{ "ocid": "ocds-x-licitia-la-38-90u-03890u001-n-31-2023", "id": "LA-38-90U-03890U001-N-31-2023", "date": "2023-10-02T19:00:00.000Z", "language": "es", "initiationType": "tender", "tag": [ "tender", "award", "contract" ], "parties": [ { "id": "CIQA", "name": "CIQA", "roles": [ "buyer" ] }, { "id": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "name": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "roles": [ "supplier" ] }, { "id": "HELS DE AGUASCALIENTES SA DE CV", "name": "HELS DE AGUASCALIENTES SA DE CV", "roles": [ "supplier" ] }, { "id": "SIGMA-ALDRICH QUIMICA S DE RL DE CV", "name": "SIGMA-ALDRICH QUIMICA S DE RL DE CV", "roles": [ "supplier" ] }, { "id": "YAIR AGUSTIN DE SANTIAGO RODRIGUEZ", "name": "YAIR AGUSTIN DE SANTIAGO RODRIGUEZ", "roles": [ "supplier" ] }, { "id": "PRODUCTOS Y EQUIPOS BIOTECNOLOGICOS SA DE CV", "name": "PRODUCTOS Y EQUIPOS BIOTECNOLOGICOS SA DE CV", "roles": [ "supplier" ] }, { "id": "ISAEL DE SANTIAGO RODRIGUEZ", "name": "ISAEL DE SANTIAGO RODRIGUEZ", "roles": [ "supplier" ] } ], "buyer": { "id": "CIQA", "name": "CIQA" }, "tender": { "id": "LA-38-90U-03890U001-N-31-2023", "title": "MATERIAL DIVERSO AGOSTO", "description": "MATERIAL DIVERSO AGOSTO", "status": "complete", "procurementMethod": "open", "procurementMethodDetails": "LICITACIÓN PÚBLICA", "mainProcurementCategory": "goods", "tenderPeriod": { "startDate": "2023-09-14T16:11:21.000Z", "endDate": "2023-09-26T15:00:00.000Z" }, "awardPeriod": { "endDate": "2023-10-02T19:00:00.000Z" }, "items": [ { "id": "0", "description": "CÓDIGO 546235 CATALOGO 34967-2.5L ACETONITRILO CHROMASOLV GRADO LC-MS FRASCO(S) CON 2.5 LITRO(S)\n\nRIEDEL DE HAEN", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 801, "currency": "MXN" } } }, { "id": "0", "description": "CÓDIGO 397758 CATALOGO TS2172-001 2,2,4-TRIMETILPENTANO (ISO-OCTANO) GRADO HPLC/SPECTRO FRASCO CON 4 LITROS. MCA TEDIA.\n\n4 LITRO(S) TEDIA", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2938, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO FOSFORICO RA 85% PLASTICO 1LT", "classification": { "scheme": "CUCOP", "id": "25101-0001" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 270, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL ETILICO (ETANOL) ABSOLUTO RA PORRON 18LT", "classification": { "scheme": "CUCOP", "id": "25101-0004" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1586, "currency": "MXN" } } }, { "id": "0", "description": "MICROTUBOS DE 2 ML CON TAPA", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 300, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACION DE BALANZA ANALÍTICA MODELO PA214\nMARCA OHAUS SERIE B337773749\nRANGO DE CALIBRACIÓN; 1 MG, 2MG, 5MG, 10MG, 20 MG, 50 MG, 100 MG, 200MG, 500MG, 1G, 2G, 5G, 10G, 20G, 50G, 100G, 200G\nSOLICITADO POR ALFONSO MERCADO\nPERTENECIENTE AL LNMG\nID C-LNG-002\nVIGENCIA DE 1 AÑO", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 1500, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACION DE BALANZA SEMIANALITICA MODELO\nPA401 \nMARCA OHAUS SERIE B328540119\nRANGO DE CALIBRACIÓN: 2G, 1000G, 2000G,3000G\nSOLICITADO POR ALFONSO MERCADO PERTENECIENTE AL LNMG\nID CLNG-003\nVIGENCIA DE 1 AÑO", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 1500, "currency": "MXN" } } }, { "id": "0", "description": "MICROESPATULA DE ACERO INOXIDABLE 22.5CM TERMINACION ESPEJO HEATHROW (CATALOGO: HS15909)", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 70, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE DE CAJA PETRI 100X15MM, DESECHABLE S/DIVISION POLIESTIRENO ESTERIL PAQUETE(S) CON 10 PIEZA(S) SYM (CATALOGO: 01SP)", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 41, "unit": { "name": "PIEZA", "value": { "amount": 36, "currency": "MXN" } } }, { "id": "0", "description": "METANOL (ALCOHOL METÍLICO), REACTIVO BAKER ANALIZED®, JT BAKER 9070, GRADO ACS, CAS: 67-56-1, PRESENTACIÓN DE 20L. NO. DE CATÁLOGO: CLAVE EL CRISOL: 49070-6420.", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHYDROFURAN INHIBITOR-FREE SUITABLE FOR HPLC 99.9%\nCATÁLOGO ALDRICH = 34865-4X4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3942, "currency": "MXN" } } }, { "id": "0", "description": "3 GARRAFONES (18 - 20 L) HEXANO GRADO TÉCNICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2334, "currency": "MXN" } } }, { "id": "0", "description": "4 GARRAFONES (18 - 20 L) CLOROFORMO GRADO TÉCNICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 7029, "currency": "MXN" } } }, { "id": "0", "description": "1 GARRAFÓN (18 - 20 L) DE METANOL GRADO TÉCNICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 913, "currency": "MXN" } } }, { "id": "0", "description": "2 GARRAFONES (18 - 20 L) ACETONA GRADO TÉCNICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1589, "currency": "MXN" } } }, { "id": "0", "description": "ACETONA GARRAFON DE 20L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1589, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 50ML FORMA BAJA GRIFFIN - KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 51, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE MAGNESIO 500 G. REF 2146-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 118, "currency": "MXN" } } }, { "id": "0", "description": "GLICERINA (GLICEROL) RA PLASTICO 1LT", "classification": { "scheme": "CUCOP", "id": "25101-0052" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 255, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL METILICO (METANOL) PARA USO EN LABORATORIO O INVESTIGACION PORRON PLASTICO 18LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 978, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE MATRAZ VOLUMÉTRICO PARA CONTENER DE 100 ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 3, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE MATRAZ VOLUMÉTRICO PARA CONTENER DE 50 ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 5, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE PIPETA VOLUMÉTRICA DE 0.5 ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE PIPETA VOLUMÉTRICA DE 1ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE PIPETA VOLUMÉTRICA DE 5 ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "CALIBRACIÓN DE PIPETA VOLUMÉTRICA DE 10 ML . CON LABORATORIO ACREDITADO EN VOLUMEN", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 950, "currency": "MXN" } } }, { "id": "0", "description": "ETILENGLICOL RA PLASTICO 3.5LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 260, "currency": "MXN" } } }, { "id": "0", "description": "ALCOHOL ETILICO ABSOLUTO RA 3.5 L MARCA CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 302, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHIDROFURANO HPLC 4 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3942, "currency": "MXN" } } }, { "id": "0", "description": "10784 VIDRIOS DE RELOJ 100 MM CON 3 PIEZAS PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0056" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 74, "currency": "MXN" } } }, { "id": "0", "description": "ACEITE PARA BOMBA DE VACIO FELISA DUO SEAL FE-1407K", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 480, "currency": "MXN" } } }, { "id": "0", "description": "HEXANOS 18.5 L MARCA JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2501, "currency": "MXN" } } }, { "id": "0", "description": "PAPEL PARAFILM DE 100 MM DE ANCHO X 38 M DE LONGITUD NATURAL.\nCATALOGO ALDRICH: HS234526B", "classification": { "scheme": "CUCOP", "id": "25501-0098" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 585, "currency": "MXN" } } }, { "id": "0", "description": "GALÓN DE THF GRADO HPLC ESTABILIZADO CON BHT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 3942, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE PAPEL FILTRO NO. 40 125 MM", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1095, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE GUANTES DE NITRILO MICROFLEX TALLA S S-15363 (2 CAJAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 210, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE GUANTES DE NITRILO MICROFLEX TALLA M S-15363 (2 CAJAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 210, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE GUANTES DE NITRILO MICROFLEX TALLA L S-15363 (2 CAJAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 210, "currency": "MXN" } } }, { "id": "0", "description": "WHA1821047. FILTROS DE MICROFIBRA DE VIDRIO WHATMAN,\nGRADE GF/B CIRCLES, 47 MM, 100/PK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3567.5, "currency": "MXN" } } }, { "id": "0", "description": "CODIGO: 104456 CTR00632 ACIDO CLORHIDRICO FUMANTE 36.5-38% ACS VIDRIO 2.5LT", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 535, "currency": "MXN" } } }, { "id": "0", "description": "10 ML BD JERINGA DE PLASTICO ( PAQUETE CON 100)", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 372.9, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO CLORHIDRICO ACS 36.5-38%", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 245, "currency": "MXN" } } }, { "id": "0", "description": "VERNIER DIGITAL - ELECTRÓNICA DIGITAL CALIBRADOR DE PANTALLA 6'' LCD METRIC CONVERSION ENTRE 6 INCHES Y 150MM,CALIBRADOR IMPERMEABLE DIGITAL ABRAZADERAS", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1178.38, "currency": "MXN" } } }, { "id": "0", "description": "EMBUDO ESTRIADO DE VIDRIO 100 MM TALLO CORTO PYREX, CAT. NO. 6180-100,", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 160.21, "currency": "MXN" } } }, { "id": "0", "description": "EMBUDO ESTRIADO DE VIDRIO 75 MM TALLO CORTO PYREX, CAT. NO. 6180-75,", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 114.76, "currency": "MXN" } } }, { "id": "0", "description": "EMBUDO ESTRIADO DE VIDRIO 55 MM TALLO CORTO PYREX, CAT. NO. 6180-55,", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 249.85, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO ROBUSTO CON RESISTENCIA A SUSTANCIAS QUÍMICAS NBR92-500 MARCA TOUCH N TUFF - TALLA MEDIANA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 228.56, "currency": "MXN" } } }, { "id": "0", "description": "GUANTES DE NITRILO ROBUSTO CON RESISTENCIA A SUSTANCIAS QUÍMICAS NBR92-500 MARCA TOUCH N TUFF - TALLA GRANDE", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 228.56, "currency": "MXN" } } }, { "id": "0", "description": "GLASS LIQUID SCINTILLATION VIALS, CAP = 20 ML, MARCA WHEATON, WITH PE CAP, DE ACUERDO A CATÁLOGO # DWK986546, CAJA CON 500 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 11059.36, "currency": "MXN" } } }, { "id": "0", "description": "CORNING PASTEUR PIPETTES 5 3/4 IN NON-STERILE - CATÁLOGO ALDRICH = CLS7095B5X-200 EA", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 588.13, "currency": "MXN" } } }, { "id": "0", "description": "MICROPIPETA 20-200 UL", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1406.25, "currency": "MXN" } } }, { "id": "0", "description": "PUNTA PARA MICROPIPETA 1-300 UL", "classification": { "scheme": "CUCOP", "id": "25501-0089" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 436.25, "currency": "MXN" } } }, { "id": "0", "description": "SODIO ARSENATO A.C.S. 25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1238.8, "currency": "MXN" } } }, { "id": "0", "description": "DIMETILSULFOXIDO\n D4540-1L", "classification": { "scheme": "CUCOP", "id": "25101-0037" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3360, "currency": "MXN" } } }, { "id": "0", "description": "MINI 1L STIRRER, AC/DC INPUT 100 V / 240 V, UNIVERSAL PLUG SET, POLYCARBONATE PLATE, GRAY, PURPLE, NO. DE CATÁLOGO: HS120155-1EA.\n \nCARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERTET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 3927.65, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ DE AFORACIÓN DE 10 ML CON TAPÓN DE VIDRIO", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 314.08, "currency": "MXN" } } }, { "id": "0", "description": "1 GARRAFÓN DE ÉTER ETILICO GRADO REACTIVO (18- 20 LITROS)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5100, "currency": "MXN" } } }, { "id": "0", "description": "3 GARRAFONES (18 - 20 L) CLORURO DE METILENO GRADO TÉCNICO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 6600, "currency": "MXN" } } }, { "id": "0", "description": "TERMÓMETROS DE -20 A 150° C", "classification": { "scheme": "CUCOP", "id": "25501-0096" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 140, "currency": "MXN" } } }, { "id": "0", "description": "COPPER(II) SULFATE PENTAHYDRATE\n\nREAGENTPLUS®, =98.0% 250G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1112.5, "currency": "MXN" } } }, { "id": "0", "description": "PARAFILM M ROLL SIZE 2 IN X 250 FT\nCATÁLOGO ALDRICH = P7543-1EA", "classification": { "scheme": "CUCOP", "id": "25501-0068" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 959.96, "currency": "MXN" } } }, { "id": "0", "description": "PIPETTE BULB, VOLUME 1 ML, NO. DE CATÁLOGO:Z509035-1PAK. 1 PAQUETE.\n\nCARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25501-0068" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 350, "currency": "MXN" } } }, { "id": "0", "description": "BORAX ANHYDROUS, CAS: 1330-43-4, SKU: 71997-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 95, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ EBULLICIÓN DE VIDRIO 250 ML FONDO PLANO CUELLO CORTO UNIÓN ESMERILADA 24/40 PYREX (PROVEEDOR CTR)", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 371.75, "currency": "MXN" } } }, { "id": "0", "description": "BARRA MAGNETICA POLIGONO DE TEFLON 6 X 10MM BLANCA SIN ANILLO", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 180, "currency": "MXN" } } }, { "id": "0", "description": "CAJA PETRI 100X15MM DE VIDRIO PAQUETE C/10 PIEZAS BRAND", "classification": { "scheme": "CUCOP", "id": "25501-0005" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 552.94, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO 10ML FORMA BAJA GRIFFIN - KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 48.92, "currency": "MXN" } } }, { "id": "0", "description": "VASO DE PRECIPITADO DE VIDRIO F/BAJA GRIFFIN 20ML PAQUETE C/5 PIEZAS - KIMAX", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 226.44, "currency": "MXN" } } }, { "id": "0", "description": "CLOROFORMO\n319988-2.5L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2120, "currency": "MXN" } } }, { "id": "0", "description": "ACETONA\n270725-4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 972.5, "currency": "MXN" } } }, { "id": "0", "description": "ETHYL ALCOHOL, PURE E7023", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2318.8, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO FORMICO 27001-1L-R", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 445, "currency": "MXN" } } }, { "id": "0", "description": "METANOL, ACS REAGENT, =99.8% 320390-4L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1057.5, "currency": "MXN" } } }, { "id": "0", "description": "105031 CTR105031 ACIDO SULFURICO CONCENTRADO RA ACS 95-98% VIDRIO AMBAR 3.5LT CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1070, "currency": "MXN" } } }, { "id": "0", "description": "104324 CTR00636 ACIDO CLORHIDRICO FUMANTE ACS 36-38% VIDRIO AMBAR 3.5LT CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 680, "currency": "MXN" } } }, { "id": "0", "description": "103815 CTR00800 ACIDO NITRICO 68-70% RA ACS (CONCENTRADO) VIDRIO AMBAR 3.5LT CTR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1200, "currency": "MXN" } } }, { "id": "0", "description": "1442-125 PAPEL FILTRO #42 12.5CM C/100 WHATMAN", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1730, "currency": "MXN" } } }, { "id": "0", "description": "ZINC ACETATE DIHYDRATE =98.0%, REAGENT GRADE, SIGMA-ALDRICH Z0625-1KG. GRADO\nREAGENT GRADE\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=98% (EDTA TITRATION)\n\nFORMULARIO\nPOWDER\n\nREACTION SUITABILITY\nREAGENT TYPE: CATALYST\nCORE: ZINC\n\nSMILES STRING\nO.O.CC(=O)O[ZN]OC(C)=O\n\nINCHI\n1S/2C2H4O2.2H2O.ZN/C2*1-2(3)4;;;/H2*1H3,(H,3,4);2*1H2;/Q;;;;+2/P-2\n\nINCHI KEY\nBEAZKUGSCHFXIQ-UHFFFAOYSA-L\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1992.6, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE POTASIO 500 G. REF 1152-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 450, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE SODIO 500 G. REF 1153-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 85, "currency": "MXN" } } }, { "id": "0", "description": "ACETATO DE POTASIO 500 G. REF 1007-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 445, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE BARIO 500 G. REF 2136-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 370, "currency": "MXN" } } }, { "id": "0", "description": "NITRATO DE MAGNESIO 500 G. REF 2528-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 350, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE ZINC 500 G. REF 2154-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 675, "currency": "MXN" } } }, { "id": "0", "description": "CLORURO DE LITIO 500 G. REF 1145-500", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2850, "currency": "MXN" } } }, { "id": "0", "description": "AMBER STORAGE BOTTLES VOL 240 ML OD X H61 MM, X 143 MM, 24-400, PKG OF 12 EA, 23235", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 533.33, "currency": "MXN" } } }, { "id": "0", "description": "AGUA TRIDESTILADA, FRASCO DE 3.5 LITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 95, "currency": "MXN" } } }, { "id": "0", "description": "MATRAZ BOLA FONDO REDONDO DE 100ML JUNTA 24/40", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 317.77, "currency": "MXN" } } }, { "id": "0", "description": "FOSFATO DE POTASIO DIBASIC, PURISS. P.A., ACS REAGENT, ANHYDROUS, =99.0% (T), CÓDIGO 60356-1KG. GRADO\nACS REAGENT\nPURISS. P.A.\n\nNIVEL DE CALIDAD\n300\n\nANÁLISIS\n=99.0% (T)\n\nFORMULARIO\nPOWDER OR CRYSTALS\n\nIMPUREZAS\n=0.001% TOTAL NITROGEN (N)\n\nPÉRDIDA\n=1.0% LOSS ON DRYING, 105 °C\n\nPH\n8.5-9.6 (25 °C, 50 MG/ML IN H2O)\n\nTRAZAS DE ANIÓN\nCHLORIDE (CL-): =30 MG/KG\nSULFATE (SO42-): =50 MG/KG\n\nTRAZAS DE CATIÓN\nCA: =50 MG/KG\nCD: =5 MG/KG\nCO: =5 MG/KG\nCR: =5 MG/KG\nCU: =5 MG/KG\nFE: =10 MG/KG\nMG: =5 MG/KG\nMN: =5 MG/KG\nNA: =500 MG/KG\nNI: =5 MG/KG\nPB: =5 MG/KG\nZN: =5 MG/KG\nHEAVY METALS: =5 PPM (BY ICP-OES)\n\nSMILES STRING\n[K+].[K+].OP([O-])([O-])=O\n\nINCHI\n1S/2K.H3O4P/C;;1-5(2,3)4/H;;(H3,1,2,3,4)/Q2*+1;/P-2\n\nINCHI KEY\nZPWVASYFFYYZEW-UHFFFAOYSA-L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2332.6, "currency": "MXN" } } }, { "id": "0", "description": "TUBOS PARA CENTRIFUGA TIPO FALCON DE 50 ML (50 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0047" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 300, "currency": "MXN" } } }, { "id": "0", "description": "TUBO TIPO EPPENDORF DE 2.0 ML, PAQUETE CON 500 PZAS", "classification": { "scheme": "CUCOP", "id": "25501-0047" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 350, "currency": "MXN" } } }, { "id": "0", "description": "DIETILENGLICOL RA PLASTICO 2.5LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 715, "currency": "MXN" } } }, { "id": "0", "description": "PROPILENGLICOL RA PORRON 20LT", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6250, "currency": "MXN" } } }, { "id": "0", "description": "21782 ACIDDO CITRICO ANHIDRO 500 G C/2 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 460, "currency": "MXN" } } }, { "id": "0", "description": "1138 VIDRIOS DE RELOJ 2 PIEZAS 150 MM PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0056" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 78.79, "currency": "MXN" } } }, { "id": "0", "description": "27819 PINZA DE ACERO INOXIDABLE PUNTA FINA DENTADA, LARGO 4.5 PULGADAS PQTE 2 PIEZAS", "classification": { "scheme": "CUCOP", "id": "25501-0080" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 700, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO DE VIDRIO CLARO 250ML P/MEDIO DE CULTIVO GRADUADO C/TAPON DE ROSCA NARANJA", "classification": { "scheme": "CUCOP", "id": "25501-0077" }, "quantity": 10, "unit": { "name": "PIEZA", "value": { "amount": 150.59, "currency": "MXN" } } }, { "id": "0", "description": "FRASCO DE VIDRIO CLARO 500ML P/MEDIO DE CULTIVO GRADUADO C/TAPON DE ROSCA NARANJA", "classification": { "scheme": "CUCOP", "id": "25501-0077" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 168.24, "currency": "MXN" } } }, { "id": "0", "description": "ETANOL ANHIDRO, 18.5 L. MARCA JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2430, "currency": "MXN" } } }, { "id": "0", "description": "ACETONA, 18.5 L MARCA JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2925, "currency": "MXN" } } }, { "id": "0", "description": "ETILENGLICOL, 18.5 L JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2720, "currency": "MXN" } } }, { "id": "0", "description": "ETILENGLICOL, 18.5 L JALMEK", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2720, "currency": "MXN" } } }, { "id": "0", "description": "AGUA DESIONIZADA PLASTICO PORRON 20LT", "classification": { "scheme": "CUCOP", "id": "25101-0062" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 280, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE PYREX® LOW ACTINIC MEDIA STORAGE BOTTLE, GRADUATED WITH SCREW CAP, CAPACITY 100 ML, CÓDIGO CLS51395100-4EA. MATERIAL\nAMBER BOTTLE\nBOROSILICATE GLASS BOTTLE\nCYLINDRICAL BOTTLE\nPOLYPROPYLENE CAP\nWIDE-MOUTH BOTTLE\n\nESTERILIDAD\nNON-STERILE\n\nCARACTERÍSTICA\nAUTOCLAVABLE\nCAP\nGRADUATIONS\n\nENVASE\nCASE OF 4 EA\nPACK OF 4 EA\n\nMANUFACTURER/TRADENAME\nCORNING 51395-100\n\nAVAILABILITY\nNOT AVAILABLE IN EU\n\nDIÁMETRO DEL CUELLO DE BOTELLA\n30 MM\n\nCAPACIDAD\n100 ML\n\nDIÁM. × AL\n56 MM × 100 MM\n\nADAPTADOR\n45", "classification": { "scheme": "CUCOP", "id": "25501-0092" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 930, "currency": "MXN" } } }, { "id": "0", "description": "BUFFER, REFERENCE STANDARD PH 4.00±0.01 (25 °C)\nB5020-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 155.84, "currency": "MXN" } } }, { "id": "0", "description": "BUFFER, REFERENCE STANDARD PH 7.00±0.01 (25 °C)\nB4770-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 135.8, "currency": "MXN" } } }, { "id": "0", "description": "BX16361-500ML BUFFER PH 10.0 CLEAR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 89.11, "currency": "MXN" } } }, { "id": "0", "description": "158968-5KG DEXTROSA ANHIDRA", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2088.89, "currency": "MXN" } } }, { "id": "0", "description": "Z0625-1KG ZINC ACETATE DIHYDRATE, REAGENT GRADE", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1992.6, "currency": "MXN" } } }, { "id": "0", "description": "563935-4L ISOPROPANOL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1363.8, "currency": "MXN" } } }, { "id": "0", "description": "2 LITROS DE ETILEN GLICOL, PUREZA ) 99.5 %\nCATALOGO ALDRICH: 324558-2L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "LITRO", "value": { "amount": 420, "currency": "MXN" } } }, { "id": "0", "description": "100 GR DE CLORURO DE COBALTO HEXAHIDRATADO, PUREZA ) 98 %\nCATALOGO ALDRICH: 255599-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "GRAMO", "value": { "amount": 1657.5, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE DE 100 JERINGAS DE POLIPROPILENO SIN AGUJA DE 3 ML DE CAPACIDAD Y GRADUACIÓN DE 0.1 ML.\nCATALOGO ALDRICH: Z116858-100EA", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 237.48, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE CON 100 JERINGAS DE POLIPROPILENO SIN AGUJA DE 20 ML DE CAPACIDAD Y GRADUACION DE 1 ML.\nCATALOGO ALDRICH: Z116882", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 531.23, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE CON 30 JERINGAS DE POLIPROPILENO SIN AGUJA DE 50 ML DE CAPACIDAD Y GRADUACIÓN DE 2 ML.\nCATALOGO ALDRICH: Z118400", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2865.57, "currency": "MXN" } } }, { "id": "0", "description": "PAQUETE CON 100 JERINGAS DE POLIPROPILENO SIN AGUJA DE 10 ML DE CAPACIDAD Y GRADUACIÓN DE 0.5 ML.\nCATALOGO ALDRICH: Z683604", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 371.9, "currency": "MXN" } } }, { "id": "0", "description": "GRASA DE SILICON PARA JUNTAS DE VIDRIO SOMETIDAS A ALTA VACIO", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 1438.56, "currency": "MXN" } } }, { "id": "0", "description": "CAJA CON 200 PIEZAS PIPETAS PASTEUR NO ESTERILIZADAS DE 5 3/4 PULGADAS DE LONGITUD.\nCATALOGO ALDRICH: CLS7095B5X-200EA", "classification": { "scheme": "CUCOP", "id": "25501-0031" }, "quantity": 7, "unit": { "name": "PIEZA", "value": { "amount": 588.13, "currency": "MXN" } } }, { "id": "0", "description": "TERMÓMETROS DE VIDRIO DE LABORATORIO CON ALCOHOL AZUL -20 A 150°C", "classification": { "scheme": "CUCOP", "id": "25501-0096" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 140, "currency": "MXN" } } }, { "id": "0", "description": "GALÓN DE ACIDO SULFÚRICO CONCENTRADO DE PUREZA MAYOR AL 95 %, ENVASADO EN BOTELLA DE VIDRIO ÁMBAR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1070, "currency": "MXN" } } }, { "id": "0", "description": "3.5 LITROS ÁCIDO NÍTRICO 64-66%. REACTIVO", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1200, "currency": "MXN" } } }, { "id": "0", "description": "3.5 LITROS ÁCIDO SULFÚRICO 95-98%. REACTIVO", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1070, "currency": "MXN" } } }, { "id": "0", "description": "4 LITROS DE ÉTER ETÍLICO ANHIDRO R.A.", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1225, "currency": "MXN" } } }, { "id": "0", "description": "4 LITROS DE METANOL R.A", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 340, "currency": "MXN" } } }, { "id": "0", "description": "4 LITROS DE XILENO R.A", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 4, "unit": { "name": "PIEZA", "value": { "amount": 780, "currency": "MXN" } } }, { "id": "0", "description": "3.5 LITROS DE HEXANO R.A", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 670, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS DE CARTUCHOS DE CELULOSA PARA EXTRACCIÓN 33 X 80 MM", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2785, "currency": "MXN" } } }, { "id": "0", "description": "CAJA DE PAPEL FILTRO NO. 42 125 MM", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1730, "currency": "MXN" } } }, { "id": "0", "description": "AGITADORES MAGNÉTICOS 20 MM", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 20, "unit": { "name": "PIEZA", "value": { "amount": 100, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS DE GUANTES DE LÁTEX TAMAÑO CHICO, CON 100 PZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 193.39, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS DE GUANTES DE LÁTEX TAMAÑO MEDIANO, CON 100 PZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 193.39, "currency": "MXN" } } }, { "id": "0", "description": "CAJAS DE GUANTES DE LÁTEX TAMAÑO GRANDE, CON 100 PZAS.", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 193.39, "currency": "MXN" } } }, { "id": "0", "description": "10 ML BD JERINGA DE PLASTICO ( PAQUETE CON 100)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 372.9, "currency": "MXN" } } }, { "id": "0", "description": "1000 BRAND® PASTEUR PIPETTE SODA-LIME GLASS, CAPACITY × L ~1.5 ML × 270 MM, UN-\nPLUGGED, NON-STERILE. (1 PAQUETE 1000 PIEZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4453.33, "currency": "MXN" } } }, { "id": "0", "description": "VIALES DE VIDRIO CON TAPA (COLOR TRANSPARENTE) 15ML 3 CAJAS CON 24PZAS", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4614.55, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS DE 100 ML (3 CAJAS C/12PZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1485, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS DE 250ML (3 CAJAS C/12PZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3672.85, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS DE 400 ML (3 CAJAS C/6PZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1665, "currency": "MXN" } } }, { "id": "0", "description": "VASOS DE PRECIPITADOS DE 1000 ML(3 CAJAS C/6PZAS)", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3408.85, "currency": "MXN" } } }, { "id": "0", "description": "93854-100G. PECTIN FROM APPLE, PRESENTACIÓN DE 100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2343, "currency": "MXN" } } }, { "id": "0", "description": "TETRABUTYLAMMONIUM IODIDE NO. CATALOGO 140775-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 689, "currency": "MXN" } } }, { "id": "0", "description": "(DIACETOXYIODO)BENZENE NO. CATALOGO 178721-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1404, "currency": "MXN" } } }, { "id": "0", "description": "UN FRASCO DE 4-(DIMETHYLAMINO)PYRIDINE\nNO. DE CATALOGO 107700-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1366, "currency": "MXN" } } }, { "id": "0", "description": "METHYL SALICYLATE M6752-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1304, "currency": "MXN" } } }, { "id": "0", "description": "L-SERINA REAGENTPLUS 99%100GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2290, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO L-GLUTAMICO REAGENTPLUS 99% 500 GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1560, "currency": "MXN" } } }, { "id": "0", "description": "TWEEN 20 AGENTE HUMECTANTE SOLN 500ML HYCEL", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1298, "currency": "MXN" } } }, { "id": "0", "description": "AZUL BRILLANTE G 250 P/MICROSCOPIA 100GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4135, "currency": "MXN" } } }, { "id": "0", "description": "8-HYDROXYPYRENE-1,3,6-TRISULFONIC ACID TRISODIUM SALT, =96%, NO. CAT. H1529, ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2701, "currency": "MXN" } } }, { "id": "0", "description": "METHANOL-D4, =99.8 ATOM % D, CONTAINS 0.05 % (V/V) TMS, NO. CAT. 611646-25G, ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6603, "currency": "MXN" } } }, { "id": "0", "description": "ETHYLENEDIAMINETETRAACETIC ACID, 99.995% TRACE METALS BASIS, NO. CAT. 431788-25G, ALDRICH", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1102, "currency": "MXN" } } }, { "id": "0", "description": "\"GRAPHENE OXIDE, PASTE, NON-EXFOLIATED, NO. DE CATALOGO 900704-100G. NIVEL DE CALIDAD\n100\n\nFORMULARIO\nPASTE\n\nCOMPOSICIÓN\nC, =3% (BY GRAVIMETRIC ANALYSIS COMBINED WITH EA)\n\nCARACTERÍSTICAS DE LOS PRODUCTOS ALTERNATIVOS MÁS SOSTENIBLES\nDESIGN FOR ENERGY EFFICIENCY\nLEARN MORE ABOUT THE PRINCIPLES OF GREEN CHEMISTRY.\n\nCATEGORÍA ALTERNATIVA MÁS SOSTENIBLE\nENABLING\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 11875, "currency": "MXN" } } }, { "id": "0", "description": "PRECISION SEAL RUBBER SEPTA FOR JOINTS 14/20 - CATÁLOGO ALDRICH Z553964-100EA", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 2942, "currency": "MXN" } } }, { "id": "0", "description": "SILICA GEL 70-320 MESH FOR COLUMN CHROMATOGRAPHY - CATÁLOGO ALDRICH = 288624-5KG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 16046, "currency": "MXN" } } }, { "id": "0", "description": "POLYVINYLPYRRROLIDONE AVERAGE MOL WT 40,000, PVP40-50G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "GRAMO", "value": { "amount": 708, "currency": "MXN" } } }, { "id": "0", "description": "POLYVINYLPYRRROLIDONE AVERAGE MOL WT 10,000, PVP10-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "GRAMO", "value": { "amount": 1166, "currency": "MXN" } } }, { "id": "0", "description": "POLYVINYLPYRRROLIDONE AVERAGE MOL WT MW 1,300,000, 437190-25G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "GRAMO", "value": { "amount": 1103, "currency": "MXN" } } }, { "id": "0", "description": "POLYVINYLPYRRROLIDONE POWDER AVERAGE MOL WT 55,000, 856568-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "GRAMO", "value": { "amount": 1287, "currency": "MXN" } } }, { "id": "0", "description": "SODIUM HYPOCHLORITE SOLUTION REAGENT GRADE, AVAILABLE CHLORINE 4.00-4.99% 500ML CLAVE 239305-500ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1343, "currency": "MXN" } } }, { "id": "0", "description": "[6,6]-PHENYL C61 BUTYRIC ACID METHYL ESTER, 99.5%. NO. CATÁLOGO:684449-500MG, FRASCO DE 500 MG.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 14811, "currency": "MXN" } } }, { "id": "0", "description": "POLY(3-HEXYLTHIOPHENE-2,5-DIYL), NO. CATÁLOGO:445703-1G, FRASCO DE 1 GR.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 13176, "currency": "MXN" } } }, { "id": "0", "description": "PLATINUM WIRE AUXILIARY ELECTRODE, NO. CATÁLOGO:BASMW1032-1EA, \nDESCRIPCIÓN Y COSTO DE REFERENCIA TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA-ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5893, "currency": "MXN" } } }, { "id": "0", "description": "8-HYDROXYPYRENE-1,3,6-TRISULFONIC ACID TRISODIUM SALT, 96%, NO. CATÁLOGO:H1529-1G, \nDESCRIPCIÓN Y COSTO DE REFERENCIA TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA-ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2701, "currency": "MXN" } } }, { "id": "0", "description": "AG/AGCL (3M KCL) REFERENCE ELECTRODE, NO. CATÁLOGO:BASMF2056-1EA,", "classification": { "scheme": "CUCOP", "id": "25501-0022" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2794, "currency": "MXN" } } }, { "id": "0", "description": "TETRABUTYLAMMONIUM FLUORIDE SOLUTION 1.0M IN THF, NO. CATÁLOGO:216143-100ML, FRASCO DE 100 ML \nDESCRIPCIÓN Y COSTO DE REFERENCIA TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA-ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1691, "currency": "MXN" } } }, { "id": "0", "description": "\"CELLULOSE MICROCRYSTALLINE, POWDER, 20 µM, CÓDIGO 310697-50G. FORMULARIO\nMICROCRYSTALLINE\nPOWDER\n\nNIVEL DE CALIDAD\n100\n\nTAMAÑO DE PARTÍCULA\n20 µM\n\nPH\n5-7 (11 WT. %)\n\nDENSIDAD APARENTE\n0.5 G/ML (25°C)\n\nINCHI\n1S/C12H22O11/C13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/H3-20H,1-2H2/T3?,4?,5?,6?,7?,8?,9?,10-,11?,12+/M1/S1\n\nINCHI KEY\nGUBGYTABKSRVRQ-WFVLMXAXSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1009, "currency": "MXN" } } }, { "id": "0", "description": "MORPHOLINE, NO. CATALOGO 134236-100ML, 100ML", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 862, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO (SIGMA ALDRICH) \tCONTAINS 40-150 PPM AMYLENE AS STABILIZER, ACS REAGENT, =99.5% D65100-2.5L\n2.5 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2660, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIMETILFORMAMIDA, ANHYDROUS, 99.8% (SIGMA ALDRICH) 227056 , 1 L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2491, "currency": "MXN" } } }, { "id": "0", "description": "4 LITROS DE N,N-DIMETILFORMAMIDA SUITABLE FOR HPLC, =99.9%, CÓDIGO 270547-2L. DENSIDAD DE VAPOR\n2.5 (VS AIR)\n\nNIVEL DE CALIDAD\n100\n\nPRESIÓN DE VAPOR\n2.7 MMHG ( 20 °C)\n\nANÁLISIS\n=99.9%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n833 °F\n\nPURIFICADO POR\nGLASS DISTILLATION\n\nLIM. EXPL.\n15.2 %\n\nTECHNIQUE(S)\nHPLC: SUITABLE\n\nIMPUREZAS\n=0.030% WATER\n\nRESIDUO DE EVAP.\n(0.0005%\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.430 (LIT.)\n\nPH\n6.7\n\nBP\n153 °C (LIT.)\n\nMP\n-61 °C (LIT.)\n\nDENSIDAD\n0.944 G/ML (LIT.)\n\n?\nH2O REFERENCE\n\nABSORCIÓN UV\n?: 270 NM AMAX: 1.00\n?: 275 NM AMAX: 0.30\n?: 295 NM AMAX: 0.10\n?: 310 NM AMAX: 0.05\n?: 340-400 NM AMAX: 0.01\n\nAPPLICATION(S)\nFOOD AND BEVERAGES\n\nSMILES STRING\n[H]C(=O)N(C)C\n\nINCHI\n1S/C3H7NO/C1-4(2)3-5/H3H,1-2H3\n\nINCHI KEY\nZMXDDKWLCZADIW-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5037, "currency": "MXN" } } }, { "id": "0", "description": "METANOL-D4, =99.8 ATOM % D, CONTAINS 0.05 % (V/V) TMS, CÓDIGO 611646-25G. PUREZA ISOTÓPICA\n=99.8 ATOM % D\n\nNIVEL DE CALIDAD\n200\n\nANÁLISIS\n=99% (CP)\n\nFORMULARIO\nLIQUID\n\nCONTIENE\n0.05 % (V/V) TMS\n\nLIM. EXPL.\n5.5-36.5 % (LIT.)\n\nTECHNIQUE(S)\nNMR: SUITABLE\n\nIMPUREZAS\n=0.025% WATER\nWATER\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.326 (LIT.)\n\nBP\n65.4 °C (LIT.)\n\nMP\n-99 °C (LIT.)\n\nDENSIDAD\n0.888 G/ML AT 25 °C (LIT.)\n\nFORMATO\nMIXTURE\n\nSMILES STRING\n[2H]OC([2H])([2H])[2H]\n\nINCHI\n1S/CH4O/C1-2/H2H,1H3/I1D3,2D\n\nINCHI KEY\nOKKJLVBELUTLKV-MZCSYVLQSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6603, "currency": "MXN" } } }, { "id": "0", "description": "DICLOROMETANO ANHYDROUS, =99.8%, CONTAINS 40-150 PPM AMYLENE AS STABILIZER, CÓDIGO 270997-2L. GRADO\nANHYDROUS\n\nNIVEL DE CALIDAD\n200\n\nDENSIDAD DE VAPOR\n2.9 (VS AIR)\n\nPRESIÓN DE VAPOR\n24.45 PSI ( 55 °C)\n6.83 PSI ( 20 °C)\n6.86 PSI ( 20 °C)\n\nANÁLISIS\n=99.8%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n1223 °F\n\nCONTIENE\n40-150 PPM AMYLENE AS STABILIZER\n\nLIM. EXPL.\n22 %\n\nTECHNIQUE(S)\nGAS CHROMATOGRAPHY (GC): SUITABLE\n\nIMPUREZAS\n=0.001% WATER\n=0.005% WATER (100 ML PKG)\n\nRESIDUO DE EVAP.\n(0.0005%\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.424 (LIT.)\n\nBP\n39.8-40 °C (LIT.)\n\nMP\n-97 °C (LIT.)\n\nDENSIDAD\n1.325 G/ML AT 25 °C (LIT.)\n\nSMILES STRING\nCLCCL\n\nINCHI\n1S/CH2CL2/C2-1-3/H1H2\n\nINCHI KEY\nYMWUJEATGCHHMB-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0002" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3197, "currency": "MXN" } } }, { "id": "0", "description": "TETRAHIDROFURAN, ANHYDROUS, =99.9%, INHIBITOR-FREE , FRASCO DE 1 L. NO. DE CATÁLOGO: 401757-1L. \n\nCARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERTET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2778, "currency": "MXN" } } }, { "id": "0", "description": "METANOL-D4, =99.8 ATOM % D, CONTAINS 0.03 % (V/V) TMS, NO. DE CATÁLOGO:343803-10G. FRASCO DE 10G \n\nCARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3409, "currency": "MXN" } } }, { "id": "0", "description": "D-GLUCONIC ACID SODIUM SALT, =99%. NO. CATÁLOGO: G9005-500G, FRASCO DE 500 GRAMOS.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 733, "currency": "MXN" } } }, { "id": "0", "description": "PYRIDOXAL HYDROCHLORIDE, NO. CATÁLOGO: P6155-5G. FRASCO DE 5 G. CARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERTET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2254, "currency": "MXN" } } }, { "id": "0", "description": "YODURO DE POTASIO REAGENT PLUS )99% \nCANTIDAD SOLICITADA = 500 G\nCATÁLOGO ALDRICH = 207969-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "UNIDAD", "value": { "amount": 3427, "currency": "MXN" } } }, { "id": "0", "description": "HEXADECYLTRIMETHYLAMMONIUM BROMIDE NO. DE CATALOGO H5882-100G $1453", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1298, "currency": "MXN" } } }, { "id": "0", "description": "2-ETOXIETANOL, REAGENTPLUS®, 99%, NO. CATÁLOGO: 128082-1L FRASCO DE 1 LITRO. \n\nCARACTERÍSTICAS Y COSTOS TOMADOS DE LA PÁGINA DE INTERNET DE SIGMA ALDRICH (MERCK)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1388, "currency": "MXN" } } }, { "id": "0", "description": "1,2-DIMYRISTOYL-SN-GLYCERO-3-PHOSPHATE (SODIUM SALT), POWDER14:0 PA\n830845P-25MG", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2092, "currency": "MXN" } } }, { "id": "0", "description": "(3-AMINOPROPIL)TRIETOXISILANO440140-100ML\nSINÓNIMOS: 3-TRIETOXISILILPROPILAMINA, APTES, APTS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2109, "currency": "MXN" } } }, { "id": "0", "description": "DIMETILSULFÓXIDO, =99.5% (GC), SUITABLE FOR PLANT CELL CULTURE\nD4540-1L", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2409, "currency": "MXN" } } }, { "id": "0", "description": "SODIUM ALUMINATE GRADO TÉCNICO SIGMA-ALDRICH 13404-2.5KG-R . GRADO\nTECHNICAL\n\nNIVEL DE CALIDAD\n100\n\nFORMULARIO\nPOWDER\n\nREACTION SUITABILITY\nCORE: ALUMINUM\nREAGENT TYPE: CATALYST\n\nIMPUREZAS\n=0.05% FE (AS FE2O3)\n\nTRAZAS DE CATIÓN\nAL (AL2O3): 50-56%\nNA (AS NA2O): 37-45%\n\nSMILES STRING\n[NA+].O=[AL-]=O\n\nINCHI\n1S/AL.NA.2O/Q-1;+1;;\n\nINCHI KEY\nIYJYQHRNMMNLRH-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "KILOGRAMO", "value": { "amount": 2572, "currency": "MXN" } } }, { "id": "0", "description": "GRAPHENE OXIDE, PASTE NON-EXFOLIATED, SKU: 900704-100G .NIVEL DE CALIDAD\n100\n\nFORMULARIO\nPASTE\n\nCOMPOSICIÓN\nC, =3% (BY GRAVIMETRIC ANALYSIS COMBINED WITH EA)\n\nCARACTERÍSTICAS DE LOS PRODUCTOS ALTERNATIVOS MÁS SOSTENIBLES\nDESIGN FOR ENERGY EFFICIENCY\nLEARN MORE ABOUT THE PRINCIPLES OF GREEN CHEMISTRY.\n\nCATEGORÍA ALTERNATIVA MÁS SOSTENIBLE\nENABLING\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 11875, "currency": "MXN" } } }, { "id": "0", "description": "TOLUENO ANHÍDRO 99.8 % (2 L) NO. CAT. SIGMA-ALDRICH 244511-2L . GRADO\nANHYDROUS\n\nNIVEL DE CALIDAD\n100\n200\n\nDENSIDAD DE VAPOR\n3.2 (VS AIR)\n\nPRESIÓN DE VAPOR\n22 MMHG ( 20 °C)\n26 MMHG ( 25 °C)\n\nANÁLISIS\n99.8%\n\nFORMULARIO\nLIQUID\n\nTEMP. DE AUTOIGNICIÓN\n997 °F\n\nLIM. EXPL.\n7 %\n\nIMPUREZAS\n(0.001% WATER\n(0.005% WATER (100 ML PKG)\n\nRESIDUO DE EVAP.\n(0.0005%\n\nCOLOR\nCOLORLESS\n\nÍNDICE DE REFRACCIÓN\nN/D 1.496 (LIT.)\n\nBP\n110-111 °C (LIT.)\n\nMP\n-93 °C (LIT.)\n\nDENSIDAD\n0.865 G/ML AT 25 °C (LIT.)\n\nSMILES STRING\nCC1CCCCC1\n\nINCHI\n1S/C7H8/C1-7-5-3-2-4-6-7/H2-6H,1H3\n\nINCHI KEY\nYXFVVABEGXRONW-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 2173, "currency": "MXN" } } }, { "id": "0", "description": "6-MALEIMIDOHEXANOIC ACID 90% NO. CAT. SIGMA-ALDRICH 755842-25G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n90% (GC)\n\nFORMULARIO\nPOWDER\n\nMP\n87-92 °C\n\nTEMP. DE ALMACENAMIENTO\n2-8°C\n\nSMILES STRING\nOC(=O)CCCCCN1C(=O)C=CC1=O\n\nINCHI\n1S/C10H13NO4/C12-8-5-6-9(13)11(8)7-3-1-2-4-10(14)15/H5-6H,1-4,7H2,(H,14,15)\n\nINCHI KEY\nWOJKKJKETHYEAC-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4694, "currency": "MXN" } } }, { "id": "0", "description": "11-MALEIMIDOUNDECANOIC ACID 95 % NO. CAT. SIGMA-ALDRICH 755850-25G. NIVEL DE CALIDAD\n100\n\nANÁLISIS\n95% (GC)\n\nFORMULARIO\nPOWDER\n\nMP\n94-98 °C\n\nSMILES STRING\nOC(=O)CCCCCCCCCCN1C(=O)C=CC1=O\n\nINCHI\n1S/C15H23NO4/C17-13-10-11-14(18)16(13)12-8-6-4-2-1-3-5-7-9-15(19)20/H10-11H,1-9,12H2,(H,19,20)\n\nINCHI KEY\nUVZTZBRGZXIBLZ-UHFFFAOYSA-N\"", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7587, "currency": "MXN" } } }, { "id": "0", "description": "CARBON NANOTUBE, MULTI-WALLED 901019-25G\nCAS NO.:308068-56-6 \n50-90 NM DIAMETER, )95% CARBON BASIS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 7247, "currency": "MXN" } } }, { "id": "0", "description": "PHOSPHATE BUFFER SOLUTION, 1.0 M, PH 7.4 (25 °C), CÓDIGO P3619-1GA. FORMULARIO\nLIQUID\n\nNIVEL DE CALIDAD\n200\n\nCONCENTRACIÓN\n1.0 M\n\nPH\n7.4 (25 °C)\n\nAPPLICATION(S)\nDIAGNOSTIC ASSAY MANUFACTURING\n\nTEMP. DE ALMACENAMIENTO\n2-8°C", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1200, "currency": "MXN" } } }, { "id": "0", "description": "CURCUMIN, FROM CURCUMA LONGA (TURMERIC), POWDE, CÓDIGO C1386-50G. ORIGEN BIOLÓGICO\nCURCUMA LONGA (TURMERIC)\n\nNIVEL DE CALIDAD\n200\n\nDENSIDAD DE VAPOR\n13 (VS AIR)\n\nFORMULARIO\nPOWDER\n\nCONCENTRACIÓN\n=65% (HPLC)\n\nMP\n175 °C\n\nSOLUBILIDAD\nETHANOL: 10 MG/ML\nDMSO: )11 MG/ML (LIT.)(LIT.)\n0.5 M NAOH: SOLUBLE (THEN IMMEDIATELY DILUTE IN PBS [LIT.])(LIT.)\n\nTEMP. DE ALMACENAMIENTO\n-20°C\n\nSMILES STRING\nCOC1CC(\\C=C\\C(=O)CC(=O)\\C=C\\C2CCC(O)C(OC)C2)CCC1O\n\nINCHI\n1S/C21H20O6/C1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/H3-12,24-25H,13H2,1-2H3/B7-3+,8-4+\n\nINCHI KEY\nVFLDPWHFBUODDF-FCXRPNKRSA-N\n\nGENE INFORMATION\nHUMAN ... APP(351) , CYP1A2(1544)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 6647, "currency": "MXN" } } }, { "id": "0", "description": "MYRCENE, TECHNICAL GRADE, CÓDIGO M100005-500ML. GRADO\nTECHNICAL GRADE\n\nNIVEL DE CALIDAD\n200\n\nDENSIDAD DE VAPOR\n4.7 (VS AIR)\n\nPRESIÓN DE VAPOR\n~7 MMHG ( 20 °C)\n\nCONTIENE\n1000 PPM BHT AS INHIBITOR\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.469 (LIT.)\n\nBP\n167 °C (LIT.)\n\nSOLUBILIDAD\nWATER: SOLUBLE 0.00109 G/L AT 20 °C\n\nDENSIDAD\n0.791 G/ML AT 25 °C (LIT.)\n\nTEMP. DE ALMACENAMIENTO\n-20°C\n\nSMILES STRING\nC\\C(C)=C/CCC(=C)C=C\n\nINCHI\n1S/C10H16/C1-5-10(4)8-6-7-9(2)3/H5,7H,1,4,6,8H2,2-3H3\n\nINCHI KEY\nUAHWPYUMFXYFJY-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1548, "currency": "MXN" } } }, { "id": "0", "description": "PEPSIN FROM PORCINE GASTRIC MUCOSA CAS: 9001-75-6 POWDER, =400 UNITS/MG PROTEIN, SIGMA ALDRICH, P7125-100G, 100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2083, "currency": "MXN" } } }, { "id": "0", "description": "HENTRIACONTANE (51529-1G)", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4428, "currency": "MXN" } } }, { "id": "0", "description": "GRAPHENE OXIDE (POWDER, 15-20 SHEETS, 4-10% EDGE-OXIDIZED)796034-1G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3195, "currency": "MXN" } } }, { "id": "0", "description": "POLY(3,4-ETHYLENEDIOXYTHIOPHENE)-POLY(STYRENESULFONATE), DRY RE-DISPERSIBLE PELLETS, 768618-1G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1010, "currency": "MXN" } } }, { "id": "0", "description": "BISMUTH SELENIDE, GRANULAR (MELTED), =99.995% TRACE METALS BASIS, 33504-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1471, "currency": "MXN" } } }, { "id": "0", "description": "BISMUTH(III) TELLURIDE, POWDER, -325 MESH, 99.99% TRACE METALS BASIS, 733482-5G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 1693, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIETHYL-3-METHYLBENZAMIDE, 97%, CÓDIGO D100951-100G. DENSIDAD DE VAPOR\n6.7 (VS AIR)\n\nNIVEL DE CALIDAD\n100\n\nPRESIÓN DE VAPOR\n(0.01 MMHG ( 25 °C)\n\nANÁLISIS\n97%\n\nFORMULARIO\nLIQUID\n\nÍNDICE DE REFRACCIÓN\nN20/D 1.523 (LIT.)\n\nBP\n111 °C/1 MMHG\n160 °C/19 MMHG (LIT.)\n\nDENSIDAD\n0.998 G/ML AT 20 °C (LIT.)\n\nSMILES STRING\nCCN(CC)C(=O)C1CCCC(C)C1\n\nINCHI\n1S/C12H17NO/C1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/H6-9H,4-5H2,1-3H3\n\nINCHI KEY\nMMOXZBCLCQITDF-UHFFFAOYSA-N", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 698, "currency": "MXN" } } }, { "id": "0", "description": "PHOSPHATE BUFFERED SALINE P4417-100TAB", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2842, "currency": "MXN" } } }, { "id": "0", "description": "POLY(VINYLIDENE FLUORIDE)\n427144-100G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2686, "currency": "MXN" } } }, { "id": "0", "description": "1.5 KG DE EPSILON - CAPROLACTONA, PUREZA ) 97 %\nCATALOGO ALDRICH: 704067-500G", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 3, "unit": { "name": "KILOGRAMO", "value": { "amount": 2890, "currency": "MXN" } } }, { "id": "0", "description": "ZINC OXIDE, NANOPOWDER, (100NM, 544906-50G", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2288, "currency": "MXN" } } }, { "id": "0", "description": "HEXADECYLTRIMETHYLAMMONIUM BROMIDE, CAS: 57-09-0, SKU:H6269-250G,", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3074, "currency": "MXN" } } }, { "id": "0", "description": "AMMONIUM PHOSPHATE DIBASIC, CAS: 7783-28-0, SKU: 215996-500G,", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2836, "currency": "MXN" } } }, { "id": "0", "description": "N,N-DIMETILFORMAMIDA HPLC (2 L) NO. CATÁLOGO 270547-2L (3 BOTELLAS DE 2L)", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5037, "currency": "MXN" } } }, { "id": "0", "description": "2-PRONANOL SUITABLE FOR HPLC, 99.9% NO. CAT. 34863-4L", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 4084, "currency": "MXN" } } }, { "id": "0", "description": "METANOL SUITABLE FOR HPLC, 99.9% NO. CAT. 34860-4L-R", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3930, "currency": "MXN" } } }, { "id": "0", "description": "UNIT ELECTRONICS TTGO T-CALL V1.3 ESP32 CON SIM800L 240MHZ", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 6, "unit": { "name": "PIEZA", "value": { "amount": 600, "currency": "MXN" } } }, { "id": "0", "description": "TARJETA ARDUINO MEGA 2560 REV3", "classification": { "scheme": "CUCOP", "id": "25501-0014" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 1800, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO DE 6 MESES A SISTEMA DE REACCIÓN INNOVA, LIMPIEZA DE LINEAS DE ADICIÓN DE SOLVENTES, MANTENIMIENTO A SELLO MAGNÉTICO, CAMBIO DE EMPAQUES A AMBOS REACTORES, DESARMADO Y LIMPIEZA DE SISTEMA DE ADICIÓN DE SOLVENTES LGS.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 120000, "currency": "MXN" } } }, { "id": "0", "description": "MANTENIMIENTO A 6 MESES A SISTEMA DE REACCIÓN EN SEMICONTINUO, LIMPIEZA DE LINEAS DE ADICIÓN DE SOLVENTES, MANTENIMIENTO A SELLO MAGNÉTICO. CAMBIO DE EMPAQUES A AMBOS REACTORES", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 120000, "currency": "MXN" } } }, { "id": "0", "description": "CÓDIGO 105087 CATALOGO 5640-5 MATRAZ VOLUMETRICO DE VIDRIO 5ML CLASE A LINEA BLANCA C/TAPÓN ESMERILADO PIEZA(S) CON 1 PIEZA(S) PYREX", "classification": { "scheme": "CUCOP", "id": "25501-0024" }, "quantity": 12, "unit": { "name": "PIEZA", "value": { "amount": 310.76, "currency": "MXN" } } }, { "id": "0", "description": "D LIMONENO", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "LITRO", "value": { "amount": 4373.88, "currency": "MXN" } } }, { "id": "0", "description": "ACIDO ALGINICO SAL SODICA, 100GR", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 855, "currency": "MXN" } } }, { "id": "0", "description": "PAPEL PH (PUEDE SER EN ROLLITO)", "classification": { "scheme": "CUCOP", "id": "25501-0103" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 252.56, "currency": "MXN" } } }, { "id": "0", "description": "SENSIFAST TM KIT,", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 29495.4, "currency": "MXN" } } }, { "id": "0", "description": "500 GRS. NITRATO DE POTASIO A.C.S.", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 325, "currency": "MXN" } } }, { "id": "0", "description": "REACTIVO SPANDS PARA ANÁLISIS DE FLUORUROS , MARCA HACH, NO DE PARTE 44449, FRASCO DE 500 MILILITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1481.46, "currency": "MXN" } } }, { "id": "0", "description": "SOLUCIÓN ESTÁNDAR PAR FLUORUROS DE 100 MILIGRAMOS POR LITRO DE FLUORUROS, MARCA HACH, NO PARTE 23249, FRASCO DE 500 MILILITROS", "classification": { "scheme": "CUCOP", "id": "25101-0049" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2396.1, "currency": "MXN" } } }, { "id": "0", "description": "200 GRAMOS DE BORAX", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 200, "unit": { "name": "GRAMO", "value": { "amount": 150, "currency": "MXN" } } }, { "id": "0", "description": "INSTALACION DE TUBING 1/4 ACERO INOXIDABLE MENOR A 6 M INCLUYE VALVULA DE BOLA DE ACERO INOXIDABLE 1/4 OD Y CONEXIONES. INSTALACION PARA SUMINISTRAR NITROGENO DE FORMA REGULADA A EQUIPO SPEED EXTRACTOR E-916 BÜCHI.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 7500, "currency": "MXN" } } }, { "id": "0", "description": "REGULADOR CONCOA SERIE 200 2 ETAPA", "classification": { "scheme": "CUCOP", "id": "25501-0120" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 18500, "currency": "MXN" } } }, { "id": "0", "description": "REPARACIÓN A BOMBA DE VACÍO PARA ROTAVAPOR, MARCA BUCHI, MODELO V-700, NO. DE CATÁLOGO Z616842-1EA, NO. DE INVENTARIO CIQA A-150531 EL CUAL CONSISTE EN EL MAQUINADO DE CABEZAL, REPARACIÓN DE DIAFRAGMA, ASÍ COMO\nREINSTALACIÓN PARA 7 CFM.", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 23000, "currency": "MXN" } } }, { "id": "0", "description": "PORTA MUESTRA PARA SEM", "classification": { "scheme": "CUCOP", "id": "25501-0035" }, "quantity": 5, "unit": { "name": "PIEZA", "value": { "amount": 680, "currency": "MXN" } } }, { "id": "0", "description": "LOTE DE 10 PORTA MUESTRAS PARA XRD", "classification": { "scheme": "CUCOP", "id": "25501-0035" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5452, "currency": "MXN" } } }, { "id": "0", "description": "RESISTENCIAS DE CARTUCHO VARIAS MEDIDAS\nSEGÚN MUESTRA", "classification": { "scheme": "CUCOP", "id": "25501-0014" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 8620.69, "currency": "MXN" } } }, { "id": "0", "description": "RESISTENCIAS DE BANDA VARIAS MEDIDAS SEGÚN\nMUESTRA", "classification": { "scheme": "CUCOP", "id": "25501-0014" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5172.41, "currency": "MXN" } } }, { "id": "0", "description": "RECONFIGURACIÓN DE COAGULADOR 30 LITROS MARCA DELTA REACTORY", "classification": { "scheme": "CUCOP", "id": "35702-0004" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 21500, "currency": "MXN" } } }, { "id": "0", "description": "KIT DE TERMOPARES PARA REACTOR MARCA DELTA REACTORY", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 8600, "currency": "MXN" } } }, { "id": "0", "description": "RECTIFICACIÓN Y PULIDO DE MOLDE PARA PROBETAS DE BRILLO ACABADO ESPEJO", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 11100, "currency": "MXN" } } }, { "id": "0", "description": "10 BARRITAS DE 1/2X16CM LARGO ACERO INOX", "classification": { "scheme": "CUCOP", "id": "25501-0090" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2700, "currency": "MXN" } } }, { "id": "0", "description": "PORTA ELECTRODO DE TEFLON", "classification": { "scheme": "CUCOP", "id": "25501-0087" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 1500, "currency": "MXN" } } }, { "id": "0", "description": "CONEXIÓN RECTA PARA ELECTRODO DE TEFLON", "classification": { "scheme": "CUCOP", "id": "25501-0087" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 3500, "currency": "MXN" } } }, { "id": "0", "description": "10 BARRITAS DE 1/2 X 16 CM LARGO (BARRA DE ACERO PARA MOLINO)", "classification": { "scheme": "CUCOP", "id": "25501-0065" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 2700, "currency": "MXN" } } }, { "id": "0", "description": "REGULADOR CONCOA CON PRESIÓN MÁXIMA DE\nTRABAJO DE 250PSI", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 10000, "currency": "MXN" } } }, { "id": "0", "description": "KIT DE CONEXIONES, REEMPLAZO DE MANÓMETRO Y VÁLVULA DE SEGURIDAD PARA ENTRADA DE LINEA AL EDIFICIO, INCLUYE INSTALACIÓN Y PRUEBAS DE HERMETICIDAD.", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 5500, "currency": "MXN" } } }, { "id": "0", "description": "MANGUERA FLEXIBLE DE 3 M PARA LÍNEA DE NITRÓGENO LÍQUIDO", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 5500, "currency": "MXN" } } }, { "id": "0", "description": "REGULADOR DE DOS ETAPAS PARA SALIDA DE DEWAR", "classification": { "scheme": "CUCOP", "id": "25501-0009" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 20000, "currency": "MXN" } } }, { "id": "0", "description": "MANÓMETRO GLICERINA DE 0-30 PSI DE PRESIÓN", "classification": { "scheme": "CUCOP", "id": "29101-0230" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 600, "currency": "MXN" } } }, { "id": "0", "description": "TIJERA MANUAL PARA PODA MARCA STIHL MODELO PP10", "classification": { "scheme": "CUCOP", "id": "29101-0364" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 900, "currency": "MXN" } } }, { "id": "0", "description": "TIJERA MANUAL PARA PODA MARCA STIHL MODELO PP30", "classification": { "scheme": "CUCOP", "id": "29101-0364" }, "quantity": 3, "unit": { "name": "PIEZA", "value": { "amount": 1050, "currency": "MXN" } } }, { "id": "0", "description": "MANÓMETRO GLICERINA DE 0-60 PSI DE PRESIÓN", "classification": { "scheme": "CUCOP", "id": "29101-0364" }, "quantity": 2, "unit": { "name": "PIEZA", "value": { "amount": 650, "currency": "MXN" } } }, { "id": "0", "description": "10 M MANGUERA DE SILICÓN DIÁMETRO EXTERIOR 13 MM, INTERIOR 8 MM APROX", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "METRO", "value": { "amount": 3500, "currency": "MXN" } } }, { "id": "0", "description": "REPARACION DE LINEA DE NITROGENO LIQUIDO, CONEXIONES Y MANOMETROS", "classification": { "scheme": "CUCOP", "id": "35401-0003" }, "quantity": 1, "unit": { "name": "SERVICIO", "value": { "amount": 31000, "currency": "MXN" } } }, { "id": "0", "description": "ADQUISICIÓN DE ACCESORIO (BOMBA DE ALTO VACÍO) PARA EQUIPO LIOFILIZADOR", "classification": { "scheme": "CUCOP", "id": "29501-0005" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 40000, "currency": "MXN" } } }, { "id": "0", "description": "200 LITROS DE CICLOHEXANO", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 15000, "currency": "MXN" } } }, { "id": "0", "description": "200 LITROS DE TOLUENO", "classification": { "scheme": "CUCOP", "id": "25101-0018" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 15000, "currency": "MXN" } } }, { "id": "0", "description": "ENGRANE Y 3 BANDAS REACTOR 1 L", "classification": { "scheme": "CUCOP", "id": "25501-0072" }, "quantity": 1, "unit": { "name": "PIEZA", "value": { "amount": 15000, "currency": "MXN" } } } ], "documents": [ { "id": "1", "title": "CONVOCATORIA LA-03890U001-N-31-2023.doc", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:48.786Z" }, { "id": "2", "title": "PARTIDAS A LICITAR COMPRANET.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:51.379Z" }, { "id": "3", "title": "MODELO DE CONTRATO.docx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:55.971Z" }, { "id": "4", "title": "PLANO PARA INATALACION DE BARRAS DE SEGURIDAD EN SANITARIOS..pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:53.320Z" }, { "id": "5", "title": "CHECK LIST.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:54.553Z" }, { "id": "6", "title": "ACTA DE JUNTA DE ACLARACIONES.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:11:58.204Z" }, { "id": "7", "title": "ACTA DE APERTURA.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:12:01.329Z" }, { "id": "8", "title": "ACTA DE FALLO.pdf", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:12:04.777Z" }, { "id": "9", "title": "PARTIDAS A LICITAR COMPRANET.xlsx", "url": "https://comprasmx.buengobierno.gob.mx/sitiopublico/#/sitiopublico/detalle/d718ddd1266543be9dadebdc04d0ae29/procedimiento", "documentType": "biddingDocuments", "datePublished": "2025-12-07T12:12:06.170Z" } ] }, "awards": [ { "id": "1", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV", "name": "CONTROL TECNICO Y REPRESENTACIONES SA DE CV" } ], "value": { "amount": 115736.68, "currency": "MXN" } }, { "id": "2", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "HELS DE AGUASCALIENTES SA DE CV", "name": "HELS DE AGUASCALIENTES SA DE CV" } ], "value": { "amount": 234968.1, "currency": "MXN" } }, { "id": "3", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "SIGMA-ALDRICH QUIMICA S DE RL DE CV", "name": "SIGMA-ALDRICH QUIMICA S DE RL DE CV" } ], "value": { "amount": 302222.84, "currency": "MXN" } }, { "id": "4", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "YAIR AGUSTIN DE SANTIAGO RODRIGUEZ", "name": "YAIR AGUSTIN DE SANTIAGO RODRIGUEZ" } ], "value": { "amount": 293016, "currency": "MXN" } }, { "id": "5", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "PRODUCTOS Y EQUIPOS BIOTECNOLOGICOS SA DE CV", "name": "PRODUCTOS Y EQUIPOS BIOTECNOLOGICOS SA DE CV" } ], "value": { "amount": 86585.36, "currency": "MXN" } }, { "id": "6", "status": "active", "date": "2023-10-02T19:00:00.000Z", "suppliers": [ { "id": "ISAEL DE SANTIAGO RODRIGUEZ", "name": "ISAEL DE SANTIAGO RODRIGUEZ" } ], "value": { "amount": 362438.32, "currency": "MXN" } } ], "extensions": { "source": "ComprasMX", "canonical": "https://licitia.com.mx/licitacion/la-38-90u-03890u001-n-31-2023", "license": "https://creativecommons.org/licenses/by/4.0/", "ocidPrefixRegistered": false } }