\n65-67 °C (LIT.)\n\nMP\n-108 °C (LIT.)\n\nDENSIDAD\n0.889 G/ML AT 25 °C (LIT.)\n\nABSORCIÓN\n=0.0044 AT 315 NM\n=0.005 AT 350 NM\n=0.005 AT 400 NM\n=0.02 AT 300 NM\n=0.046 AT 275 NM\n=0.18 AT 250 NM\n=0.26 AT 245 NM\n=1.0 AT 212 NM\n\nABSORCIÓN UV\n?: 245 NM AMAX: =0.26\n?: 275 NM AMAX: =0.046\n?: 315 µM AMAX: =0.0044\n\nIDONEIDAD\nCOMPLIES FOR IR SPECTROSCOPY\n\nAPPLICATION(S)\nFOOD AND BEVERAGES\n\nSMILES STRING\nC1CCOC1\n\nINCHI\n1S/C4H8O/C1-2-4-5-3-1/H1-4H2\n\nINCHI KEY\nWYURNTSHIVDZCO-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2432, "currency": "MXN" } } }, { "id": "0", "description": "ASTAXANTHIN SML0982-50MG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3572, "currency": "MXN" } } }, { "id": "0", "description": "LYCOPENE\t=98% (HPLC), FROM TOMATO SMB00706-1MG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4559, "currency": "MXN" } } }, { "id": "0", "description": "XANTHOPHYLL\tX6250-1MG, FROM MARIGOLD", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4836, "currency": "MXN" } } }, { "id": "0", "description": "94964-500UL BLUEYE PRESTAINED PROTEIN LADDER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4930, "currency": "MXN" } } }, { "id": "0", "description": "EXTRACTO DE LEVADURA 450 GRAMOS. MARCA: MCD. CATALOGO: DBK9031. PARA REALIZAR MEDIOS DE CULTIVO PARA MICROORGANISMOS", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 938, "currency": "MXN" } } }, { "id": "0", "description": "\"PIPERONYLIC ACID, 99% CODIGO DE SIGMA ALDRICH: P49805-25G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n99%\n\nFORMULARIO\nPOWDER\n\nMP\n229-231 °C (LIT.)\n\nSMILES STRING\nOC(=O)C1CCC2OCOC2C1\n\nINCHI\n1S/C8H6O4/C9-8(10)5-1-2-6-7(3-5)12-4-11-6/H1-3H,4H2,(H,9,10)\n\nINCHI KEY\nVDVJGIYXDVPQLP-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4840, "currency": "MXN" } } }, { "id": "0", "description": "\"N, N-DICYCLOHEXYL CARBODIIMIDE, 99%, CÓDIGO DE SIGMA ALDRICH: D80002-100G. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n99%\n\nFORMULARIO\nSOLID\n\nREACTION SUITABILITY\nREACTION TYPE: COUPLING REACTIONS\n\nBP\n122-124 °C/6 MMHG (LIT.)\n\nMP\n34-35 °C (LIT.)\n\nSMILES STRING\nC1CCC(CC1)N=C=NC2CCCCC2\n\nINCHI\n1S/C13H22N2/C1-3-7-12(8-4-1)14-11-15-13-9-5-2-6-10-13/H12-13H,1-10H2\n\nINCHI KEY\nQOSSAOTZNIDXMA-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 729, "currency": "MXN" } } }, { "id": "0", "description": "\"HIDRÓXIDO DE SODIO, REAGENT GRADE, =98%, PELLETS (ANHYDROUS), S5881-1KG. GRADO\nREAGENT GRADE\n\nNIVEL DE CALIDAD\n200\n\nAGENCY\nSUITABLE FOR EPA 1621\nSUITABLE FOR SM 4500 - NH3\n\nDENSIDAD DE VAPOR\n)1 (VS AIR)\n\nPRESIÓN DE VAPOR\n(18 MMHG ( 20 °C)\n3 MMHG ( 37 °C)\n\nANÁLISIS\n=98%\n\nFORMULARIO\nPELLETS (ANHYDROUS)\n\nTECHNIQUE(S)\nCELL CULTURE | MAMMALIAN: SUITABLE\n\nIMPUREZAS\n=1.0% SODIUM CARBONATE\n\nMP\n318 °C (LIT.)\n\nSOLUBILIDAD\nWATER: SOLUBLE 1260 G/L AT 20 °C\n\nDENSIDAD\n2.13 G/CM3 AT 20 °C\n\nSMILES STRING\n[OH-].[NA+]\n\nINCHI\n1S/NA.H2O/H;1H2/Q+1;/P-1\n\nINCHI KEY\nHEMHJVSKTPXQMS-UHFFFAOYSA-M\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2477, "currency": "MXN" } } }, { "id": "0", "description": "\"TETRABUTYLAMMONIUM BROMIDE, REAGENTPLUS®, =99.0%, 193119-100G. NIVEL DE CALIDAD\n300\n\nLÍNEA DEL PRODUCTO\nREAGENTPLUS®\n\nANÁLISIS\n=99.0%\n\nFORMULARIO\nPOWDER, CRYSTALS OR GRANULES\n\nPH\n6.48 (30 °C)\n\nMP\n102-106 °C (LIT.)\n\nSOLUBILIDAD\nETHANOL: 50 MG/ML, CLEAR, COLORLESS TO LIGHT YELLOW\n\nSMILES STRING\n[BR-].CCCC[N+](CCCC)(CCCC)CCCC\n\nINCHI\n1S/C16H36N.BRH/C1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/H5-16H2,1-4H3;1H/Q+1;/P-1\n\nINCHI KEY\nJRMUNVKIHCOMHV-UHFFFAOYSA-M\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1865, "currency": "MXN" } } }, { "id": "0", "description": "\"PERIODIC ACID, REAGENTPLUS®, =99.0%, CÓDIGO DE SIGMA ALDRICH: P7875-100G. NIVEL DE CALIDAD\n100\n\nLÍNEA DEL PRODUCTO\nREAGENTPLUS®\n\nANÁLISIS\n=99.0%\n\nFORMULARIO\nPOWDER OR CRYSTALS\n\nREACTION SUITABILITY\nREAGENT TYPE: OXIDANT\n\nTECHNIQUE(S)\nTOXICOLOGY ASSAY: SUITABLE\n\nMP\n122 °C (LIT.)\n\nSOLUBILIDAD\nWATER: 100 MG/ML, CLEAR, COLORLESS\n\nSMILES STRING\nOI(O)(O)(O)(O)=O\n\nINCHI\n1S/H5IO6/C2-1(3,4,5,6)7/H(H5,2,3,4,5,6,7)\n\nINCHI KEY\nTWLXDPFBEPBAQB-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2962, "currency": "MXN" } } }, { "id": "0", "description": "\"\"\"WHATMAN® QUALITATIVE FILTER PAPER, GRADE 4, CIRCLES, DIAM. 125 MM, PACK OF 100, CÓDIGO DE SIGMA ALDRICH: WHA1004125. MATERIALES\nCELLULOSE FILTERS\nCIRCLES\n\nENVASE\nPACK OF 100\n\nMANUFACTURER/TRADENAME\nWHATMAN 1004-125\nWHATMAN ARTICLE NO. 28414014 (US REFERENCE)\n\nPARÁMETROS\n0.22 PSI WET BURST\n37 SEC/100 ML SPEED (HERZBERG)\n\nDIÁMETRO\n125 MM\n\nGROSOR\n205 µM\n\nCENIZA\n=0.06%\n\nTAMAÑO DE PORO\n20-25 µM (PARTICLE RETENTION)\n\nPESO BÁSICO\n92 G/M2\"\"", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 474, "currency": "MXN" } } }, { "id": "0", "description": "\"BISPHENOL A GLYCEROLATE DIMETHACRYLATE, CÓDIGO : 494356-100ML. COMPOSICIÓN\nGLYCEROL/PHENOL, 1\n\nNIVEL DE CALIDAD\n200\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.552 (LIT.)\n\nDENSIDAD\n1.161 G/ML AT 25 °C (LIT.)\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nCC(=C)C(=O)OCC(O)COC1CCC(CC1)C(C)(C)C2CCC(OCC(O)COC(=O)C(C)=C)CC2\n\nINCHI\n1S/C29H36O8/C1-19(2)27(32)36-17-23(30)15-34-25-11-7-21(8-12-25)29(5,6)22-9-13-26(14-10-22)35-16-24(31)18-37-28(33)20(3)4/H7-14,23-24,30-31H,1,3,15-18H2,2,4-6H3\n\nINCHI KEY\nAMFGWXWBFGVCKG-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1233, "currency": "MXN" } } }, { "id": "0", "description": "\"ÁCIDO FOSFÓRICO. ACS REAGENT, 85 WT. % IN H2O, CÓDIGO DE SIGMA ALDRICH 695017-100ML. GRADO\nACS REAGENT\n\nNIVEL DE CALIDAD\n200\n\nDENSIDAD DE VAPOR\n3.4 (VS AIR)\n\nPRESIÓN DE VAPOR\n2.2 MMHG ( 20 °C)\n5 MMHG ( 25 °C)\n\nANÁLISIS\n=85% H3PO4 BASIS (BY NAOH, TITRATION)\n\nFORMULARIO\nLIQUID\n\nCONCENTRACIÓN\n=85 WT. % IN H2O\n\nTECHNIQUE(S)\nNMR: SUITABLE\n\nIMPUREZAS\nREDUCING SUBSTANCES, PASSES TEST\n=0.001% VOLATILE ACIDS (AS CH3COOH)\n\nCOLOR\nAPHA: =10\n\nBP\n158 °C (LIT.)\n\nMP\n~40 °C (LIT.)\n\nDENSIDAD\n1.685 G/ML AT 25 °C (LIT.)\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =3 PPM\nNITRATE (NO3-): =5 PPM\nSULFATE (SO42-): =0.003%\n\nTRAZAS DE CATIÓN\nAS: =1 PPM\nCA: =0.002%\nFE: =0.003%\nK: =0.005%\nMG: =0.02%\nMN: =0.5 PPM\nNA: =0.025%\nSB: =0.002%\nHEAVY METALS: =0.001% (BY ICP)\n\nSMILES STRING\nOP(O)(O)=O\n\nINCHI\n1S/H3O4P/C1-5(2,3)4/H(H3,1,2,3,4)\n\nINCHI KEY\nNBIIXXVUZAFLBC-UHFFFAOYSA-N\n\nGENE INFORMATION\nHUMAN ... SRC(6714)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1044, "currency": "MXN" } } }, { "id": "0", "description": "\"IRON(III) NITRATE NONAHYDRATE. ACS REAGENT, 98%, CÓDIGO DE SIGMA ALDRICH: 216828-500G. GRADO\nACS REAGENT\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=98%\n98.0-101.0% (ACS SPECIFICATION)\n\nFORMULARIO\nMOIST CRYSTALS\n\nREACTION SUITABILITY\nREAGENT TYPE: CATALYST\nCORE: IRON\n\nCARACTERÍSTICAS DE LOS PRODUCTOS ALTERNATIVOS MÁS SOSTENIBLES\nCATALYSIS\nLEARN MORE ABOUT THE PRINCIPLES OF GREEN CHEMISTRY.\n\nIMPUREZAS\n=0.005% INSOLUBLES\n=0.1% SUBSTANCES NOT PPTD. BY NH4OH (AS SULFATES)\n\nPH\n1.5 (20 °C)\n\nMP\n47 °C (LIT.)\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =5 PPM\nSULFATE (SO42-): =0.01%\n\nTRAZAS DE CATIÓN\nCA: =0.01%\nK: =0.005%\nMG: =0.005%\nNA: =0.05%\n\nCATEGORÍA ALTERNATIVA MÁS SOSTENIBLE\n, ALIGNED\n\nSMILES STRING\nO.O.O.O.O.O.O.O.O.[FE+3].[O-][N+]([O-])=O.[O-][N+]([O-])=O.[O-][N+]([O-])=O\n\nINCHI\n1S/FE.3NO3.9H2O/C;3*2-1(3)4;;;;;;;;;/H;;;;9*1H2/Q+3;3*-1;;;;;;;;;\n\nINCHI KEY\nSZQUEWJRBJDHSM-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2190, "currency": "MXN" } } }, { "id": "0", "description": "\"MANGANESE(II) NITRATE HYDRATE. 98%, 288640-500G. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n98%\n\nFORMULARIO\nSOLID\n\nCOMPOSICIÓN\nDEGREE OF HYDRATION, 4-6\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nO.[MN++].[O-][N+]([O-])=O.[O-][N+]([O-])=O\n\nINCHI\n1S/MN.2NO3.H2O/C;2*2-1(3)4;/H;;;1H2/Q+2;2*-1;\n\nINCHI KEY\nHBTFASPVVFSRRI-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2301, "currency": "MXN" } } }, { "id": "0", "description": "\"ÁCIDO CÍTRICO. 99%, CÓDIGO DE SIGMA ALDRICH: C0759-1KG. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n99%\n\nFORMULARIO\nCRYSTALS\n\nLIM. EXPL.\n8 %, 65 °F\n\nPKA (25 °C)\n(1) 3.13, (2) 4.76, (3) 6.40\n\nPKA \n(1) 3.13, (2) 4.76, (3) 6.4\n\nMP\n153-159 °C (LIT.)\n\nSOLUBILIDAD\nWATER: SOLUBLE 383 G/L AT 25 °C\n\nSMILES STRING\nOC(=O)CC(O)(CC(O)=O)C(O)=O\n\nINCHI\n1S/C6H8O7/C7-3(8)1-6(13,5(11)12)2-4(9)10/H13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)\n\nINCHI KEY\nKRKNYBCHXYNGOX-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1838, "currency": "MXN" } } }, { "id": "0", "description": "\"CLOROFORMO-D 99.8 %D, 99.8 ATOM % D 151823-250G. PUREZA ISOTÓPICA\n99.8 ATOM % D\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=99% (CP)\n\nFORMULARIO\nLIQUID\n\nTECHNIQUE(S)\nNMR: SUITABLE\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.444 (LIT.)\n\nBP\n60.9 °C (LIT.)\n\nMP\n-64 °C (LIT.)\n\nDENSIDAD\n1.500 G/ML AT 25 °C (LIT.)\n\nCAMBIO DE MASA\nM+1\n\nSMILES STRING\n[2H]C(CL)(CL)CL\n\nINCHI\n1S/CHCL3/C2-1(3)4/H1H/I1D\n\nINCHI KEY\nHEDRZPFGACZZDS-MICDWDOJSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3055, "currency": "MXN" } } }, { "id": "0", "description": "\"(VINYLBENZYL)TRIMETHYLAMMONIUM CHLORIDE 99%, 458694-100G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n99%\n\nMP\n240 °C (DEC.) (LIT.)\n\nSMILES STRING\n[CL-].C[N+](C)(C)CC1CCC(C=C)CC1\n\nINCHI\n1S/C12H18N.CLH/C1-5-11-6-8-12(9-7-11)10-13(2,3)4;/H5-9H,1,10H2,2-4H3;1H/Q+1;/P-1\n\nINCHI KEY\nTVXNKQRAZONMHJ-UHFFFAOYSA-M\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6341, "currency": "MXN" } } }, { "id": "0", "description": "1-AMINOCYCLOPROPANECARBOXYLIC ACID, CAT. A3903-1G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 16917, "currency": "MXN" } } }, { "id": "0", "description": "1-AMINOCYCLOPROPANECARBOXYLIC ACID, CAT. A3903-250MG.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5221, "currency": "MXN" } } }, { "id": "0", "description": "N-(3-DIMETHYLAMINOPROPYL)-N´-ETHYLCARBODIIMIDE HYDROCHLORIDE. CAT. E7750-5G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2071, "currency": "MXN" } } }, { "id": "0", "description": "2,4-DIMETHYLPYRROLE. CAT. 390836-5G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3386, "currency": "MXN" } } }, { "id": "0", "description": "XYLITOL. CAT. X3375-100G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 934, "currency": "MXN" } } }, { "id": "0", "description": "SODIUM DEOXYCHOLATE. D6750-25G.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1116, "currency": "MXN" } } }, { "id": "0", "description": "CAJA PETRI 100X15MM, DESECHABLES SIN DIVISION DE POLIETIRENO ESTERIL PAQUETE CON 10 PIEZAS. SYM. CATALOGO: 01SP", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 50, "unit": { "name": "PIEZA", "value": { "amount": 32, "currency": "MXN" } } }, { "id": "0", "description": "POLY(VINYL ALCOHOL) 80% HYDROLIZED MW 9000-10,000 G/MOL CATÁLOGO ALDRICH = 360627-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3458, "currency": "MXN" } } }, { "id": "0", "description": "QUITOSANO EN POLVO DE ALTO PESO MOLECULAR (APROX 200,000 G/MOL), BOTE CON 50 GRAMOS, 419419-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2337, "currency": "MXN" } } }, { "id": "0", "description": "CALDO NUTRITIVO PARA ENSAYOS BIOLÓGICOS, DE LA MARCA BIOXON CON 450 GRAMOS,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1968, "currency": "MXN" } } }, { "id": "0", "description": "ZINC OXIDE, 544906-50 G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2681, "currency": "MXN" } } }, { "id": "0", "description": "1-BUTYL-3-METHYLIMIDAZOLIUM CHLORIDE. 94128-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4413, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE SODIO 500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 100, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO DE 2 LTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1478, "currency": "MXN" } } }, { "id": "0", "description": "REACTIVO BRADFORD - B6916-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2451, "currency": "MXN" } } }, { "id": "0", "description": "QUITOSANO - 448869-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1910, "currency": "MXN" } } }, { "id": "0", "description": "TITANIUM(IV) CHLORIDE, 208566-200G;", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1829, "currency": "MXN" } } }, { "id": "0", "description": "CELLULOSE FIBERS, (MEDIUM), C6288-100G.\nNÚMERO DE CAS:\n9004-34-6\nNÚMERO CE:\n232-674-9\nNÚMERO MDL:\nMFCD00081512\nNACRES:\nNA.56\nPROPIEDADES\nORIGEN BIOLÓGICO\n(SOFTWOOD TREE PULP)\n\nNIVEL DE CALIDAD\n200\n\nFORMULARIO\nFIBERS\n\nIMPUREZAS\nDARK PARTICLES\n\nCOLOR\nWHITE\n\nTAMAÑO DE PARTÍCULA\n(MEDIUM)\n\nINCHI\n1S/C12H22O11/C13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/H3-20H,1-2H2/T3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/M1/S1\n\nINCHI KEY\nGUBGYTABKSRVRQ-WFVLMXAXSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1221, "currency": "MXN" } } }, { "id": "0", "description": "ACETONA PORRON DE 18.5 L JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1589, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL ETILICO (ETANOL), PORRON DE 20 LITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 80, "unit": { "name": "LITRO", "value": { "amount": 73.25, "currency": "MXN" } } }, { "id": "0", "description": "ZINC NITRATE HEXAHYDRATE\n228737-100G\n2 X 100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 639, "currency": "MXN" } } }, { "id": "0", "description": "L-PHENYLALANINE\nREAGENT GRADE, =98% P2126\n\n100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2348, "currency": "MXN" } } }, { "id": "0", "description": "A2153-10G SEROALBÚMINA BOVINA", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2232, "currency": "MXN" } } }, { "id": "0", "description": "U1250-1KG UREA REAGENTPLUS®, =99.5%, PELLETS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1478, "currency": "MXN" } } }, { "id": "0", "description": "I202-100G IMIDAZOL REAGENTPLUS®, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 902, "currency": "MXN" } } }, { "id": "0", "description": "242284-100ML ANILINA ACS REAGENT, =99.5%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 949, "currency": "MXN" } } }, { "id": "0", "description": "322415-2L METANOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3938, "currency": "MXN" } } }, { "id": "0", "description": "252549-500ML FORMALDEHIDO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1587, "currency": "MXN" } } }, { "id": "0", "description": "I3408-100G INDOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2304, "currency": "MXN" } } }, { "id": "0", "description": "L-CYSTINEC8755-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2767, "currency": "MXN" } } }, { "id": "0", "description": "N-BROMOPHTHALIMIDE\t260908-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3076, "currency": "MXN" } } }, { "id": "0", "description": "A-CYANO-4-HYDROXYCINNAMIC ACID\t476870-10G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2269, "currency": "MXN" } } }, { "id": "0", "description": "2,5-DIHYDROXYBENZOIC ACID\t149357-10G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 909, "currency": "MXN" } } }, { "id": "0", "description": "ÁCIDO TRIFLUOROACÉTICO\t302031-10X1ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4017, "currency": "MXN" } } }, { "id": "0", "description": "ACETONITRILO\t34998-4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 14474, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO PREVENTIVO DE CAMPANA DE FLUJO LAMINAR VERTICAL, MARCA: CHD-LAB, MODELO: B-CV-03 (CLB-201-03), ID EQUIPO: 1203. REVISION DEL MECANISMO DE CERRADO DE LA PUERTA, LIMPIEZA Y LUBRICACION DE POLEAS, REVISION DE LAMPARA UV Y CONSIDERAR EL CAMBIO EN CASO NECESARIO. REVISION DE MOTOVENTILADOR, REVISION Y LIMPIEZA DEL INTERIOR DE LA CABINA. REVISION DEL SISTEMA ELECTRICO. REVISION DEL FLUJO DE AIRE, REVISION DE LA INTEGRIDAD Y FUNCIONAMIENTO DEL FILTRO HEPA QUE CUMPLA CON LAS ESPECIFICACIONES REQUERIDAS Y SI NO PASA LAS PRUEBAS CONSIDERAR QUE SE REALICE EL CAMBIO. AL FINAL DEL MANTEMIENTO REVISAR Y ASEGURARSE QUE EL EQUIPO QUEDE FUNCIONANDO CORRECTAMENTE.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 23000, "currency": "MXN" } } }, { "id": "0", "description": "3-HEXYLTHIOPHENE-2-BORONIC ACID PINACOL ESTER\t697400-5G\t\tALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 9978, "currency": "MXN" } } }, { "id": "0", "description": "CHLOROFORM-D (DEUTEROCLOROFORMO), 99.8 ATOM % D. NO. DE\nCATÁLOGO: 151823-50G, FRASCO DE 50 GRAMOS. NÚMERO DE\nCAS:865-49-6.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 768, "currency": "MXN" } } }, { "id": "0", "description": "ETILENGLICOL EN UN BIDÓN DE 18.5 L.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 873, "currency": "MXN" } } }, { "id": "0", "description": "310468-500G. CLORURO DE LITIO (LICL), ACS REAGENT, =99%, 500 GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 4855, "currency": "MXN" } } }, { "id": "0", "description": "S9251-100G. SULFANILAMIDA (H2NC6H4SO2NH2), =98%, 100 GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 1135, "currency": "MXN" } } }, { "id": "0", "description": "185868-1L. N,N-DIETHYLANILINE ((C2H5)2NC6H5), =99%, 1 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 1827, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO-D3, 99.8 ATOM % D, CONTAINS 0.03 %, 500 ML, 225789-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5732, "currency": "MXN" } } }, { "id": "0", "description": "DEUTERIUM OXIDE, 99.9 ATOM % D, CONTAINS 1 % (W/W) 3-(TRIMETHYLSILYL)-1-PROPANESULFONIC ACID, SODIUM SALT (DSS), 5 G, CALVE SIGMA ALDRICH-293040-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5811, "currency": "MXN" } } }, { "id": "0", "description": "TERT-BUTANOL, ACS REAGENT =99.0%, 2 L , CLAVE - 360538-2L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3730, "currency": "MXN" } } }, { "id": "0", "description": "FLUORESCEIN O,O´-DIACRYLATE, 98%, 500 MG, CLAVE 570257-500MG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5226, "currency": "MXN" } } }, { "id": "0", "description": "2-(DIETHYLAMINO)ETHYL METHACRYLATE, CONTAINS 1500 PPM MEHQ AS INHIBITOR, 99%, 1 L, CLAVE 408980-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3859, "currency": "MXN" } } }, { "id": "0", "description": "STARCH FROM CORN S9679-1KG SIGMA ALDRICH\nUNMODIFIED WAXY CORN STARCH OF ESSENTIALLY PURE AMYLOPECTIN; CONTAINS ONLY TRACE AMOUNTS OF AMYLOSE.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 6107, "currency": "MXN" } } }, { "id": "0", "description": "GELATINA FROM PORCINE SKIN G2500-1KG\nCAS 9000-70-8", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 5104, "currency": "MXN" } } }, { "id": "0", "description": "POLICAPROLACTONA 440744-500 GRAMOS\nAVERAGE MN 80,000", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6664, "currency": "MXN" } } }, { "id": "0", "description": "1-OCTADECENO DE SIGMA ALDRICH O806-1L, TECHNICAL GRADE, 90%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 5, "unit": { "name": "LITRO", "value": { "amount": 1163, "currency": "MXN" } } }, { "id": "0", "description": "9081 PEPTONA DE CASEINA TIPO I(TRIPTONA) 450 GR. MCD\nLAB", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1105, "currency": "MXN" } } }, { "id": "0", "description": "9031-MCD EXTRACTO DE LEVADURA 450GR MCD LAB MCD LAB", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 938, "currency": "MXN" } } }, { "id": "0", "description": "202134-25G CESIUM IODIDE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2191, "currency": "MXN" } } }, { "id": "0", "description": "203017-10G CESIUM BROMIDE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1297, "currency": "MXN" } } }, { "id": "0", "description": "369519-500G 4,7,10-TRIOXA-1,13-TRIDECANEDIAMINE 97%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1889, "currency": "MXN" } } }, { "id": "0", "description": "131377-5G 1,10-PHENANTHROLINE =99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1015, "currency": "MXN" } } }, { "id": "0", "description": "401188-10G ANTIMONY(III) IODIDE 98%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1139, "currency": "MXN" } } }, { "id": "0", "description": "211168-50G LEAD(II) IODIDE 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1614, "currency": "MXN" } } }, { "id": "0", "description": "667609-100ML BIS[2-(N,N-DIMETHYLAMINO)ETHYL] ETHER 97%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1460, "currency": "MXN" } } }, { "id": "0", "description": "303143-25G 3,6-DIMETHYL-1,4-DIOXANE-2,5-DIONE 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1941, "currency": "MXN" } } }, { "id": "0", "description": "364525-1L ÁCIDO OLEICO TECHNICAL GRADE, 90%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1572, "currency": "MXN" } } }, { "id": "0", "description": "227927-10G SILVER CHLORIDE REAGENTPLUS®, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2049, "currency": "MXN" } } }, { "id": "0", "description": "207969-100G YODURO DE POTASIO REAGENTPLUS®, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1374, "currency": "MXN" } } }, { "id": "0", "description": "360074-10G MAGNESIUM BROMIDE 98%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1100, "currency": "MXN" } } }, { "id": "0", "description": "206911-100G ALUMINUM CHLORIDE REAGENT GRADE, 98%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1273, "currency": "MXN" } } }, { "id": "0", "description": "464317-25G YTTRIUM(III) CHLORIDE HEXAHYDRATE\n99.99% TRACE METALS BASIS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1903, "currency": "MXN" } } }, { "id": "0", "description": "334073-5G INDIUM(III) CHLORIDE TETRAHYDRATE 97%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1460, "currency": "MXN" } } }, { "id": "0", "description": "B0750-100G BARIUM CHLORIDE DIHYDRATE =99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 952, "currency": "MXN" } } }, { "id": "0", "description": "248649-100ML HYDRIODIC ACID CONTAINS =1.5% HYPOPHOSPHOROUS ACID AS STABILIZER, ACS REAGENT, =47.0%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2547, "currency": "MXN" } } }, { "id": "0", "description": "268003-500ML HYDROBROMIC ACID REAGENT GRADE, 48%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1374, "currency": "MXN" } } }, { "id": "0", "description": "255521-100G STRONTIUM CHLORIDE HEXAHYDRATE ACS REAGENT, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1480, "currency": "MXN" } } }, { "id": "0", "description": "546739-100G ZINC BROMIDE DIHYDRATE 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1281, "currency": "MXN" } } }, { "id": "0", "description": "679445-1G 3-(BROMOMETHYL)PHENYLBORONIC ACID 90%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1588, "currency": "MXN" } } }, { "id": "0", "description": "117706-25ML PHENYLACETYLENE 98%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1353, "currency": "MXN" } } }, { "id": "0", "description": "F1635-500ML FORMALDEHÍDO SOLUTION CONTAINS 10-15% METHANOL AS STABILIZER, 37 WT. % IN H2O", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1141, "currency": "MXN" } } }, { "id": "0", "description": "104094-100ML PIPERIDINE REAGENTPLUS®, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1150, "currency": "MXN" } } }, { "id": "0", "description": "GREEN GRAPHENE QUANTUM DOTS\t900713-50MG\tALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7502, "currency": "MXN" } } }, { "id": "0", "description": "MULTIWALL CARBON NANOTUBES CARBOXYLIC ACID FUNCTIONALIZED\tALDRICH 755125-1G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4045, "currency": "MXN" } } }, { "id": "0", "description": "SILVER DISPERSION 736473-25G ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 13981, "currency": "MXN" } } }, { "id": "0", "description": "POLY(3,4-ETHYLENEDIOXYTHIOPHENE)-POLY(STYRENESULFONATE) PELLETS\t768618-1G \tALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1190, "currency": "MXN" } } }, { "id": "0", "description": "3D PRINTABLE GRAPHENE OXIDE INK\t916579-10ML ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3357, "currency": "MXN" } } }, { "id": "0", "description": "TRICLORURO DE FOSFORO (PCL3)\nNO. CATALOGO ALDRICH: 157791-1KG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 3437, "currency": "MXN" } } }, { "id": "0", "description": "\"QUITOSANO PESO BAJO CODIGO DE SIGMA ALDRICH: 448869-250G. NIVEL DE CALIDAD\n100\n\nFORMULARIO\nPOWDER\n\nMOL PESO\n50,000-190,000 DA (BASED ON VISCOSITY)\n\nVISCOSIDAD\n20-300 CP, 1 WT. % IN 1% ACETIC ACID(25 °C, BROOKFIELD)(LIT.)\n\nSOLUBILIDAD\nDILUTE AQUEOUS ACID: SOLUBLE\n\nINCHI\n1S/C56H103N9O39/C1-87-56(86)65-28-38(84)46(19(10-74)96-55(28)104-45-18(9-73)95-49(27(64)37(45)83)97-39-12(3-67)88-47(85)20(57)31(39)77)103-54-26(63)36(82)44(17(8-72)94-54)102-53-25(62)35(81)43(16(7-71)93-53)101-52-24(61)34(80)42(15(6-70)92-52)100-51-23(60)33(79)41(14(5-69)91-51)99-50-22(59)32(78)40(13(4-68)90-50)98-48-21(58)30(76)29(75)11(2-66)89-48/H11-55,66-85H,2-10,57-64H2,1H3,(H,65,86)/T11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48+,49+,50+,51+,52+,53+,54+,55+/M1/S1\n\nINCHI KEY\nFLASNYPZGWUPSU-SICDJOISSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6596, "currency": "MXN" } } }, { "id": "0", "description": "\"QUITOSANO PESO ALTO PESO, CODIGO DE SIGMA ALDRICH: 419419-250G. NIVEL DE CALIDAD\n100\n\nFORMULARIO\n(COARSE GROUND FLAKES AND POWDER)\n\nMOL PESO\n310000-375000 DA\n\nVISCOSIDAD\n800-2000 CP, 1 WT. % IN 1% ACETIC ACID(25 °C, BROOKFIELD)(LIT.)\n\nSOLUBILIDAD\nH2O: INSOLUBLE\nORGANIC SOLVENTS: INSOLUBLE\n\nINCHI\n1S/C56H103N9O39/C1-87-56(86)65-28-38(84)46(19(10-74)96-55(28)104-45-18(9-73)95-49(27(64)37(45)83)97-39-12(3-67)88-47(85)20(57)31(39)77)103-54-26(63)36(82)44(17(8-72)94-54)102-53-25(62)35(81)43(16(7-71)93-53)101-52-24(61)34(80)42(15(6-70)92-52)100-51-23(60)33(79)41(14(5-69)91-51)99-50-22(59)32(78)40(13(4-68)90-50)98-48-21(58)30(76)29(75)11(2-66)89-48/H11-55,66-85H,2-10,57-64H2,1H3,(H,65,86)/T11-,12-,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23-,24-,25-,26-,27-,28-,29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,40-,41-,42-,43-,44-,45-,46-,47-,48+,49+,50+,51+,52+,53+,54+,55+/M1/S1\n\nINCHI KEY\nFLASNYPZGWUPSU-SICDJOISSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8059, "currency": "MXN" } } }, { "id": "0", "description": "\"PARACETAMOL, BIOXTRA, =99.0%, CÓDIGO DE SIGMA ALDRICH: A7085-100G. LÍNEA DEL PRODUCTO\nBIOXTRA\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=99.0%\n\nFORMULARIO\nPOWDER\n\nIMPUREZAS\n=0.0005% PHOSPHORUS (P)\n=0.1% INSOLUBLE MATTER\n\nRESIDUO DE IGN.\n=0.1%\n\nMP\n168-172 °C (LIT.)\n\nSOLUBILIDAD\nETHANOL: 0.5 M, CLEAR, COLORLESS\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =0.05%\nSULFATE (SO42-): =0.05%\n\nTRAZAS DE CATIÓN\nAL: =0.0005%\nCA: =0.0005%\nCU: =0.0005%\nFE: =0.0005%\nK: =0.005%\nMG: =0.0005%\nNH4+: =0.05%\nNA: =0.005%\nPB: =0.001%\nZN: =0.0005%\n\nSMILES STRING\nCC(=O)NC1CCC(O)CC1\n\nINCHI\n1S/C8H9NO2/C1-6(10)9-7-2-4-8(11)5-3-7/H2-5,11H,1H3,(H,9,10)\n\nINCHI KEY\nRZVAJINKPMORJF-UHFFFAOYSA-N\n\nGENE INFORMATION\nHUMAN ... FAAH(2166) , PTGS1(5742) , PTGS2(5743) , TRPV1(7442)\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1352, "currency": "MXN" } } }, { "id": "0", "description": "\"MALTODEXTRINA, CÓDIGO DE SIGMA ALDRICH: 419672-100G. ORIGEN BIOLÓGICO\nCORN\n\nNIVEL DE CALIDAD\n200\n\nDESCRIPCIÓN\nDEXTROSE EQUIVALENT 4.0 - 7.0\n\nFORMULARIO\nPOWDER\n\nMP\n240 °C (DEC.) (LIT.)\n\nINCHI\n1S/C6H12O6/C7-1-3(9)5(11)6(12)4(10)2-8/H1,3-6,8-12H,2H2/T3-,4+,5+,6+/M0/S1\n\nINCHI KEY\nGZCGUPFRVQAUEE-SLPGGIOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1586, "currency": "MXN" } } }, { "id": "0", "description": "\"PEROXIDO DE HIDROGENO SÓLUCIÓN, 34.5-36.5%, CÓDIGO : 18304-1L. PRESIÓN DE VAPOR\n23.3 MMHG ( 30 °C)\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n34.5-36.5%\n\nCADUCIDAD\nSHELF LIFE IS LIMITED.\n\nCONTIENE\nSTABILIZER\n\nREACTION SUITABILITY\nREAGENT TYPE: OXIDANT\n\nIMPUREZAS\n=0.0002% HEAVY METALS (AS PB)\n=0.02% FREE ACID (AS H2SO4)\n=0.05% NON-VOLATILE MATTER\n\nRESIDUO DE IGN.\n=0.03%\n\nSOLUBILIDAD\nDIETHYL ETHER: SOLUBLE\nPETROLEUM ETHER: INSOLUBLE\nWATER: SOLUBLE\n\nDENSIDAD\n1.130 G/CM3\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nOO\n\nINCHI\n1S/H2O2/C1-2/H1-2H\n\nINCHI KEY\nMHAJPDPJQMAIIY-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2671, "currency": "MXN" } } }, { "id": "0", "description": "FLUORESCEIN O-METHACRYLATE, \tALDRICH,\t568864-1G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 6234, "currency": "MXN" } } }, { "id": "0", "description": "CHLOROFORM-D,\tALDRICH,\t416754-250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3747, "currency": "MXN" } } }, { "id": "0", "description": "4-CYANO-4-[(DODECYLSULFANYLTHIOCARBONYL)SULFANYL]PENTANOIC ACID,\tALDRICH,\t723274-1G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4089, "currency": "MXN" } } }, { "id": "0", "description": "MYRCENE,\tALDRICH,\tM100005-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1816, "currency": "MXN" } } }, { "id": "0", "description": "4-CYANO-4-(PHENYLCARBONOTHIOYLTHIO)PENTANOIC ACID,\tALDRICH,\t722995-1G\t3964", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3964, "currency": "MXN" } } }, { "id": "0", "description": "4-ACRYLOYLMORPHOLINE\t, ALDRICH 448273-250ML\t6955", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6955, "currency": "MXN" } } }, { "id": "0", "description": "LICL,\tALDRICH,\t310468-100G\t1698", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1698, "currency": "MXN" } } }, { "id": "0", "description": "MURASHIGE AND SKOOG BASAL SALT MACRONUTRIENT SOLUTION\t, ALDRICH, \tM0654-1L\t1,032.00", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1032, "currency": "MXN" } } }, { "id": "0", "description": "MURASHIGE AND SKOOG BASAL SALT MICRONUTRIENT SOLUTION,\tALDRICH,\tM0529-1L\t 1,022.00", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1022, "currency": "MXN" } } }, { "id": "0", "description": "MEDIO BASAL MURASHIGE Y SKOOG,\tALDRICH,\tM9274-1L\t353", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 353, "currency": "MXN" } } }, { "id": "0", "description": "MAGNESIUM SULFATE, ANHYDROUS, REAGENTPLUS®, =99.5%, ALDRICH, M7506-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2909, "currency": "MXN" } } }, { "id": "0", "description": "SODIUM HYDRIDE, 60 % DISPERSION IN MINERAL OIL, ALDRICH, 452912-100G,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1451, "currency": "MXN" } } }, { "id": "0", "description": "2-AMINOBENZOTHIAZOLE, 97%, ALDRICH, 108812-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1520, "currency": "MXN" } } }, { "id": "0", "description": "POLY(ETHYLENE OXIDE), AVERAGE MV ~4,000,000 (NOMINAL), CONTAINS (1000 PPM BHT AS INHIBITOR, ALDRICH, 189464-250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3238, "currency": "MXN" } } }, { "id": "0", "description": "P-TOLUENESULFONYL CHLORIDE, REAGENTPLUS®, =99%, ALDRICH, 240877-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5190, "currency": "MXN" } } }, { "id": "0", "description": "N-(3-DIMETHYLAMINOPROPYL)-N´-ETHYLCARBODIIMIDE HYDROCHLORIDE, \tCOMMERCIAL GRADE, POWDER, ALDRICH, E7750-10G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3528, "currency": "MXN" } } }, { "id": "0", "description": "4-(DIMETHYLAMINO)PYRIDINE, REAGENTPLUS®, =99%, ALDRICH, 107700-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1604, "currency": "MXN" } } }, { "id": "0", "description": "DCC, 99%, ALDRICH, D80002-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 729, "currency": "MXN" } } }, { "id": "0", "description": "CYSTEAMINE, =98.0% (RT), ALDRICH, 30070-10G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3886, "currency": "MXN" } } }, { "id": "0", "description": "(±)-A-LIPOIC ACID T5625-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 16852, "currency": "MXN" } } }, { "id": "0", "description": "PENTAFLUOROBENZENESULFONYL CHLORIDE\n103764-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2149, "currency": "MXN" } } }, { "id": "0", "description": "4-FLUOROBENZENESULFONYL CHLORIDE F6206-25", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1700, "currency": "MXN" } } }, { "id": "0", "description": "2-ISOPROPENYL-2-OXAZOLINE\t560626-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5183, "currency": "MXN" } } }, { "id": "0", "description": "YEAST EXTRACT. CAT. 70161-100G. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1048, "currency": "MXN" } } }, { "id": "0", "description": "BASIC FUCHSIN. CAT B0904-5G. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1849, "currency": "MXN" } } }, { "id": "0", "description": "2-KETOBUTYRIC ACID. CAT K401-5G. SIGMA-ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1391, "currency": "MXN" } } }, { "id": "0", "description": "ACETAMINOPHEN (CH3CONHC6H4OH)\nPHR1005-1G\nPHARMACEUTICAL SECONDARY STANDARD; CERTIFIED REFERENCE MATERIAL\n1 GRAMO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2580, "currency": "MXN" } } }, { "id": "0", "description": "ZINC (II) OXIDE - ZNO\n96479-100G\nACS REAGENT, =99.0%\n100 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1042, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO 372978-1L \nPROPIEDADES\nGRADO\nANHYDROUS PAQUETE\n\nNIVEL DE CALIDAD\n200\n\nDENSIDAD DE VAPOR\n4.1 (VS AIR)\n\nPRESIÓN DE VAPOR\n160 MMHG ( 20 °C)\n\nANÁLISIS\n=99%\n\nFORMULARIO\nLIQUID\n\nCONTIENE\nAMYLENES AS STABILIZER\n\nENVASE\nSURE/SEALT OF 1, 6X1, 2 L\nPURE-PAC® 2 OF 20 L (USA ONLY)\n\nIMPUREZAS\n(0.001% WATER\n0.005% WATER (100ML)\n\nRESIDUO DE EVAP.\n(0.0003%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2317, "currency": "MXN" } } }, { "id": "0", "description": "1-3 BUTADIENE\nNO. CAT. : 295035-1KG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 11542, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO-L- ASCÓRBICO GRADO REACTIVO 100G\tA7506, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1256, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE ORO (III) TRIHYDRATE =99.9% TRACE METALS BASIS 5 G\t520918, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 16878, "currency": "MXN" } } }, { "id": "0", "description": "GRAPHENE OXIDE, 25 G\t900704, SIGMA-ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4335, "currency": "MXN" } } }, { "id": "0", "description": "TRIETANOLAMINA, 100 ML\t90279, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 783, "currency": "MXN" } } }, { "id": "0", "description": "\"E-DECALACTONE, =99%, CÓDIGO DE SIGMA ALDRICH: W361305-100G. ORIGEN BIOLÓGICO\nSYNTHETIC\n\nNIVEL DE CALIDAD\n400\n\nAGENCY\nMEETS PURITY SPECIFICATIONS OF JECFA\n\nANÁLISIS\n=99%\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.461 (LIT.)\n\nBP\n117 °C/3 MMHG (LIT.)\n\nDENSIDAD\n0.976 G/ML AT 25 °C (LIT.)\n\nAPPLICATION(S)\nFLAVORS AND FRAGRANCES\n\nORGANOLÉPTICO\nCOCONUT; CREAMY; SWEET\n\nSMILES STRING\nCCCCC1CCCCC(=O)O1\n\nINCHI\n1S/C10H18O2/C1-2-3-6-9-7-4-5-8-10(11)12-9/H9H,2-8H2,1H3\n\nINCHI KEY\nYKVIWISPFDZYOW-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2284, "currency": "MXN" } } }, { "id": "0", "description": "SÌLICA GEL (SIO2), TECHNICAL GRADE, PORE SIZE 60 Å, 230-400 MESH PARTICLE SIZE, 40-63 µM PARTICLE SIZE, NO. CATÁLOGO: 717185-25KG, PRESENTACIÓN DE 25KG.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 15466, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 2.5 LITROS DE ETHYLBENZENE\nNO. CAT. : E12508-2.5L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2920, "currency": "MXN" } } }, { "id": "0", "description": "295809-1G \n1,4,10,13-TETRAOXA-7,16-DIAZACYCLOOCTADE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6998, "currency": "MXN" } } }, { "id": "0", "description": "B5136-25G BENZYLAMINE HCL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1156, "currency": "MXN" } } }, { "id": "0", "description": "185701-100G BENZYLAMINE, REAGENTPLUS, 99%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 909, "currency": "MXN" } } }, { "id": "0", "description": "GALLIC ACID MONOHYDRATE, ACS REAGENT, =98.0%, ALDRICH, 398225-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2611, "currency": "MXN" } } }, { "id": "0", "description": "AMMONIUM HYDROXIDE SOLUTION, ACS REAGENT, 28.0-30.0% NH3 BASIS, SKU: 221228-2.5L-A, CAS: 1336-21-6, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2277, "currency": "MXN" } } }, { "id": "0", "description": "AMMONIUM PHOSPHATE DIBASIC, ACS REAGENT, =98%, SKU:215996-500G, CAS: 7783-28-0, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2793, "currency": "MXN" } } }, { "id": "0", "description": "CALCIUM NITRATE TETRAHYDRATE, ACS REAGENT, 99%, SKU: 237124-500G, CAS:13477-34-4, SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1807, "currency": "MXN" } } }, { "id": "0", "description": "HEXADECYLTRIMETHYLAMMONIUM BROMIDE, =98%, SKU:H5882-500G, CAS: 57-09-0, SIGMA ALDRICH.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4547, "currency": "MXN" } } }, { "id": "0", "description": "L-CYSTEINE, BIOULTRA, =98.5% (RT), SKU:30089-25G, CAS: 52-90-4", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2129, "currency": "MXN" } } }, { "id": "0", "description": "L-GLUTATHIONE REDUCED, =98.0%, SKU: G4251-10G, CAS:70-18-8", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2219, "currency": "MXN" } } }, { "id": "0", "description": "NITRIC ACID, ACS REAGENT, 70%, SKU: 438073-2.5L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2793, "currency": "MXN" } } }, { "id": "0", "description": "HYDROXYAPATITE, NANOPOWDER, (200 NM PARTICLE SIZE (BET), =97%, SYNTHETIC, SKU:677418-25G, CAS:12167-74-7", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5591, "currency": "MXN" } } }, { "id": "0", "description": "GRAPHENE OXIDE, PASTE, NON-EXFOLIATED. SKU:900704-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 13866, "currency": "MXN" } } }, { "id": "0", "description": "2-(DIISOPROPYLAMINO)ETHYL METRACRYLATE 730971-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2632, "currency": "MXN" } } }, { "id": "0", "description": "N-ISOPROPYLACRYLAMIDE 415324-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3998, "currency": "MXN" } } }, { "id": "0", "description": "2-(TERT-BUTYLAMINO) ETHYL METHACRYLATE CAT. 444332-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3093, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO CITRICO CAT. 251275-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2253, "currency": "MXN" } } }, { "id": "0", "description": "BOROHIDRURO DE SODIO 452882-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1481, "currency": "MXN" } } }, { "id": "0", "description": "N-HYDROXYSUCCINIMIDE - 56480-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1540, "currency": "MXN" } } }, { "id": "0", "description": "N-(3-DIMETILAMINOPROPILO)-N´-ETILCARBODIIMIDA HYDROCHLORIDE - 03450-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2138, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL ETILICO (ETANOL) SOLN 96% RA ACS PORRON 20LT , CTR203062", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1465, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL METILICO (METANOL) RA PLASTICO PORRON 18LT, CTR01212", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL ISOPROPILICO (2-PROPANOL) RA PORRON 20LT CTR172532", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1632, "currency": "MXN" } } }, { "id": "0", "description": "COPPER (II) ACETATE, ACS REAGENT, =98%, SKU: 217557-100G, CAS:6046-93-1", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1451, "currency": "MXN" } } }, { "id": "0", "description": "3-4-ETHYLENEDIOXYTHIOPHENE CÓDIGO 483028-10G,\nPROPIEDADESANÁLISIS: 97%ÍNDICE DE REFRACCIÓNN20/D 1.5765\n(LIT.)BP193 °C (LIT.)DENSIDAD1.331 G/ML AT 25 °C (LIT.)TEMP. DE\nALMACENAMIENTO2-8°CSMILES\nSTRINGC1COC2CSCC2O1INCHI1S/C6H6O2S/C1-2-8-6-4-9-3-5(6)\n7-1/H3-4H,1-2H2INCHI KEYGKWLILHTTGWKLQUHFFFAOYSA-\nN", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2266, "currency": "MXN" } } }, { "id": "0", "description": "CURCUMIN, FROM CURCUMA LONGA (TURMERIC), POWDE, CÓDIGO\nC1386-50G. ORIGEN BIOLÓGICOCURCUMA LONGA (TURMERIC)NIVEL\nDE CALIDAD200DENSIDAD DE VAPOR13 (VS AIR)\nFORMULARIOPOWDERCONCENTRACIÓN=65% (HPLC)MP175\n°CSOLUBILIDADETHANOL: 10 MG/MLDMSO: )11 MG/ML (LIT.)(LIT.)\n0.5 M NAOH: SOLUBLE (THEN IMMEDIATELY DILUTE IN PBS [LIT.])(LIT.)\nTEMP. DE ALMACENAMIENTO-20°CSMILES STRINGCOC1CC\n(\\C=C\\C(=O)CC(=O)\\C=C\\C2CCC(O)C(OC)C2)\nCCC1OINCHI1S/C21H20O6/C1-26-20-11-14(5-9-18(20)24)3-7-\n16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/H3-12,24-\n25H,13H2,1-2H3/B7-3+,8-4+INCHI KEYVFLDPWHFBUODDFFCXRPNKRSA-\nNGENE INFORMATIONHUMAN ... APP(351) ,\nCYP1A2(1544)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7764, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIMETHYLFORMAMIDE, ANHYDROUS, 99.8%, ALDRICH, 227056-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2917, "currency": "MXN" } } }, { "id": "0", "description": "TRIETHYLAMINE, =99%, ALDRICH, T0886-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3175, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIMETILFORMAMIDA - 227056-2L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4647, "currency": "MXN" } } }, { "id": "0", "description": "351. AGAR DEXTROSA Y PAPA 450GR BIOXON REGISTRO SANITARIO 0120R83 SSA", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1356, "currency": "MXN" } } }, { "id": "0", "description": "7581. CALDO LACTOSADO 450GR - BIOXON", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1262, "currency": "MXN" } } }, { "id": "0", "description": "7586. AGAR SALMONELLA Y SHIGELLA 450GR - BIOXON", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1582, "currency": "MXN" } } }, { "id": "0", "description": "12696. AGAR LEVINE CON EOSINA Y AZUL DE METILENO 500GR - BBL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3184, "currency": "MXN" } } }, { "id": "0", "description": "TOLUENO - 1 LATA DE 18 LT - CODIGO 104502", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1886, "currency": "MXN" } } }, { "id": "0", "description": "A90004-50G\n\t50 G\tANTHRAQUINONE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 876, "currency": "MXN" } } }, { "id": "0", "description": "426288-25G\n\t25 G\t\nTETRABUTYLAMMONIUM BROMIDE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1553, "currency": "MXN" } } }, { "id": "0", "description": "D41007-500G\n\t500 G\t\n1,6-DIBROMOHEXANE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2923, "currency": "MXN" } } }, { "id": "0", "description": "56749-50G\n\t50 G\tIMIDAZOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 11180, "currency": "MXN" } } }, { "id": "0", "description": "238597-500G\n\t500 G\tSULFATO DE SODIO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1698, "currency": "MXN" } } }, { "id": "0", "description": "A56353-25G\n\t25 G\t\n6-AMINO-1-HEXANOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5119, "currency": "MXN" } } }, { "id": "0", "description": "227056-1L\n\t1.0 L\t\nN,N-DIMETILFORMAMIDA", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2917, "currency": "MXN" } } }, { "id": "0", "description": "06734-50MG\n\t50 MG\t\nTAMOXIFENO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2417, "currency": "MXN" } } }, { "id": "0", "description": "239267-100G\t\n100 G\t\nCOBALT(II) NITRATE HEXAHYDRATE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1938, "currency": "MXN" } } }, { "id": "0", "description": "D27802-100G\t100 G\t\n1,4-DIAZABICYCLO[2.2.2]OCTANE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1865, "currency": "MXN" } } }, { "id": "0", "description": "185361-100G\n\t100 G\t\nTEREPHTHALIC ACID", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 947, "currency": "MXN" } } }, { "id": "0", "description": "PLURONIC L121\nNO. CAT. : 435457-250ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1718, "currency": "MXN" } } }, { "id": "0", "description": "SPAN80, SORBITANE MONOOLEATE\nNO. CAT. S6760-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3893, "currency": "MXN" } } }, { "id": "0", "description": "2-ETHYLHEXYL METHACRYLATE\nNO. CAT. 290807-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2491, "currency": "MXN" } } }, { "id": "0", "description": "GLYCIDYL METHACRYLATE\nNO. CAT. 779342-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2284, "currency": "MXN" } } }, { "id": "0", "description": "1-DODECANETHIOL\nNO. CAT. 471364-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1554, "currency": "MXN" } } }, { "id": "0", "description": "GLYCIDYL METHACRYLATE\nNO. CAT. 151238-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3675, "currency": "MXN" } } }, { "id": "0", "description": "INHIBITOR REMOVERS\nNO. CAT. 311332-250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8078, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO DEUTERADO\nNO. CAT. 151823-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 1351, "currency": "MXN" } } }, { "id": "0", "description": "100 GRAMOS DE 3-CHLOROPEROXYBENZOIC ACID\nNO. CAT. 273031-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2787, "currency": "MXN" } } }, { "id": "0", "description": "50 GRAMOS DE 4,4´-DITHIODIBUTYRIC ACID\nNO. CAT. C15605-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3943, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 5 ML DE 7-METHYL-1,5,7-TRIAZABICYCLO[4.4.0]DEC-5-ENE\nNO. CAT. 359505-5ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 7581, "currency": "MXN" } } }, { "id": "0", "description": "1,2-DIMETHYLIMIDAZOLE\nNO. CAT. 136131-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 976, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO CON 200 GRAMOS DE TITANIUM TETRACHLORIDE\nNO. CAT. 208566-200G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1829, "currency": "MXN" } } }, { "id": "0", "description": "2-ISOPROPENIL-2-OXAZOLINA CAT 560626-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5183, "currency": "MXN" } } }, { "id": "0", "description": "PORRON DE METANOL DE 20L. JT BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "PORRON DE METANOL DE 20L. JT BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "MESITYLENE 98%\nNO. CATÁLOGO M7200-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2611, "currency": "MXN" } } }, { "id": "0", "description": "QUITOSANO\nSINÓNIMOS: POLI(D-GLUCOSAMINA), QUITINA DESACETILADA\nCAS NO.:\nNO. CATÁLOGO 448869-250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6596, "currency": "MXN" } } }, { "id": "0", "description": "ETHYLENEDIAMINE\nSINÓNIMOS: 1,2-DIAMINOETHANE\nNO. CATÁLOGO E26266-2.5L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3266, "currency": "MXN" } } }, { "id": "0", "description": "SUERO FETAL BOVINO, ORIGEN UNIÓN EUROPEA, ESTÉRIL, LIBRE DE MICOPLASMA", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 12963.62, "currency": "MXN" } } }, { "id": "0", "description": "DATP (100MM), GRADO BIOLOGIA MOLECULAR. MARCA INVITROGEN. SOLUCION DE 100MM EN 250UL. CATALGO: 10216018", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2381.7, "currency": "MXN" } } }, { "id": "0", "description": "DCTP (100MM), GRADO BIOLOGIA MOLECULAR. SOLUCION DE 100MM EN 250 UL. MARCA: INVITROGEN. CATALOGO: 10217016", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2381.7, "currency": "MXN" } } }, { "id": "0", "description": "DGTP(100MM), GRADO BIOLOGÍA MOLECULAR. MARCA: INVITROGEN. CATALOGO:10218014. SOLUCION 100MM EN 250 UL", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2363.09, "currency": "MXN" } } }, { "id": "0", "description": "DTTP (100MM) GRADO BIOLOGIA MOLECULAR. MARCA INVITROGEN. CATALOGO: 10219012. SOLUCION 100MM EN 250 UL", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2381.7, "currency": "MXN" } } }, { "id": "0", "description": "KIT DE EXTRACCIÓN DE PROTEÍNAS BACTERIANAS. (250 ML) CAT. 90078. THERMO SCIENTIFIC.", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8167.77, "currency": "MXN" } } }, { "id": "0", "description": "MEM-PERT PLUS MEMBRANE PROTEIN EXTRACTION KIT (300 ML). CAT. 89842. THERMO SCIENTIFIC.PAQUETE", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8130.56, "currency": "MXN" } } }, { "id": "0", "description": "GENEJET PLASMID MINIPREP KIT. CAT. K0502. THERMO SCIENTIFIC.", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1646.81, "currency": "MXN" } } }, { "id": "0", "description": "SYBR SAFE DNA GEL STAIN 400UG. CAT. 33102. INVITROGEN", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1819.53, "currency": "MXN" } } }, { "id": "0", "description": "MEZCLA MASTER DE PCR DREAM TAQ VERDE (2X) 200 REACCIONES - THERMO SCIENTIFIC CAT. K1081", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2586.35, "currency": "MXN" } } }, { "id": "0", "description": "GENEJET PLASMID MINIPREP KIT. CAT. K0502. THERMO SCIENTIFIC.PAQUETE", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1646.81, "currency": "MXN" } } }, { "id": "0", "description": "KIT CITOTOXICIDAD HS PRESTO BLUE\tP50200, THERMO FISHER SCIENTIFIC", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6148.74, "currency": "MXN" } } }, { "id": "0", "description": "CLICK-ITT PLUS TUNEL ASSAY KITS FOR IN SITU APOPTOSIS DETECTION, 1 KIT,\tTHERMOFISHER SCIENTIFIC,\tC10619, 17,750.00", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 14846.87, "currency": "MXN" } } }, { "id": "0", "description": "TAQ POLIMERASA GRADO BIOLOGIA MOLECULAR. MARCA INVITROGEN. 500 UNIDADES. CATALOGO: 10342020", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5379.83, "currency": "MXN" } } }, { "id": "0", "description": "REACTIVO DE VIABILIDAD CELULAR HS PRESTOBLUET, SKU:P50200", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6148.74, "currency": "MXN" } } }, { "id": "0", "description": "GASAS 10X10 (1 CAJA)", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 105.81, "currency": "MXN" } } }, { "id": "0", "description": "GASAS 7.5 X 5 CM (1 CAJA)", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 87.76, "currency": "MXN" } } }, { "id": "0", "description": "MICRODACYN SPRAY", "classification": { "scheme": "CUCOP", "id": "25301-3455" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 192.38, "currency": "MXN" } } }, { "id": "0", "description": "VENDAS 5 CMS", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 5.83, "currency": "MXN" } } }, { "id": "0", "description": "VENDAS 10 CMS", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 11.29, "currency": "MXN" } } }, { "id": "0", "description": "VENDAS DE 7,5 CMS", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 8.14, "currency": "MXN" } } }, { "id": "0", "description": "VENDA DE 30X 5 CMS", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 25.6, "currency": "MXN" } } }, { "id": "0", "description": "ALGODÓN EN CONTENIDO DE 300G", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 69.81, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO TALLA CHICO (CAJA)", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 214.28, "currency": "MXN" } } }, { "id": "0", "description": "CUBREBOCAS NK 95 (CAJA)", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 481.25, "currency": "MXN" } } }, { "id": "0", "description": "ABATELENGUAS (CAJA)", "classification": { "scheme": "CUCOP", "id": "25301-4408" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 38.48, "currency": "MXN" } } }, { "id": "0", "description": "KIMTECH SCIENCE KIMWIPES - LIMPIAPARABRISAS DELICADO, 4.4 X 8.4 PULGADAS 1 CAPA, 280 HOJAS/CAJA, 4 PAQUETES, KW01X4", "classification": { "scheme": "CUCOP", "id": "25501-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 648, "currency": "MXN" } } }, { "id": "0", "description": "CÓDIGO 113576 HS20632B BULBO SUCCIONADOR 3 VIAS HULE ROJO HEATHROW", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "CÓDIGO 150291 CATALOGO 03-448-23 BULBO SUCCIONADOR 1 VIA ROJO PIEZA(S) CON 1 PIEZA(S) FISHERBRAND", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS PETRI DE POLIPROPILENO DESECHABLES DE POLIESTIRENO DE 90X15MM, ESTERILES, PAQUETE DE 10 PIEZAS,", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 30, "unit": { "name": "PIEZA", "value": { "amount": 36.96, "currency": "MXN" } } }, { "id": "0", "description": "CELDAS DESECHABLE 1 CAJA CON 100 PZAS. SEMI MICRO DE 1.5 ML DLAB", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 583.6, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE GUANTES MICROFLEX DE LATEX LIBRES DE TALCO, TALLA GRANDE", "classification": { "scheme": "CUCOP", "id": "25501-0091" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 181.3, "currency": "MXN" } } }, { "id": "0", "description": "303143-25G\n3,6-DIMETHYL-1,4-DIOXANE-2,5-DIONE, 99% 25 GRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2426.25, "currency": "MXN" } } }, { "id": "0", "description": "A54059-100G\n2-(2-AMINOETHOXY)ETHANOL, 98%", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1518.75, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILLO SIN POLVO TALLA CHICA CAJA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 214.28, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILLO SIN POLVO TALLA MEDIANO CAJA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 214.28, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILLO SIN POLVO TALLA GRANDE CAJA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 214.28, "currency": "MXN" } } }, { "id": "0", "description": "HEXANO HPLC- NUMERO DE REFERENCIA 270504-2L (1 PIEZA DE 4 LITROS)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2374.54, "currency": "MXN" } } }, { "id": "0", "description": "\"METHYL CINNAMATE, =99.0% (GC), CÓDIGO DE SSIGMA ALDRICH: 96410-100G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n=99.0% (GC)\n\nFORMULARIO\nCRYSTALS\n\nBP\n260-262 °C (LIT.)\n\nMP\n33-38 °C (LIT.)\n\nSMILES STRING\nCOC(=O)\\C=C\\C1CCCCC1\n\nINCHI\n1S/C10H10O2/C1-12-10(11)8-7-9-5-3-2-4-6-9/H2-8H,1H3/B8-7+\n\nINCHI KEY\nCCRCUPLGCSFEDV-BQYQJAHWSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 891.25, "currency": "MXN" } } }, { "id": "0", "description": "XILENO R.A 4 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 780, "currency": "MXN" } } }, { "id": "0", "description": "METANOL ANHIDRO PARA TITULACION KARL FISHER, MAX. 0.005% DE AGUA 4 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 989.85, "currency": "MXN" } } }, { "id": "0", "description": "DECAHIDRONAFTALENO ANHIDRO R.A, FRASCO 2 LITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7085, "currency": "MXN" } } }, { "id": "0", "description": "\"POTASSIUM DISULFITE, =98%, CÓDIGO DE SIGMA ALDRICH: P2522-500G. NIVEL DE CALIDAD\n200\n\nANÁLISIS\n=98%\n\nFORMULARIO\nPOWDER\n\nSMILES STRING\n[K+].[K+].[O-]S(=O)S([O-])(=O)=O\n\nINCHI\n1S/2K.H2O5S2/C;;1-6(2)7(3,4)5/H;;(H,1,2)(H,3,4,5)/Q2*+1;/P-2\n\nINCHI KEY\nRWPGFSMJFRPDDP-UHFFFAOYSA-L\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2955, "currency": "MXN" } } }, { "id": "0", "description": "CAPSULAS DE EVAPORACIÓN DE PORCELANA DE 125ML. (1 PAQUETE DE 10 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1122.63, "currency": "MXN" } } }, { "id": "0", "description": "HEXANO 20L JT BAKER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5411.88, "currency": "MXN" } } }, { "id": "0", "description": "AZIDA DE SODIO (NAN3), 500 G, KARAL, CAT. 6048.0500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 8039.06, "currency": "MXN" } } }, { "id": "0", "description": "JARRA GRADUADA PARA ACIDO DE 5 LITROS", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 379.87, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE PAÑUELOS DESECHABLES KIMWIPES 1 CAPA 11.17 X 20.83CM P/TRABAJOS DELICADOS C/286, 34120 KIMBERLY-CLARK", "classification": { "scheme": "CUCOP", "id": "25501-0079" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 162, "currency": "MXN" } } }, { "id": "0", "description": "VASO PRECIPITADO DE VIDRIO ASTM 50ML EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 40.5, "currency": "MXN" } } }, { "id": "0", "description": "VASO PRECIPITADO DE VIDRIO ASTM 100ML EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 51.3, "currency": "MXN" } } }, { "id": "0", "description": "PLATILLOS DE ALUMINIO PARA PESAJE 57MM DIAM\nHEATHROW SCIENTIFIC", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 234.33, "currency": "MXN" } } }, { "id": "0", "description": "27398. CRISOL DE PORCELANA 30ML, DIAMETRO 50MM, ALTURA 31MM, FORMA ANCHA - COORS", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 56.14, "currency": "MXN" } } }, { "id": "0", "description": "5794. VASO DE PRECIPITADO DE VIDRIO 100ML, FORMA BAJA GRIFFIN, PAQUETE C/5 PIEZAS - PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 342.67, "currency": "MXN" } } }, { "id": "0", "description": "8487. PIPETEADOR (SUCCIONADOR) ROJO 25ML, PAQUETE C/2 PIEZAS - DLAB", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 432, "currency": "MXN" } } }, { "id": "0", "description": "27879. KIT DE BARRAS MAGNETICAS OCTAGONALES, COLOR BLANCO, MEDIDAS SURTIDAS C/16 - FISHERBRAND", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3282.98, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO FENICO CRISTAL (FENOL) ACS MCA \nMEYER, 500 GR, CAT. 0115-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 808.29, "currency": "MXN" } } }, { "id": "0", "description": "PISETA INTEGRAL DE PLÁSTICO POLIETILENO CON BOCA ANGOSTA, 500 ML, ESLAB PI-112. SKU: VAR-PI-1122", "classification": { "scheme": "CUCOP", "id": "25501-0068" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 141.18, "currency": "MXN" } } }, { "id": "0", "description": "MICROTUBOS PARA CENTRÍFUGA CAPP EXPELL DESECHABLES, 2 ML. SKU: CAP-5102000C", "classification": { "scheme": "CUCOP", "id": "25501-0026" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 315.4, "currency": "MXN" } } }, { "id": "0", "description": "PAPEL PARAFILM BEMIS PM99 M IMPERMEABLE IDEAL PARA PROTECCIÓN DE MUESTRAS, 5 CM X 76 M. SKU: PAR-PM992", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 785, "currency": "MXN" } } }, { "id": "0", "description": "ESPÁTULA DE ACERO INOXIDABLE CON CUCHARA Y PUNTA PLANA, 125 MM, GLASSCO 374.303. SKU: GL-374.303.01", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 47.35, "currency": "MXN" } } }, { "id": "0", "description": "ESPÁTULA DE ACERO INOXIDABLE CON CUCHARA Y PUNTA PLANA, 150 MM, GLASSCO 374.303. SKU: GL-374.303.02", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 59.97, "currency": "MXN" } } }, { "id": "0", "description": "ESPÁTULA DE ACERO INOXIDABLE MICRO CON CUCHARA Y PUNTA PLANA GLASSCO 377.303.01 LARGO 15 CM. SKU: GL-377.303.01", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 96.8, "currency": "MXN" } } }, { "id": "0", "description": "1 FRASCO DE ALCOHOL BENCILICO (100 ML)\nREAGENTPLUS®, =99%\nNO. CATÁLOGO: 108006-100ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2163.75, "currency": "MXN" } } }, { "id": "0", "description": "1 FRASCO DE CLOROFORMO DEUTERADO DE 100 G. NÚMERO DE PRODUCTO: 151823-100G. SIGMA ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1688.75, "currency": "MXN" } } }, { "id": "0", "description": "IRON(II) ACETATE, 95%, 10G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3218.75, "currency": "MXN" } } }, { "id": "0", "description": "CRUCIBLE COORS\nZ247170-1PAK\nCOORST PORCELAIN CRUCIBLE \nWIDE FORM, CAPACITY 30 ML", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 56.14, "currency": "MXN" } } }, { "id": "0", "description": "GLYCINE, 2 KG\n1610724 - CRISSOF\n2 KILOGRAMOS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4888.89, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS PETRI ESTERILES DESECHABLES DE POLIPROPILENO DE 90X15MM CAJA CON 54 BOLSAS CON BOLSAS DE 10 PIEZAS. MARCA INTERLUX. CATALOGO:CP9015-C", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1995.98, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE DE PASTEUR PIPETTE RUBBER BULBS, CAPACITY 2 ML, CÓDIGO : Z111597-12EA. MATERIALES: RUBBER BULB. MANUFACTURER/TRADENAME: 200-2A", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 220, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE DE PRECISION SEAL® RUBBER SEPTA, WHITE, 10/30 JOINTS, COLOR WHITE, CÓDIGO : Z553956-10EA.", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 848.75, "currency": "MXN" } } }, { "id": "0", "description": "\"PTFE SYRINGE NEEDLE, GAUGE 12, L 12 IN., CÓDIGO : Z117366-1EA, LONGITUD\n 12 IN.\n \n MANÓMETRO\n 12\"", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 838.75, "currency": "MXN" } } }, { "id": "0", "description": "\"PTFE SYRINGE NEEDLE, GAUGE 16, L 12 IN, CÓDIGO DE SIGMA ALDRICH: Z117331-1EA, LONGITUD\n 12 IN.\n \n MANÓMETRO\n 16\"", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 556.25, "currency": "MXN" } } }, { "id": "0", "description": "TUBING CONNECTORS, L 90 MM, STRAIGHT, CÓDIGO Z178470-12EA, CARACTERÍSTICAS FOR TUBING I.D. 5/16 - 9/16 IN, MANUFACTURER/TRADENAME BEL-ART, LONGITUD 90 MM", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1608.75, "currency": "MXN" } } }, { "id": "0", "description": "SYRINGE PP/PE WITHOUT NEEDLE,LUER SLIP TIP, CENTERED, CAPACITY 5 ML, GRADUATED, 0.2 ML, STERILE, CÓDIGO:Z116866-100EA", "classification": { "scheme": "CUCOP", "id": "25501-0088" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1178.75, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® MAGNETIC STIRRING BAR, PTFE, CYLINDRICAL, L 80 MM, BAR DIAM. 9 MM, CÓDIGO : Z328944-10EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4470, "currency": "MXN" } } }, { "id": "0", "description": "BRAND® MAGNETIC STIRRING BAR, PTFE, CYLINDRICAL, L 25 MM, BAR DIAM. 6 MM, CÓDIGO : Z328774-10EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1623.75, "currency": "MXN" } } }, { "id": "0", "description": "\"MICRO SPOON AND SPATULA WEIGHING SET, STAINLESS STEEL, AUTOCLAVABLE, CÓDIGO DE SIGMA ALDRICH: Z648299-1EA. EACH DOUBLE-HEADED IMPLEMENT HAS TWO DIFFERENT TOOL HEADS, EFFECTIVELY OFFERING TWICE THE NUMBER OF TOOLS IN ONE VERSATILE KIT. TOOL HEADS COME WITH 2 SMALL MICRO-SPOONS THAT ARE USED TO COLLECT AND TRANSPORT DRY SUBSTANCES OR LIQUIDS. ALSO COMES WITH 8 FLAT SPATULAS OF DIFFERENT SIZES THAT ARE PERFECT FOR WORKING WITH POWDERS, STIRRING AND MIXING.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3301.25, "currency": "MXN" } } }, { "id": "0", "description": "MOLYKOTE HIGH-VACUUM SILICONE GREASE, COLORLESS, WEIGHT 5.3 OZ (TUBE), CÓDIGO : Z273554-1EA.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1388.75, "currency": "MXN" } } }, { "id": "0", "description": "\"CLOROFORMO-D, 99.8 ATOM % D, CÓDIGO : 151823-250G. PUREZA ISOTÓPICA\n99.8 ATOM % D\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=99% (CP)\n\nFORMULARIO\nLIQUID\n\nTECHNIQUE(S)\nNMR: SUITABLE\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.444 (LIT.)\n\nBP\n60.9 °C (LIT.)\n\nMP\n-64 °C (LIT.)\n\nDENSIDAD\n1.500 G/ML AT 25 °C (LIT.)\n\nCAMBIO DE MASA\nM+1\n\nSMILES STRING\n[2H]C(CL)(CL)CL\n\nINCHI\n1S/CHCL3/C2-1(3)4/H1H/I1D\n\nINCHI KEY\nHEDRZPFGACZZDS-MICDWDOJSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3818.75, "currency": "MXN" } } }, { "id": "0", "description": "\"2 PAQUETSE DE 100 CHAROLAS PARA MUESTRO DE ALUMINIO DE 60 ML, DIÁMETRO 2 1/4, ALTO 5/8\"\", CÓDIGO S-24429", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 210, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE PLASTICO GRADUADO DE 250 ML. QUE RESISTA CICLO DE ESTERILIZACION EN AUTOCLAVE", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 51.66, "currency": "MXN" } } }, { "id": "0", "description": "SOLUCIÓN ESTÁNDAR DE CONDUCTIVIDAD DE 1,413 µS/CM. FRASCO DE 500ML. HANNA,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 273.75, "currency": "MXN" } } }, { "id": "0", "description": "\"MOLYKOTE HIGH-VACUUM SILICONE GREASE, COLORLESS, WEIGHT 5.3 OZ (TUBE), CÓDIGO : Z273554-1EA. MATERIALES\nCOLORLESS\n\nPESO\n5.3 OZ (TUBE)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1388.75, "currency": "MXN" } } }, { "id": "0", "description": "\"MANGANESE(II) SULFATE MONOHYDRATE. REAGENTPLUS®, =99%, CÓDIGO DE SIGMA ALDRICH M7634-500G. NIVEL DE CALIDAD\n200\n\nLÍNEA DEL PRODUCTO\nREAGENTPLUS®\n\nANÁLISIS\n=99%\n\nFORMULARIO\nPOWDER\n\nPH\n3-3.5 (20 °C, 50 G/L)\n\nTEMP. DE ALMACENAMIENTO\nROOM TEMP\n\nSMILES STRING\nO.[MN++].[O-]S([O-])(=O)=O\n\nINCHI\n1S/MN.H2O4S.H2O/C;1-5(2,3)4;/H;(H2,1,2,3,4);1H2/Q+2;;/P-2\n\nINCHI KEY\nISPYRSDWRDQNSW-UHFFFAOYSA-L\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1228.75, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE DE TUBOS PARA RMN WILMAD® 5 MM DE DIÁMETRO ECONOMIA, FREQUENCY 600 MHZ, L 7 IN., CÓDIGO DE SIGMA ALDRICH: Z565229-100EA. MATERIALES\nBOROSILICATE GLASS (ASTM TYPE 1 CLASS B)\nBOROSILICATE GLASS TUBE\nCOLORLESS TUBE\n\nCARACTERÍSTICAS\nNECK THREAD PUSH FIT\n\nMANUFACTURER/TRADENAME\nWILMAD WG-1000-7\n\nPARÁMETROS\n600 MHZ FREQUENCY\n\nLONGITUD\n7 IN.\n\nINCLINACIÓN\n102 µM\n\nCONCENTRICIDAD\n102 µM\n\nTUBO DIÁM.\n5 MM\n\nPARED GROSOR\n0.43 MM", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 4373.75, "currency": "MXN" } } }, { "id": "0", "description": "TEMED, 50 ML, NÚMERO DE CATALOGO 1610801", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2465, "currency": "MXN" } } }, { "id": "0", "description": "COOM BRILL BLUE G-250,10G, NÚMERO DE CATALOGO 1610406", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2437.5, "currency": "MXN" } } }, { "id": "0", "description": "\"2-PROPANOL SUITABLE FOR HPLC, 99.9%, 34863-4L. DENSIDAD DE VAPOR\n2.1 (VS AIR)\n\nNIVEL DE CALIDAD\n100\n\nPRESIÓN DE VAPOR\n33 MMHG ( 20 °C)\n44 MMHG ( 25 °C)\n\nANÁLISIS\n99.9%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n750 °F\n\nLIM. EXPL.\n2.0-12.7 %, 93 °C\n\nTECHNIQUE(S)\nHPLC: SUITABLE\n\nIMPUREZAS\n=0.0005% NON-VOLATILE MATTER\n=0.001% FREE ACID (AS C2H5COOH)\n=0.05% WATER (KARL FISCHER)\n\nCOLOR\nAPHA: =10\n\nTRANSMITANCIA\n210 NM, =20%\n220 NM, =50%\n230 NM, =75%\n260 NM, =98%\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.377 (LIT.)\n\nPH\n7.0 (20 °C)\n\nBP\n82 °C (LIT.)\n\nMP\n-89.5 °C (LIT.)\n\nDENSIDAD\n0.785 G/ML AT 25 °C (LIT.)\n\nABSORCIÓN UV\n?: 205 NM AMAX: =1.0\n?: 210 NM AMAX: =0.70\n?: 220 NM AMAX: =0.20\n?: 230 NM AMAX: =0.10\n?: 260 NM AMAX: =0.01\n?: 400 NM AMAX: =0.01\n\nAPPLICATION(S)\nFOOD AND BEVERAGES\n\nSMILES STRING\nCC(C)O\n\nINCHI\n1S/C3H8O/C1-3(2)4/H3-4H,1-2H3\n\nINCHI KEY\nKFZMGEQAYNKOFK-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5256.25, "currency": "MXN" } } }, { "id": "0", "description": "CUBREOBJETOS 24X50MM DE VIDRIO RECTANGULARES CAJA CON 100 PIEZAS. MARCA PYREX. CATALOGO: 2935N-24X50", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 15, "unit": { "name": "PIEZA", "value": { "amount": 68.71, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS DE LA MARCA QUANTOFIX, PARA LA DETERMINACIÓN DE PERÓXIDO DE CONCENTRACIÓN DE 0 A 1,000 MG/L H2O2. PERÓXIDO DE HIDRÓGENO. CAJA CON 60 TIRAS,", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1048.8, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS PERÓXIDO 100 0 A 100 MG/L H2O2,91312-100", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1012.7, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS DE LA MARCA QUANTOFIX, PARA LA DETERMINACIÓN DE PERÓXIDO DE CONCENTRACIÓN DE 0 A 25 MG/L H2O2. PERÓXIDO DE HIDRÓGENO. CAJA CON 100 TIRAS, 91319-25", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1012.7, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS DE LA MARCA QUANTOFIX, PARA ENSAYOS BIOLÓGICO EN AGUA, NITRATO 100 0 A 100MG/L NO3-/NO2-, 91319-25", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1012.7, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS DE LA MARCA QUANTOFIX PARA ENSAYOS BIOLÓGICOS EN AGUA, NITRATO/NITRITO DE CONCENTRACIÓN DE 0 A 500 MG/L NO3-NO2, 91313-500", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1124.8, "currency": "MXN" } } }, { "id": "0", "description": "TIRAS REACTIVAS DE LA MARCA QUANTOFIX PARA ENSAYOS BIOLÓGICOS EN AGUA, OBTENCIÓN DE NITRITOS PARA CONCENTRACIONES DE 0 A 80 MG/L NO2-,", "classification": { "scheme": "CUCOP", "id": "25501-0045" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1086.8, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS PETRI, ESTIRILIZADAS, DESECHABLES Y TRANSPARENTES. CON MEDIDAS DE 90X15 MM C/54 PIEZAS Y TRAE 10 BOLSAS CONTENIENDO LAS 54 PIEZAS DE CAJAS PETRI, NÚMERO DE CATÁLOGO DE SUMINORTE: PP 90X15-C", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1995.98, "currency": "MXN" } } }, { "id": "0", "description": "PIPETA DE TRANSFERENCIA DE PLÁSTICO, 3ML PK/500 MARCA VIAND MUY UTILIZADAS PARA BANCOS DE SANGRE, HEMATOLOGÍA, QUÍMICA, MICROBIOLOGÍA, ANÁLISIS CLÍNICOS. 3.0 ML CAPACIDAD.FABRICADA CON POLIETILENO 100% VIRGEN. MTPB03-500", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 429.88, "currency": "MXN" } } }, { "id": "0", "description": "CUBRE OBJETOS DE VIDRIO MARCA VIAND, Y DE MEDIDA: 24X50 MM , PAQUETE CON 100 PIEZAS. : 7201-2450", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 68.71, "currency": "MXN" } } }, { "id": "0", "description": "TUBO PARA CENTRIFUGA, DE LA MARCA VIAND, CON VOLUMEN DE 50ML PK/25 VIAND. DESCRIPCIÓN. TUBO PARA CENTRIFUGA 50ML PK/25 VIAND MODELO: VCT50 ESPECIFICACIONES: -1 PAQUETE DE 25 TUBOS PARA CENTRIFUGA CAPACIDAD: 50ML MATERIAL: PLÁSTICO. MCTR050-25", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 250, "currency": "MXN" } } }, { "id": "0", "description": "CAJA PETRI ANUMBRA, DE MEDIDAS DE 60X15MM, DE VIDRIO LINEA ECONOMICA, MODELO ANUMBRA.FABRICADAS DE VIDRIO BOROSILICATO. COMPLETAS, TAPA Y BASE.", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 51.87, "currency": "MXN" } } }, { "id": "0", "description": "JERINGA 5ML 22GX32MM C/100 PZAS. MCA. SENSIMEDICAL. JERINGA ESTERIL DESECHABLE DE 5 ML CON AGUJA CALIBRE 21G X 32 MM PABELLÓN VERDE CAJA CON 100 PIEZAS. C72A0018-1", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 219.64, "currency": "MXN" } } }, { "id": "0", "description": "JERINGA DE VIDRIO, CON EMBOLO METÁLICO, PARA CROMATOGRAFÍA SERIE 700, EXTRAIBLE CON UNA CAPACIDAD DE 10 UL (MICROLITROS). 23441B", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2090, "currency": "MXN" } } }, { "id": "0", "description": "SUCCIONADOR DE PIPETA 3 VIAS ROJO, MARCA EISCO. ESTOS MATERIALES SERÁN UTILIZADOS PARA LAS PRUEBAS BIOLÓGICAS DEL AGUA ACTIVADA. CH0580A", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 108, "currency": "MXN" } } }, { "id": "0", "description": "MANGO PARA BISTURÍ NÚM. 4. FABRICADO EN ACERO INOXIDABLE NÚMERO DE CATÁLOGO : 901-4", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 105, "currency": "MXN" } } }, { "id": "0", "description": "PLATILLOS DE ALUMINIO PARA LLEVAR A CABO PESAJE DE MUESTRAS, DE 43 MM DE DIÁMETRO MARCA HEATHROW SCIENTIFIC. PAQUETE", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 200, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS 1000UL AZULES NO ESTERIL BOLSA(S) CON 1000 PIEZA(S) CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 155.8, "currency": "MXN" } } }, { "id": "0", "description": "AZUL DE METILENO RA VIDRIO AMBAR 100GR CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 960, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS 1000UL AZULES NO ESTERIL BOLSA(S) CON 1000 PIEZA(S) CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0095" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 155.8, "currency": "MXN" } } }, { "id": "0", "description": "ÁCIDO ACÉTICO GLACIAL A6283-2.5L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 540, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHIDROFURANO DE 4 LTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2199.54, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS PARA RMN WILMAD® 5 MM DE DIÁMETRO, ECONOMÍA, Z565229-100EA,", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 4373.75, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO-D, 151823-250G,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 3818.75, "currency": "MXN" } } }, { "id": "0", "description": "TAMIZ DE 8\" DE DIAMETRO, ALTURA COMPLETA, MARCO Y\nMALLA EN ACERO INOXIDABLE. MALLA NO 325 (45 MICRAS)", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5960, "currency": "MXN" } } }, { "id": "0", "description": "151874-50G-SB. DIMETIL SULFÓXIDO-D6 ((CD3)2SO), 99.9 ATOM % D, 50 GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 5896.25, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHIDROFURANO A.C.S. MCA MEYER, 4 L. CAT. 2585-4000", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 2199.54, "currency": "MXN" } } }, { "id": "0", "description": "WHA1001090. WHATMAN® QUALITATIVE FILTER PAPER, GRADE 1, CIRCLES, DIAM. 90 MM, PACK OF 100", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 379.05, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ KITAZATO 250 ML. CORNING", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 372.76, "currency": "MXN" } } }, { "id": "0", "description": "MCTR050-25 TUBO PARA CENTRIFUGA 50ML PK/25 VIAND", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 250, "currency": "MXN" } } }, { "id": "0", "description": "CH0368D CAJA PETRI COMPLETA VIDRIO 100 X 15MM EISCO", "classification": { "scheme": "CUCOP", "id": "25501-0133" }, "quantity": 50, "unit": { "name": "PIEZA", "value": { "amount": 58.9, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS PARA MICROPIPETA 1000 UL\tCRM GLOBE\t\n500 PIEZAS (BOLSA)", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 155.8, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS PARA MICROPIPETA 200 UL\tCRM GLOBE\t\n1000 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 197.6, "currency": "MXN" } } }, { "id": "0", "description": "PUNTAS PARA MICROPIPETA 200 UL\tCRM GLOBE\t\n1000 BOLSA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 197.6, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS PARA MICROCENTRÍFUGA 2 ML TRANSPARENTES\nCRM GLOBE\t500 PZAS BOLSA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 315.5, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO\nTALLA M", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 214.28, "currency": "MXN" } } }, { "id": "0", "description": "PORTAOBJETOS MODELO VE-P10, ESPESOR 0,8-1,0 MM, CONTENER 50 PIEZAS POR CAJA TAMAÑO 26 X 76 MM.", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 32.88, "currency": "MXN" } } }, { "id": "0", "description": "CAJA PARA ARCHIVAR-TRANSPORTAR PORTAOBJETOS, MODELO CRM-0050, CAJA PARA ALMACENAR PORTAOBJETOS DE MEDIDA 75 X 25 MM, CAJAS FABRICADAS EN PP .", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 233.33, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS PETRI ESTERILES DESECHABLES DE POLIPROPILENO DE 90X15MM. CAJA CON 54 BOLSAS CON BOLSAS DE 10 PIEZAS.CATALOGO: CP9015-C", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1995.98, "currency": "MXN" } } }, { "id": "0", "description": "3.5 LTS\nALCOHOL ISOPROPILICO TECNICO MCA. ALVI", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 600, "currency": "MXN" } } }, { "id": "0", "description": "2587-4000 4 LTS TETRAHIDROFURANO HPLC MCA. MEYER", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6129.38, "currency": "MXN" } } }, { "id": "0", "description": "BRAND.702595 PUNTA PARA MICROPIPETA DE 0.5 A 5ML. BRAND", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 590, "currency": "MXN" } } }, { "id": "0", "description": "7608. AGAR BILIS VERDE BRILLANTE 450GR - BIOXON", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2039, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHIDROFURANO HPLC 4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6129.38, "currency": "MXN" } } }, { "id": "0", "description": "PORTAOBJETOS 50 PZS", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 32.88, "currency": "MXN" } } }, { "id": "0", "description": "PAPEL INDICADOR DE PH 1-14 UNIVERSAL 5MT MACHEREY-NAGEL", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 380, "currency": "MXN" } } }, { "id": "0", "description": "GL-139.464.05A. PROBETA CLASE A GLASSCO 139.464, 250 ML, CALIBRADA PARA ENTREGAR CON DOBLE ESCALA, BASE HEXAGONAL Y BUMPER", "classification": { "scheme": "CUCOP", "id": "25501-0037" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 579.77, "currency": "MXN" } } }, { "id": "0", "description": "KX-37025-10. PIPETA MOHR CLASE A SERIADA Y CERTIFICADA, 10 ML, KIMAX 37025 CON ESCALA ÁMBAR Y CÓDIGO DE COLOR", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 200.72, "currency": "MXN" } } }, { "id": "0", "description": "GL-124.125.05. PIPETA MOHR CLASE B, 25 ML, GLASSCO 124.125 CON ESCALA ÁMBAR Y CÓDIGO DE COLOR", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 433.09, "currency": "MXN" } } } ], "documents": [ { "id": "1", "title": "LA-03890U001-N-19-2024.doc", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:28:54.346Z" }, { "id": "2", "title": "PARTIDA 16-17-107-108.docx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:28:55.943Z" }, { "id": "3", "title": "CONTRATO DOF ADQUISICION BIENES.doc", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:28:57.383Z" }, { "id": "4", "title": "PARTIDA 111-112-113-114-115-116-117.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:28:58.675Z" }, { "id": "5", "title": "CHECK LIST.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:29:03.266Z" }, { "id": "6", "title": "PARTIDAS FINAL.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:29:05.077Z" }, { "id": "7", "title": "ACTA JUNTA DE ACLARACIONES.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:29:08.505Z" }, { "id": "8", "title": "ACTA DE APERTURA FINAL.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:29:43.089Z" }, { "id": "9", "title": "PARTIDAS FINAL.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:29:45.497Z" }, { "id": "10", "title": "ACTA DE FALLO.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:30:06.592Z" }, { "id": "11", "title": "PARTIDAS ADJUDICADAS.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:30:08.519Z" }, { "id": "12", "title": "ANEXO PRECIO NO CONVENIENTE.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:30:20.817Z" }, { "id": "13", "title": "ANEXO PRECIO NO CONVENIENTE P2.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/06b306a2645645a4baf06aeabeb901b5/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-01T20:30:43.316Z" } ] }, "awards": [ { "id": "1", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "ISAEL DE SANTIAGO RODRIGUEZ", "name": "ISAEL DE SANTIAGO RODRIGUEZ" } ], "value": { "amount": 440827.75, "currency": "MXN" } }, { "id": "2", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "VECO SA DE CV", "name": "VECO SA DE CV" } ], "value": { "amount": 329672, "currency": "MXN" } }, { "id": "3", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "COLIN INGENIERIA SA DE CV", "name": "COLIN INGENIERIA SA DE CV" } ], "value": { "amount": 83520, "currency": "MXN" } }, { "id": "4", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "JESUS MANUEL RESENDIZ BOONE", "name": "JESUS MANUEL RESENDIZ BOONE" } ], "value": { "amount": 296687.4, "currency": "MXN" } }, { "id": "5", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "JOSE ANGEL CARRAL NARRO", "name": "JOSE ANGEL CARRAL NARRO" } ], "value": { "amount": 3883313.44, "currency": "MXN" } }, { "id": "6", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "MIGUEL ANGEL DYER HERRERA", "name": "MIGUEL ANGEL DYER HERRERA" } ], "value": { "amount": 436309.44, "currency": "MXN" } }, { "id": "7", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "EL CRISOL SA DE CV", "name": "EL CRISOL SA DE CV" } ], "value": { "amount": 1214053.49, "currency": "MXN" } }, { "id": "8", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "name": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV" } ], "value": { "amount": 1187685.72, "currency": "MXN" } }, { "id": "9", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "APPLIED BIOSYSTEMS DE MEXICO S DE RL DE CV", "name": "APPLIED BIOSYSTEMS DE MEXICO S DE RL DE CV" } ], "value": { "amount": 93743.39, "currency": "MXN" } }, { "id": "10", "status": "active", "date": "2024-05-29T19:00:00.000Z", "suppliers": [ { "id": "HELS DE AGUASCALIENTES SA DE CV", "name": "HELS DE AGUASCALIENTES SA DE CV" } ], "value": { "amount": 236302.12, "currency": "MXN" } } ], "extensions": { "source": "ComprasMX", "canonical": "https://licitia.com.mx/licitacion/la-38-90u-03890u001-n-19-2024", "license": "https://creativecommons.org/licenses/by/4.0/", "ocidPrefixRegistered": false } }